{"diffoscope-json-version": 1, "source1": "/srv/reproducible-results/rbuild-debian/r-b-build.paw2Fanr/b1/libdc1394_2.2.6-4_amd64.changes", "source2": "/srv/reproducible-results/rbuild-debian/r-b-build.paw2Fanr/b2/libdc1394_2.2.6-4_amd64.changes", "unified_diff": null, "details": [{"source1": "Files", "source2": "Files", "unified_diff": "@@ -1,7 +1,7 @@\n \n  98782a79dac0bc1fce45070eba308a74 227988 debug optional libdc1394-25-dbgsym_2.2.6-4_amd64.deb\n  dbd4d7903cdb03e7add2b9446e9c5114 108516 libs optional libdc1394-25_2.2.6-4_amd64.deb\n  7466a71644ce6fdf906816b9ee217aae 134100 libdevel optional libdc1394-dev_2.2.6-4_amd64.deb\n- 99928e1ea338bc6c58c8330512f0f469 455288 doc optional libdc1394-doc_2.2.6-4_all.deb\n+ c56a39591b93f3b65e5b0460fd1331e7 454944 doc optional libdc1394-doc_2.2.6-4_all.deb\n  6551bf40ee1da5bfa4fe1984622977ff 5756 debug optional libdc1394-utils-dbgsym_2.2.6-4_amd64.deb\n  7bbb1e242b7a7c8910f69f44e2f0ca18 31992 utils optional libdc1394-utils_2.2.6-4_amd64.deb\n"}, {"source1": "libdc1394-doc_2.2.6-4_all.deb", "source2": "libdc1394-doc_2.2.6-4_all.deb", "unified_diff": null, "details": [{"source1": "file list", "source2": "file list", "unified_diff": "@@ -1,3 +1,3 @@\n -rw-r--r--   0        0        0        4 2021-08-10 20:53:45.000000 debian-binary\n -rw-r--r--   0        0        0     4572 2021-08-10 20:53:45.000000 control.tar.xz\n--rw-r--r--   0        0        0   450524 2021-08-10 20:53:45.000000 data.tar.xz\n+-rw-r--r--   0        0        0   450180 2021-08-10 20:53:45.000000 data.tar.xz\n"}, {"source1": "control.tar.xz", "source2": "control.tar.xz", "unified_diff": null, "details": [{"source1": "control.tar", "source2": "control.tar", "unified_diff": null, "details": [{"source1": "./md5sums", "source2": "./md5sums", "unified_diff": null, "details": [{"source1": "./md5sums", "source2": "./md5sums", "comments": ["Files differ"], "unified_diff": null}]}]}]}, {"source1": "data.tar.xz", "source2": "data.tar.xz", "unified_diff": null, "details": [{"source1": "data.tar", "source2": "data.tar", "unified_diff": null, "details": [{"source1": "file list", "source2": "file list", "unified_diff": "@@ -145,10 +145,10 @@\n -rw-r--r--   0 root         (0) root         (0)      184 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/tab_s.png\n -rw-r--r--   0 root         (0) root         (0)      188 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/tab_sd.png\n -rw-r--r--   0 root         (0) root         (0)    10560 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/tabs.css\n -rw-r--r--   0 root         (0) root         (0)     9872 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/types_8h.html\n -rw-r--r--   0 root         (0) root         (0)     3282 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/unionfw__cdev__event.html\n -rw-r--r--   0 root         (0) root         (0)    23756 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/utils_8h.html\n -rw-r--r--   0 root         (0) root         (0)    47788 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/html/video_8h.html\n--rw-r--r--   0 root         (0) root         (0)   279959 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/libdc1394.pdf.gz\n+-rw-r--r--   0 root         (0) root         (0)   279593 2021-08-10 20:53:45.000000 ./usr/share/doc/libdc1394-doc/libdc1394.pdf.gz\n drwxr-xr-x   0 root         (0) root         (0)        0 2021-08-10 20:53:45.000000 ./usr/share/doc-base/\n -rw-r--r--   0 root         (0) root         (0)      378 2020-09-22 20:24:57.000000 ./usr/share/doc-base/libdc1394-doc.libdc1394-doc\n"}, {"source1": "./usr/share/doc/libdc1394-doc/libdc1394.pdf.gz", "source2": "./usr/share/doc/libdc1394-doc/libdc1394.pdf.gz", "unified_diff": null, "details": [{"source1": "libdc1394.pdf", "source2": "libdc1394.pdf", "unified_diff": null, "details": [{"source1": "pdftotext {} -", "source2": "pdftotext {} -", "unified_diff": "@@ -551,601 +551,601 @@\n \n 28\n \n 4.1.4.12 dc1394_reset_bus() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 29\n \n-4.2 dc1394/control.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2 dc1394/conversions.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 29\n \n 4.2.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-31\n-\n-4.2.2 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-31\n-\n-4.2.2.1 dc1394feature_info_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-31\n+29\n \n-4.2.2.2 dc1394featureset_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.2 Enumeration Type Documentation\n \n-32\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.3 Enumeration Type Documentation\n+30\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.2.1 dc1394bayer_method_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-32\n+30\n \n-4.2.3.1 dc1394feature_mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.2.2 dc1394stereo_method_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-32\n+30\n \n-4.2.3.2 dc1394feature_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.3 Function Documentation\n \n-32\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.3.3 dc1394trigger_mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+30\n \n-32\n+4.2.3.1 dc1394_bayer_decoding_16bit() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.3.4 dc1394trigger_polarity_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+30\n \n-32\n+4.2.3.2 dc1394_bayer_decoding_8bit() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.3.5 dc1394trigger_source_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+30\n \n-32\n+4.2.3.3 dc1394_convert_frames() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.4 Function Documentation\n+30\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.3.4 dc1394_convert_to_MONO8() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.4.1 dc1394_camera_reset()\n+31\n \n-32\n+4.2.3.5 dc1394_convert_to_RGB8() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+31\n \n-32\n+4.2.3.6 dc1394_convert_to_YUV422() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.4.2 dc1394_camera_set_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+31\n \n-33\n+4.2.3.7 dc1394_debayer_frames() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.2.4.3 dc1394_external_trigger_get_mode()\n+31\n \n-. . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.3.8 dc1394_deinterlace_stereo() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-33\n+32\n \n-4.2.4.4 dc1394_external_trigger_get_polarity() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.2.3.9 dc1394_deinterlace_stereo_frames() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-33\n+32\n \n-4.2.4.5 dc1394_external_trigger_get_power() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3 dc1394/dc1394.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-33\n+32\n \n-4.2.4.6 dc1394_external_trigger_get_source() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.3.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-33\n+32\n \n-4.2.4.7 dc1394_external_trigger_get_supported_sources() . . . . . . . . . . . . . . . . .\n+4.4 dc1394/format7.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 33\n \n-4.2.4.8 dc1394_external_trigger_has_polarity() . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.9 dc1394_external_trigger_set_mode()\n-\n-. . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.2 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.10 dc1394_external_trigger_set_polarity() . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.2.1 dc1394format7mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.11 dc1394_external_trigger_set_power() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.2.2 dc1394format7modeset_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.12 dc1394_external_trigger_set_source() . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3 Function Documentation\n+\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.13 dc1394_feature_get() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.1 dc1394_format7_get_color_coding() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 34\n \n-4.2.4.14 dc1394_feature_get_absolute_boundaries() . . . . . . . . . . . . . . . . . . . .\n+4.4.3.2 dc1394_format7_get_color_codings() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 35\n \n-4.2.4.15 dc1394_feature_get_absolute_control() . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.3 dc1394_format7_get_color_filter() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 35\n \n-4.2.4.16 dc1394_feature_get_absolute_value() . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.4 dc1394_format7_get_data_depth() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 35\n \n-4.2.4.17 dc1394_feature_get_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.5 dc1394_format7_get_frame_interval() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 35\n \n-4.2.4.18 dc1394_feature_get_boundaries()\n-\n-. . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.6 dc1394_format7_get_image_position() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 35\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.7 dc1394_format7_get_image_size() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 36\n \n-4.2.4.20 dc1394_feature_get_modes() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.8 dc1394_format7_get_max_image_size() . . . . . . . . . . . . . . . . . . . . . . .\n \n 36\n \n-4.2.4.21 dc1394_feature_get_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.9 dc1394_format7_get_mode_info() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 36\n \n-4.2.4.22 dc1394_feature_get_value() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-36\n+4.4.3.10 dc1394_format7_get_modeset()\n \n-4.2.4.23 dc1394_feature_has_absolute_control() . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 36\n \n-4.2.4.24 dc1394_feature_is_present() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.11 dc1394_format7_get_packet_parameters() . . . . . . . . . . . . . . . . . . . . .\n \n 36\n \n-4.2.4.19 dc1394_feature_get_mode()\n-\n-Generated by Doxygen\n-\n-\fv\n-\n-4.2.4.25 dc1394_feature_is_readable() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.12 dc1394_format7_get_packet_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 37\n \n-4.2.4.26 dc1394_feature_is_switchable() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.13 dc1394_format7_get_packets_per_frame() . . . . . . . . . . . . . . . . . . . . .\n \n 37\n \n-4.2.4.27 dc1394_feature_print()\n-\n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-37\n-\n-4.2.4.28 dc1394_feature_print_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+Generated by Doxygen\n \n-37\n+\fv\n \n-4.2.4.29 dc1394_feature_set_absolute_control() . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.14 dc1394_format7_get_pixel_number() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 37\n \n-4.2.4.30 dc1394_feature_set_absolute_value()\n+4.4.3.15 dc1394_format7_get_recommended_packet_size()\n \n-. . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . .\n \n 37\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.16 dc1394_format7_get_roi() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-38\n+37\n \n-4.2.4.32 dc1394_feature_set_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.17 dc1394_format7_get_total_bytes() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 38\n \n-4.2.4.33 dc1394_feature_set_value() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.18 dc1394_format7_get_unit_position() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 38\n \n-4.2.4.34 dc1394_feature_temperature_get_value()\n-\n-. . . . . . . . . . . . . . . . . . . . .\n+4.4.3.19 dc1394_format7_get_unit_size() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 38\n \n-4.2.4.35 dc1394_feature_temperature_set_value() . . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.20 dc1394_format7_set_color_coding() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 38\n \n-4.2.4.36 dc1394_feature_whitebalance_get_value() . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.21 dc1394_format7_set_image_position() . . . . . . . . . . . . . . . . . . . . . . .\n \n 38\n \n-4.2.4.37 dc1394_feature_whitebalance_set_value() . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.22 dc1394_format7_set_image_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 39\n \n-4.2.4.38 dc1394_feature_whiteshading_get_value() . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.23 dc1394_format7_set_packet_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 39\n \n-4.2.4.39 dc1394_feature_whiteshading_set_value() . . . . . . . . . . . . . . . . . . . . .\n+4.4.3.24 dc1394_format7_set_roi() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 39\n \n-4.2.4.40 dc1394_memory_busy() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.5 dc1394/iso.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 39\n \n-4.2.4.41 dc1394_memory_load() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-39\n-\n-4.2.4.42 dc1394_memory_save() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-40\n-\n-4.2.4.43 dc1394_pio_get() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.5.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 40\n \n-4.2.4.44 dc1394_pio_set() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.5.2 Function Documentation\n \n-40\n-\n-4.2.4.45 dc1394_software_trigger_get_power() . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 40\n \n-4.2.4.46 dc1394_software_trigger_set_power() . . . . . . . . . . . . . . . . . . . . . . .\n+4.5.2.1 dc1394_iso_allocate_bandwidth() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 40\n \n-4.3 dc1394/conversions.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.5.2.2 dc1394_iso_allocate_channel() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 40\n \n-4.3.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-41\n-\n-4.3.2 Enumeration Type Documentation\n-\n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.5.2.3 dc1394_iso_release_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 41\n \n-4.3.2.1 dc1394bayer_method_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.5.2.4 dc1394_iso_release_bandwidth()\n \n-41\n-\n-4.3.2.2 dc1394stereo_method_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 41\n \n-4.2.4.31 dc1394_feature_set_mode()\n-\n-4.3.3 Function Documentation\n-\n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.5.2.5 dc1394_iso_release_channel() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 42\n \n-4.3.3.1 dc1394_bayer_decoding_16bit() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.5.2.6 dc1394_iso_set_persist() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 42\n \n-4.3.3.2 dc1394_bayer_decoding_8bit() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6 dc1394/capture.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-42\n+43\n \n-4.3.3.3 dc1394_convert_frames() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-42\n+44\n \n-4.3.3.4 dc1394_convert_to_MONO8() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.2 Macro Definition Documentation\n \n-42\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.3.3.5 dc1394_convert_to_RGB8() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+44\n \n-43\n+4.6.2.1 DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC . . . . . . . . . . . . . . . . . .\n \n-4.3.3.6 dc1394_convert_to_YUV422() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+44\n \n-43\n+4.6.3 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.3.3.7 dc1394_debayer_frames() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+44\n \n-43\n+4.6.3.1 dc1394capture_callback_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.3.3.8 dc1394_deinterlace_stereo() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+44\n \n-43\n+4.6.4 Enumeration Type Documentation\n \n-4.3.3.9 dc1394_deinterlace_stereo_frames() . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 44\n \n-4.4 dc1394/dc1394.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.4.1 dc1394capture_policy_t\n \n-44\n-\n-4.4.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 44\n \n-4.5 dc1394/format7.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 44\n \n-4.5.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.5 Function Documentation\n \n-46\n+4.6.5.1 dc1394_capture_dequeue()\n \n-4.5.2 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-46\n+44\n \n-Generated by Doxygen\n+4.6.5.2 dc1394_capture_enqueue()\n \n-\fvi\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.2.1 dc1394format7mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+45\n \n-46\n+4.6.5.3 dc1394_capture_get_fileno() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.2.2 dc1394format7modeset_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+45\n \n-46\n+4.6.5.4 dc1394_capture_is_frame_corrupt() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-4.5.3 Function Documentation\n+45\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.5.5 dc1394_capture_set_callback() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-46\n+45\n \n-4.5.3.1 dc1394_format7_get_color_coding() . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.5.6 dc1394_capture_setup() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-46\n+45\n \n-4.5.3.2 dc1394_format7_get_color_codings() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.6.5.7 dc1394_capture_stop() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-46\n+45\n \n-4.5.3.3 dc1394_format7_get_color_filter() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7 dc1394/control.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-47\n+46\n \n-4.5.3.4 dc1394_format7_get_data_depth() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-47\n+48\n \n-4.5.3.5 dc1394_format7_get_frame_interval() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.2 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-47\n+48\n \n-4.5.3.6 dc1394_format7_get_image_position() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.2.1 dc1394feature_info_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-47\n+48\n \n-4.5.3.7 dc1394_format7_get_image_size() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.2.2 dc1394featureset_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-47\n+48\n \n-4.5.3.8 dc1394_format7_get_max_image_size() . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.3 Enumeration Type Documentation\n \n-48\n+Generated by Doxygen\n \n-4.5.3.9 dc1394_format7_get_mode_info() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 48\n \n-4.5.3.10 dc1394_format7_get_modeset()\n+\fvi\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.3.1 dc1394feature_mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 48\n \n-4.5.3.11 dc1394_format7_get_packet_parameters() . . . . . . . . . . . . . . . . . . . . .\n+4.7.3.2 dc1394feature_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 48\n \n-4.5.3.12 dc1394_format7_get_packet_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.3.3 dc1394trigger_mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-48\n+49\n \n-4.5.3.13 dc1394_format7_get_packets_per_frame() . . . . . . . . . . . . . . . . . . . . .\n+4.7.3.4 dc1394trigger_polarity_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 49\n \n-4.5.3.14 dc1394_format7_get_pixel_number() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.3.5 dc1394trigger_source_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 49\n \n-4.5.3.15 dc1394_format7_get_recommended_packet_size()\n+4.7.4 Function Documentation\n \n-. . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+\n+4.7.4.1 dc1394_camera_reset()\n \n 49\n \n-4.5.3.16 dc1394_format7_get_roi() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 49\n \n-4.5.3.17 dc1394_format7_get_total_bytes() . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.2 dc1394_camera_set_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 49\n \n-4.5.3.18 dc1394_format7_get_unit_position() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.3 dc1394_external_trigger_get_mode()\n+\n+. . . . . . . . . . . . . . . . . . . . . . . .\n+\n+49\n+\n+4.7.4.4 dc1394_external_trigger_get_polarity() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 50\n \n-4.5.3.19 dc1394_format7_get_unit_size() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.5 dc1394_external_trigger_get_power() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 50\n \n-4.5.3.20 dc1394_format7_set_color_coding() . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.6 dc1394_external_trigger_get_source() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 50\n \n-4.5.3.21 dc1394_format7_set_image_position() . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.7 dc1394_external_trigger_get_supported_sources() . . . . . . . . . . . . . . . . .\n \n 50\n \n-4.5.3.22 dc1394_format7_set_image_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.8 dc1394_external_trigger_has_polarity() . . . . . . . . . . . . . . . . . . . . . . .\n \n 50\n \n-4.5.3.23 dc1394_format7_set_packet_size() . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.9 dc1394_external_trigger_set_mode()\n+\n+. . . . . . . . . . . . . . . . . . . . . . . .\n+\n+50\n+\n+4.7.4.10 dc1394_external_trigger_set_polarity() . . . . . . . . . . . . . . . . . . . . . . .\n \n 51\n \n-4.5.3.24 dc1394_format7_set_roi() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.11 dc1394_external_trigger_set_power() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 51\n \n-4.6 dc1394/iso.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.12 dc1394_external_trigger_set_source() . . . . . . . . . . . . . . . . . . . . . . .\n \n 51\n \n-4.6.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.13 dc1394_feature_get() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 51\n \n-4.6.2 Function Documentation\n+4.7.4.14 dc1394_feature_get_absolute_boundaries() . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+51\n+\n+4.7.4.15 dc1394_feature_get_absolute_control() . . . . . . . . . . . . . . . . . . . . . . .\n+\n+51\n+\n+4.7.4.16 dc1394_feature_get_absolute_value() . . . . . . . . . . . . . . . . . . . . . . .\n \n 52\n \n-4.6.2.1 dc1394_iso_allocate_bandwidth() . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.17 dc1394_feature_get_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 52\n \n-4.6.2.2 dc1394_iso_allocate_channel() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.18 dc1394_feature_get_boundaries()\n+\n+. . . . . . . . . . . . . . . . . . . . . . . . .\n \n 52\n \n-4.6.2.3 dc1394_iso_release_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+\n+52\n+\n+4.7.4.20 dc1394_feature_get_modes() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+\n+52\n+\n+4.7.4.21 dc1394_feature_get_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+\n+52\n+\n+4.7.4.22 dc1394_feature_get_value() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 53\n \n-4.6.2.4 dc1394_iso_release_bandwidth()\n+4.7.4.23 dc1394_feature_has_absolute_control() . . . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . .\n+53\n+\n+4.7.4.24 dc1394_feature_is_present() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+\n+53\n+\n+4.7.4.25 dc1394_feature_is_readable() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+\n+53\n+\n+4.7.4.26 dc1394_feature_is_switchable() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+\n+53\n+\n+4.7.4.27 dc1394_feature_print()\n+\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 53\n \n-4.6.2.5 dc1394_iso_release_channel() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.28 dc1394_feature_print_all() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 54\n \n-4.6.2.6 dc1394_iso_set_persist() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.29 dc1394_feature_set_absolute_control() . . . . . . . . . . . . . . . . . . . . . . .\n \n 54\n \n-4.7 dc1394/capture.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.30 dc1394_feature_set_absolute_value()\n+\n+. . . . . . . . . . . . . . . . . . . . . . .\n \n 54\n \n-4.7.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+. . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-55\n+54\n \n-4.7.2 Macro Definition Documentation\n+4.7.4.32 dc1394_feature_set_power() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+54\n+\n+4.7.4.33 dc1394_feature_set_value() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+\n+54\n+\n+4.7.4.34 dc1394_feature_temperature_get_value()\n+\n+. . . . . . . . . . . . . . . . . . . . .\n \n 55\n \n-4.7.2.1 DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC . . . . . . . . . . . . . . . . . .\n+4.7.4.35 dc1394_feature_temperature_set_value() . . . . . . . . . . . . . . . . . . . . . .\n \n 55\n \n-4.7.3 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.36 dc1394_feature_whitebalance_get_value() . . . . . . . . . . . . . . . . . . . . .\n \n-56\n+55\n \n-4.7.3.1 dc1394capture_callback_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.19 dc1394_feature_get_mode()\n \n-56\n+4.7.4.31 dc1394_feature_set_mode()\n \n Generated by Doxygen\n \n \fvii\n \n-4.7.4 Enumeration Type Documentation\n+4.7.4.37 dc1394_feature_whitebalance_set_value() . . . . . . . . . . . . . . . . . . . . .\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+55\n \n-56\n+4.7.4.38 dc1394_feature_whiteshading_get_value() . . . . . . . . . . . . . . . . . . . . .\n \n-4.7.4.1 dc1394capture_policy_t\n+55\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.39 dc1394_feature_whiteshading_set_value() . . . . . . . . . . . . . . . . . . . . .\n \n 56\n \n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.40 dc1394_memory_busy() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 56\n \n-4.7.5 Function Documentation\n-\n-4.7.5.1 dc1394_capture_dequeue()\n-\n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.41 dc1394_memory_load() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 56\n \n-4.7.5.2 dc1394_capture_enqueue()\n-\n-. . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.42 dc1394_memory_save() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 56\n \n-4.7.5.3 dc1394_capture_get_fileno() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.43 dc1394_pio_get() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 56\n \n-4.7.5.4 dc1394_capture_is_frame_corrupt() . . . . . . . . . . . . . . . . . . . . . . . . .\n-\n-57\n-\n-4.7.5.5 dc1394_capture_set_callback() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.44 dc1394_pio_set() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-57\n+56\n \n-4.7.5.6 dc1394_capture_setup() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.45 dc1394_software_trigger_get_power() . . . . . . . . . . . . . . . . . . . . . . .\n \n 57\n \n-4.7.5.7 dc1394_capture_stop() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n+4.7.4.46 dc1394_software_trigger_set_power() . . . . . . . . . . . . . . . . . . . . . . .\n \n 57\n \n 4.8 dc1394/log.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 57\n \n 4.8.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-58\n+57\n \n 4.8.2 Enumeration Type Documentation\n \n . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 58\n \n@@ -1165,15 +1165,15 @@\n \n 4.8.3.1 dc1394_log_debug() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 58\n \n 4.8.3.2 dc1394_log_error() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-59\n+58\n \n 4.8.3.3 dc1394_log_register_handler() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 59\n \n 4.8.3.4 dc1394_log_set_default_handler() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1181,29 +1181,29 @@\n \n 4.8.3.5 dc1394_log_warning() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 59\n \n 4.9 dc1394/register.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-60\n+59\n \n 4.9.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 60\n \n 4.9.2 Function Documentation\n \n . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-61\n+60\n \n 4.9.2.1 dc1394_get_absolute_register() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-61\n+60\n \n 4.9.2.2 dc1394_get_adv_control_registers() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 61\n \n 4.9.2.3 dc1394_get_control_registers() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1215,15 +1215,15 @@\n \n 4.9.2.5 dc1394_get_PIO_register() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 61\n \n 4.9.2.6 dc1394_get_registers() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-62\n+61\n \n 4.9.2.7 dc1394_get_SIO_register() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 62\n \n 4.9.2.8 dc1394_get_strobe_register()\n \n@@ -1237,15 +1237,15 @@\n \n 4.9.2.10 dc1394_set_adv_control_registers() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 62\n \n 4.9.2.11 dc1394_set_control_registers() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-63\n+62\n \n 4.9.2.12 dc1394_set_format7_register() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 63\n \n 4.9.2.13 dc1394_set_PIO_register() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1257,15 +1257,15 @@\n \n 4.9.2.15 dc1394_set_SIO_register() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 63\n \n 4.9.2.16 dc1394_set_strobe_register() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-64\n+63\n \n 4.10 dc1394/types.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 64\n \n 4.10.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1281,19 +1281,19 @@\n \n 4.10.2.1 dc1394bool_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 64\n \n 4.10.2.2 dc1394byte_order_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-65\n+64\n \n 4.10.2.3 dc1394color_coding_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-65\n+64\n \n 4.10.2.4 dc1394color_filter_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 65\n \n 4.10.2.5 dc1394switch_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1323,23 +1323,23 @@\n \n 66\n \n 4.11.2.3 dc1394_feature_get_string()\n \n . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-67\n+66\n \n 4.11.2.4 dc1394_framerate_as_float() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-67\n+66\n \n 4.11.2.5 dc1394_get_color_coding_bit_size() . . . . . . . . . . . . . . . . . . . . . . . .\n \n-67\n+66\n \n 4.11.2.6 dc1394_get_color_coding_data_depth() . . . . . . . . . . . . . . . . . . . . . .\n \n 67\n \n 4.11.2.7 dc1394_get_color_coding_from_video_mode() . . . . . . . . . . . . . . . . . . .\n \n@@ -1349,23 +1349,23 @@\n \n . . . . . . . . . . . . . . . . . . .\n \n 67\n \n 4.11.2.9 dc1394_is_color() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-68\n+67\n \n 4.11.2.10 dc1394_is_same_camera() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-68\n+67\n \n 4.11.2.11 dc1394_is_video_mode_scalable() . . . . . . . . . . . . . . . . . . . . . . . .\n \n-68\n+67\n \n 4.11.2.12 dc1394_is_video_mode_still_image() . . . . . . . . . . . . . . . . . . . . . . .\n \n 68\n \n 4.12 dc1394/vendor/avt.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1381,23 +1381,23 @@\n \n 4.12.2.1 dc1394_avt_get_advanced_feature_inquiry() . . . . . . . . . . . . . . . . . . . .\n \n 70\n \n 4.12.2.2 dc1394_avt_get_aoi() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-71\n+70\n \n 4.12.2.3 dc1394_avt_get_auto_gain() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-71\n+70\n \n 4.12.2.4 dc1394_avt_get_auto_shutter() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-71\n+70\n \n 4.12.2.5 dc1394_avt_get_blemish()\n \n 71\n \n . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1405,201 +1405,201 @@\n \n . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 71\n \n 4.12.2.7 dc1394_avt_get_color_corr() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-72\n+71\n \n 4.12.2.8 dc1394_avt_get_deferred_trans() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-72\n+71\n \n 4.12.2.9 dc1394_avt_get_dsnu() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-72\n+71\n \n 4.12.2.10 dc1394_avt_get_extented_shutter() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 72\n \n 4.12.2.11 dc1394_avt_get_frame_info() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 72\n \n 4.12.2.12 dc1394_avt_get_gpdata_info() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-73\n+72\n \n 4.12.2.13 dc1394_avt_get_hsnr() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-73\n+72\n \n 4.12.2.14 dc1394_avt_get_io() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-73\n+72\n \n 4.12.2.15 dc1394_avt_get_lut() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-73\n+72\n \n 4.12.2.16 dc1394_avt_get_lut_info() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 73\n \n 4.12.2.17 dc1394_avt_get_lut_mem_ctrl() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-74\n+73\n \n Generated by Doxygen\n \n \fix\n \n 4.12.2.18 dc1394_avt_get_MaxResolution() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-74\n+73\n \n 4.12.2.19 dc1394_avt_get_mirror() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-74\n+73\n \n 4.12.2.20 dc1394_avt_get_multiple_slope() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-74\n+73\n \n 4.12.2.21 dc1394_avt_get_shading() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 74\n \n 4.12.2.22 dc1394_avt_get_shading_info() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-75\n+74\n \n 4.12.2.23 dc1394_avt_get_shading_mem_ctrl() . . . . . . . . . . . . . . . . . . . . . . .\n \n-75\n+74\n \n 4.12.2.24 dc1394_avt_get_test_images()\n \n . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-75\n+74\n \n 4.12.2.25 dc1394_avt_get_timebase() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-75\n+74\n \n 4.12.2.26 dc1394_avt_get_trigger_delay() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-75\n+74\n \n 4.12.2.27 dc1394_avt_get_version() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 75\n \n 4.12.2.28 dc1394_avt_print_advanced_feature() . . . . . . . . . . . . . . . . . . . . . . .\n \n-76\n+75\n \n 4.12.2.29 dc1394_avt_read_gpdata()\n \n . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-76\n+75\n \n 4.12.2.30 dc1394_avt_read_shading_img() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-76\n+75\n \n 4.12.2.31 dc1394_avt_reset() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-76\n+75\n \n 4.12.2.32 dc1394_avt_reset_frame_info() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-76\n+75\n \n 4.12.2.33 dc1394_avt_set_aoi() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 76\n \n 4.12.2.34 dc1394_avt_set_auto_gain() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-77\n+76\n \n 4.12.2.35 dc1394_avt_set_auto_shutter() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-77\n+76\n \n 4.12.2.36 dc1394_avt_set_blemish() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-77\n+76\n \n 4.12.2.37 dc1394_avt_set_channel_adjust() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-77\n+76\n \n 4.12.2.38 dc1394_avt_set_color_corr() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 77\n \n 4.12.2.39 dc1394_avt_set_deferred_trans() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-78\n+77\n \n 4.12.2.40 dc1394_avt_set_dsnu() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-78\n+77\n \n 4.12.2.41 dc1394_avt_set_extented_shutter() . . . . . . . . . . . . . . . . . . . . . . . .\n \n-78\n+77\n \n 4.12.2.42 dc1394_avt_set_hsnr() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 78\n \n 4.12.2.43 dc1394_avt_set_io() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 78\n \n 4.12.2.44 dc1394_avt_set_lut() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-79\n+78\n \n 4.12.2.45 dc1394_avt_set_lut_mem_ctrl() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-79\n+78\n \n 4.12.2.46 dc1394_avt_set_mirror() . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-79\n+78\n \n 4.12.2.47 dc1394_avt_set_multiple_slope() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 79\n \n 4.12.2.48 dc1394_avt_set_shading() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 79\n \n 4.12.2.49 dc1394_avt_set_shading_mem_ctrl() . . . . . . . . . . . . . . . . . . . . . . .\n \n-80\n+79\n \n 4.12.2.50 dc1394_avt_set_test_images()\n \n . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-80\n+79\n \n 4.12.2.51 dc1394_avt_set_timebase() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-80\n+79\n \n 4.12.2.52 dc1394_avt_set_trigger_delay() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 80\n \n 4.12.2.53 dc1394_avt_write_gpdata() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1607,15 +1607,15 @@\n \n 4.12.2.54 dc1394_avt_write_shading_img() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 80\n \n 4.13 dc1394/vendor/basler.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-81\n+80\n \n 4.13.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 81\n \n 4.13.2 Function Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1633,23 +1633,23 @@\n \n . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n \fx\n \n 4.13.2.3 dc1394_basler_sff_chunk_iterate() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-82\n+81\n \n 4.13.2.4 dc1394_basler_sff_chunk_iterate_init() . . . . . . . . . . . . . . . . . . . . . . .\n \n-82\n+81\n \n 4.13.2.5 dc1394_basler_sff_feature_enable() . . . . . . . . . . . . . . . . . . . . . . . .\n \n-82\n+81\n \n 4.13.2.6 dc1394_basler_sff_feature_is_available() . . . . . . . . . . . . . . . . . . . . . .\n \n 82\n \n 4.13.2.7 dc1394_basler_sff_feature_is_enabled() . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1657,41 +1657,41 @@\n \n 4.13.2.8 dc1394_basler_sff_feature_print() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 82\n \n 4.13.2.9 dc1394_basler_sff_feature_print_all() . . . . . . . . . . . . . . . . . . . . . . . .\n \n-83\n+82\n \n 4.13.2.10 dc1394_basler_sff_is_available()\n \n . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-83\n+82\n \n 4.14 dc1394/vendor/basler_sff.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-83\n+82\n \n 4.14.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-84\n+83\n \n 4.14.2 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-84\n+83\n \n 4.14.2.1 dc1394basler_dcam_csr_value_t . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-84\n+83\n \n 4.14.2.2 dc1394basler_dcam_whitebalance_csr_value_t . . . . . . . . . . . . . . . . . .\n \n-84\n+83\n \n 4.14.2.3 dc1394basler_sff_crc_checksum_t . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 84\n \n 4.14.2.4 dc1394basler_sff_cycle_time_stamp_t . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1705,59 +1705,59 @@\n \n . . . . . . . . . . . . . . . . . . . .\n \n 84\n \n 4.14.2.7 dc1394basler_sff_feature_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-85\n+84\n \n 4.14.2.8 dc1394basler_sff_frame_counter_t . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-85\n+84\n \n 4.14.3 Enumeration Type Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-85\n+84\n \n 4.14.3.1 dc1394basler_sff_feature_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-85\n+84\n \n 4.15 dc1394/vendor/basler_sff_registry.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 86\n \n 4.15.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 86\n \n 4.15.2 Function Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-87\n+86\n \n 4.15.2.1 basler_sff_registry_find_by_chunk_guid() . . . . . . . . . . . . . . . . . . . . . .\n \n-87\n+86\n \n 4.15.2.2 basler_sff_registry_find_by_csr_guid() . . . . . . . . . . . . . . . . . . . . . . .\n \n-87\n+86\n \n 4.15.2.3 basler_sff_registry_find_by_id() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-87\n+86\n \n 4.16 dc1394/vendor/pixelink.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 87\n \n 4.16.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-88\n+87\n \n 4.16.2 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 88\n \n 4.16.2.1 dc1394_pxl_adv_feature_info_t . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1779,25 +1779,25 @@\n \n . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 88\n \n 4.16.3.2 dc1394pxl_gpio_polarity_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-89\n+88\n \n 4.16.4 Function Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-89\n+88\n \n 4.16.4.1 dc1394_pxl_convert_float32_to_quadlet()\n \n . . . . . . . . . . . . . . . . . . . . .\n \n-89\n+88\n \n 4.16.4.2 dc1394_pxl_convert_uint32_to_float32() . . . . . . . . . . . . . . . . . . . . . .\n \n 89\n \n 4.16.4.3 dc1394_pxl_get_camera_info() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1813,19 +1813,19 @@\n \n Generated by Doxygen\n \n \fxi\n \n 4.16.4.6 dc1394_pxl_get_gpo_config() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-90\n+89\n \n 4.16.4.7 dc1394_pxl_get_gpo_param() . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-90\n+89\n \n 4.16.4.8 dc1394_pxl_get_gpo_param_min_max() . . . . . . . . . . . . . . . . . . . . . .\n \n 90\n \n 4.16.4.9 dc1394_pxl_print_camera_info() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1833,23 +1833,23 @@\n \n 4.16.4.10 dc1394_pxl_set_gpio_mode_param() . . . . . . . . . . . . . . . . . . . . . . .\n \n 90\n \n 4.16.4.11 dc1394_pxl_set_gpo_config() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-91\n+90\n \n 4.17 dc1394/video.h File Reference . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-91\n+90\n \n 4.17.1 Detailed Description . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-92\n+91\n \n 4.17.2 Typedef Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 92\n \n 4.17.2.1 dc1394video_frame_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1863,19 +1863,19 @@\n \n . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 92\n \n 4.17.3.2 dc1394operation_mode_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-93\n+92\n \n 4.17.3.3 dc1394speed_t . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-93\n+92\n \n 4.17.4 Function Documentation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 93\n \n 4.17.4.1 dc1394_video_get_bandwidth_usage() . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1887,19 +1887,19 @@\n \n 4.17.4.3 dc1394_video_get_framerate() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 93\n \n 4.17.4.4 dc1394_video_get_iso_channel() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-94\n+93\n \n 4.17.4.5 dc1394_video_get_iso_speed() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-94\n+93\n \n 4.17.4.6 dc1394_video_get_mode() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 94\n \n 4.17.4.7 dc1394_video_get_multi_shot() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1911,19 +1911,19 @@\n \n 4.17.4.9 dc1394_video_get_operation_mode() . . . . . . . . . . . . . . . . . . . . . . . .\n \n 94\n \n 4.17.4.10 dc1394_video_get_supported_framerates() . . . . . . . . . . . . . . . . . . . .\n \n-95\n+94\n \n 4.17.4.11 dc1394_video_get_supported_modes() . . . . . . . . . . . . . . . . . . . . . .\n \n-95\n+94\n \n 4.17.4.12 dc1394_video_get_transmission() . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 95\n \n 4.17.4.13 dc1394_video_set_framerate() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -1935,19 +1935,19 @@\n \n 4.17.4.15 dc1394_video_set_iso_speed() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 95\n \n 4.17.4.16 dc1394_video_set_mode() . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-96\n+95\n \n 4.17.4.17 dc1394_video_set_multi_shot() . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n-96\n+95\n \n 4.17.4.18 dc1394_video_set_one_shot() . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n 96\n \n 4.17.4.19 dc1394_video_set_operation_mode() . . . . . . . . . . . . . . . . . . . . . . .\n \n@@ -2124,28 +2124,28 @@\n No docs yet . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n dc1394/vendor/ pixelink.h\n No docs yet . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .\n \n Generated by Doxygen\n \n 25\n-54\n+43\n+46\n 29\n-40\n-44\n-44\n-51\n+32\n+33\n+39\n 57\n-60\n+59\n 64\n 65\n-91\n+90\n 68\n-81\n-83\n+80\n+82\n 86\n 87\n \n \f4\n \n File Index\n \n@@ -3441,15 +3441,15 @@\n dc1394_t \u2217 dc1394_new (\n void )\n \n Creates a new context in which cameras can be searched and used. This should be called before using any other\n libdc1394 function.\n Generated by Doxygen\n \n-\f4.2 dc1394/control.h File Reference\n+\f4.2 dc1394/conversions.h File Reference\n \n 4.1.4.12\n \n 29\n \n dc1394_reset_bus()\n \n@@ -3459,776 +3459,20 @@\n Resets the IEEE1394 bus which camera is attached to. Calling this function is \"rude\" to other devices because it\n causes them to re-enumerate on the bus and may cause a temporary disruption in their current activities. Thus,\n use it sparingly. Its primary use is if a program shuts down uncleanly and needs to free leftover ISO channels or\n bandwidth. A bus reset will free those things as a side effect.\n \n 4.2\n \n-dc1394/control.h File Reference\n-\n-Diverse controls of camera features.\n-\n-#include <dc1394/log.h>\n-\n-Data Structures\n-\u2022 struct dc1394feature_modes_t\n-\u2022 struct dc1394trigger_modes_t\n-\u2022 struct dc1394trigger_sources_t\n-\u2022 struct __dc1394feature_info_t_struct\n-\u2022 struct __dc1394featureset_t\n-\n-Typedefs\n-\u2022 typedef struct __dc1394feature_info_t_struct dc1394feature_info_t\n-\u2022 typedef struct __dc1394featureset_t dc1394featureset_t\n-\n-Enumerations\n-\u2022 enum dc1394trigger_mode_t\n-\u2022 enum dc1394feature_t\n-\u2022 enum dc1394trigger_source_t\n-\u2022 enum dc1394trigger_polarity_t\n-\u2022 enum dc1394feature_mode_t\n-\n-Generated by Doxygen\n-\n-\f30\n-\n-File Documentation\n-\n-Functions\n-dc1394error_t dc1394_feature_get_all ( dc1394camera_t \u2217camera, dc1394featureset_t \u2217features)\n-dc1394error_t dc1394_feature_get ( dc1394camera_t \u2217camera, dc1394feature_info_t \u2217feature)\n-dc1394error_t dc1394_feature_print ( dc1394feature_info_t \u2217feature, FILE \u2217fd)\n-dc1394error_t dc1394_feature_print_all ( dc1394featureset_t \u2217features, FILE \u2217fd)\n-dc1394error_t dc1394_feature_whitebalance_get_value ( dc1394camera_t \u2217camera, uint32_t \u2217u_b_\u2190value, uint32_t \u2217v_r_value)\n-\u2022 dc1394error_t dc1394_feature_whitebalance_set_value ( dc1394camera_t \u2217camera, uint32_t u_b_\u2190value, uint32_t v_r_value)\n-\u2022 dc1394error_t dc1394_feature_temperature_get_value ( dc1394camera_t \u2217camera, uint32_t \u2217target\u2190_temperature, uint32_t \u2217temperature)\n-\u2022 dc1394error_t dc1394_feature_temperature_set_value ( dc1394camera_t \u2217camera, uint32_t target_\u2190temperature)\n-\u2022 dc1394error_t dc1394_feature_whiteshading_get_value ( dc1394camera_t \u2217camera, uint32_t \u2217r_value,\n-uint32_t \u2217g_value, uint32_t \u2217b_value)\n-\u2022 dc1394error_t dc1394_feature_whiteshading_set_value ( dc1394camera_t \u2217camera, uint32_t r_value,\n-uint32_t g_value, uint32_t b_value)\n-\u2022 dc1394error_t dc1394_feature_get_value ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n-uint32_t \u2217value)\n-\u2022 dc1394error_t dc1394_feature_set_value ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n-uint32_t value)\n-\u2022 dc1394error_t dc1394_feature_is_present ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n-dc1394bool_t \u2217value)\n-\u2022 dc1394error_t dc1394_feature_is_readable ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n-dc1394bool_t \u2217value)\n-\u2022 dc1394error_t dc1394_feature_get_boundaries ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n-uint32_t \u2217min, uint32_t \u2217max)\n-\u2022 dc1394error_t dc1394_feature_is_switchable ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n-dc1394bool_t \u2217value)\n-\u2022 dc1394error_t dc1394_feature_get_power ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n-dc1394switch_t \u2217pwr)\n-\u2022 dc1394error_t dc1394_feature_set_power ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n-dc1394switch_t pwr)\n-\u2022 dc1394error_t dc1394_feature_get_modes ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n-dc1394feature_modes_t \u2217modes)\n-\u2022 dc1394error_t dc1394_feature_get_mode ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n-dc1394feature_mode_t \u2217mode)\n-\u2022 dc1394error_t dc1394_feature_set_mode ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n-dc1394feature_mode_t mode)\n-\u2022 dc1394error_t dc1394_feature_has_absolute_control ( dc1394camera_t \u2217camera, dc1394feature_t\n-feature, dc1394bool_t \u2217value)\n-\u2022 dc1394error_t dc1394_feature_get_absolute_boundaries ( dc1394camera_t \u2217camera, dc1394feature\u2190_t feature, float \u2217min, float \u2217max)\n-\u2022 dc1394error_t dc1394_feature_get_absolute_value ( dc1394camera_t \u2217camera, dc1394feature_\u2190t feature, float \u2217value)\n-\u2022 dc1394error_t dc1394_feature_set_absolute_value ( dc1394camera_t \u2217camera, dc1394feature_\u2190t feature, float value)\n-\u2022 dc1394error_t dc1394_feature_get_absolute_control ( dc1394camera_t \u2217camera, dc1394feature_t\n-feature, dc1394switch_t \u2217pwr)\n-\u2022 dc1394error_t dc1394_feature_set_absolute_control ( dc1394camera_t \u2217camera, dc1394feature_t\n-feature, dc1394switch_t pwr)\n-\u2022 dc1394error_t dc1394_external_trigger_set_polarity ( dc1394camera_t \u2217camera, dc1394trigger_\u2190polarity_t polarity)\n-\u2022 dc1394error_t dc1394_external_trigger_get_polarity ( dc1394camera_t \u2217camera, dc1394trigger_\u2190polarity_t \u2217polarity)\n-\n-\u2022\n-\u2022\n-\u2022\n-\u2022\n-\u2022\n-\n-Generated by Doxygen\n-\n-\f4.2 dc1394/control.h File Reference\n-\n-31\n-\n-dc1394error_t dc1394_external_trigger_has_polarity ( dc1394camera_t \u2217camera, dc1394bool_\u2190t \u2217polarity_capable)\n-\u2022 dc1394error_t dc1394_external_trigger_set_power ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n-\u2022 dc1394error_t dc1394_external_trigger_get_power ( dc1394camera_t \u2217camera, dc1394switch_t \u2217pwr)\n-\u2022 dc1394error_t dc1394_external_trigger_set_mode ( dc1394camera_t \u2217camera, dc1394trigger_\u2190mode_t mode)\n-\u2022 dc1394error_t dc1394_external_trigger_get_mode ( dc1394camera_t \u2217camera, dc1394trigger_\u2190mode_t \u2217mode)\n-\u2022 dc1394error_t dc1394_external_trigger_set_source ( dc1394camera_t \u2217camera, dc1394trigger_\u2190source_t source)\n-\u2022 dc1394error_t dc1394_external_trigger_get_source ( dc1394camera_t \u2217camera, dc1394trigger_\u2190source_t \u2217source)\n-\u2022 dc1394error_t\n-dc1394_external_trigger_get_supported_sources ( dc1394camera_t \u2217camera,\n-dc1394trigger_sources_t \u2217sources)\n-\u2022 dc1394error_t dc1394_software_trigger_set_power ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n-\u2022 dc1394error_t dc1394_software_trigger_get_power ( dc1394camera_t \u2217camera, dc1394switch_\u2190t \u2217pwr)\n-\u2022 dc1394error_t dc1394_pio_set ( dc1394camera_t \u2217camera, uint32_t value)\n-\u2022 dc1394error_t dc1394_pio_get ( dc1394camera_t \u2217camera, uint32_t \u2217value)\n-\u2022 dc1394error_t dc1394_camera_reset ( dc1394camera_t \u2217camera)\n-\u2022 dc1394error_t dc1394_camera_set_power ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n-\u2022 dc1394error_t dc1394_memory_busy ( dc1394camera_t \u2217camera, dc1394bool_t \u2217value)\n-\u2022 dc1394error_t dc1394_memory_save ( dc1394camera_t \u2217camera, uint32_t channel)\n-\u2022 dc1394error_t dc1394_memory_load ( dc1394camera_t \u2217camera, uint32_t channel)\n-\n-\u2022\n-\n-4.2.1\n-\n-Detailed Description\n-\n-Diverse controls of camera features.\n-Author\n-Gord Peters: main writer\n-Chris Urmson: some additions\n-Damien Douxchamps: some additions\n-Peter Antoniac: documentation maintainer\n-Rudolf Leitgeb: documentation writer\n-\n-This is the main include file of the library. It lists most of the library functions, enumerations and data structures.\n-\n-4.2.2\n-\n-Typedef Documentation\n-\n-4.2.2.1\n-\n-dc1394feature_info_t\n-\n-typedef struct\n-\n-__dc1394feature_info_t_struct\n-\n-dc1394feature_info_t\n-\n-A structure containing all information about a feature.\n-Some fields are only valid for some features (e.g. trigger, white balance,...)\n-\n-Generated by Doxygen\n-\n-\f32\n-\n-4.2.2.2\n-\n-File Documentation\n-\n-dc1394featureset_t\n-\n-typedef struct\n-\n-__dc1394featureset_t\n-\n-dc1394featureset_t\n-\n-The list of features\n-\n-4.2.3\n-\n-Enumeration Type Documentation\n-\n-4.2.3.1\n-\n-dc1394feature_mode_t\n-\n-enum\n-\n-dc1394feature_mode_t\n-\n-Control modes for a feature (excl. absolute control)\n-\n-4.2.3.2\n-\n-enum\n-\n-dc1394feature_t\n-\n-dc1394feature_t\n-\n-Enumeration of camera features\n-\n-4.2.3.3\n-\n-enum\n-\n-dc1394trigger_mode_t\n-\n-dc1394trigger_mode_t\n-\n-Enumeration of trigger modes\n-\n-4.2.3.4\n-\n-dc1394trigger_polarity_t\n-\n-enum\n-\n-dc1394trigger_polarity_t\n-\n-External trigger polarity\n-\n-4.2.3.5\n-\n-dc1394trigger_source_t\n-\n-enum\n-\n-dc1394trigger_source_t\n-\n-Enumeration of trigger sources\n-\n-4.2.4\n-\n-Function Documentation\n-\n-4.2.4.1\n-\n-dc1394_camera_reset()\n-\n-dc1394error_t dc1394_camera_reset (\n-dc1394camera_t \u2217 camera )\n-\n-reset a camera to factory default settings\n-Generated by Doxygen\n-\n-\f4.2 dc1394/control.h File Reference\n-\n-4.2.4.2\n-\n-dc1394_camera_set_power()\n-\n-dc1394error_t dc1394_camera_set_power (\n-dc1394camera_t \u2217 camera,\n-dc1394switch_t pwr )\n-\n-turn a camera on or off\n-\n-4.2.4.3\n-\n-dc1394_external_trigger_get_mode()\n-\n-dc1394error_t dc1394_external_trigger_get_mode (\n-dc1394camera_t \u2217 camera,\n-dc1394trigger_mode_t \u2217 mode )\n-\n-Gets the external trigger mode\n-\n-4.2.4.4\n-\n-dc1394_external_trigger_get_polarity()\n-\n-dc1394error_t dc1394_external_trigger_get_polarity (\n-dc1394camera_t \u2217 camera,\n-dc1394trigger_polarity_t \u2217 polarity )\n-\n-Gets the polarity of the external trigger\n-\n-4.2.4.5\n-\n-dc1394_external_trigger_get_power()\n-\n-dc1394error_t dc1394_external_trigger_get_power (\n-dc1394camera_t \u2217 camera,\n-dc1394switch_t \u2217 pwr )\n-\n-Gets the status of the external trigger\n-\n-4.2.4.6\n-\n-dc1394_external_trigger_get_source()\n-\n-dc1394error_t dc1394_external_trigger_get_source (\n-dc1394camera_t \u2217 camera,\n-dc1394trigger_source_t \u2217 source )\n-\n-Gets the external trigger source\n-\n-4.2.4.7\n-\n-dc1394_external_trigger_get_supported_sources()\n-\n-dc1394error_t dc1394_external_trigger_get_supported_sources (\n-dc1394camera_t \u2217 camera,\n-dc1394trigger_sources_t \u2217 sources )\n-\n-Gets the list of available external trigger source\n-\n-Generated by Doxygen\n-\n-33\n-\n-\f34\n-\n-4.2.4.8\n-\n-File Documentation\n-\n-dc1394_external_trigger_has_polarity()\n-\n-dc1394error_t dc1394_external_trigger_has_polarity (\n-dc1394camera_t \u2217 camera,\n-dc1394bool_t \u2217 polarity_capable )\n-\n-Tells whether the external trigger can change its polarity or not.\n-\n-4.2.4.9\n-\n-dc1394_external_trigger_set_mode()\n-\n-dc1394error_t dc1394_external_trigger_set_mode (\n-dc1394camera_t \u2217 camera,\n-dc1394trigger_mode_t mode )\n-\n-Sets the external trigger mode\n-\n-4.2.4.10\n-\n-dc1394_external_trigger_set_polarity()\n-\n-dc1394error_t dc1394_external_trigger_set_polarity (\n-dc1394camera_t \u2217 camera,\n-dc1394trigger_polarity_t polarity )\n-\n-Sets the polarity of the external trigger\n-\n-4.2.4.11\n-\n-dc1394_external_trigger_set_power()\n-\n-dc1394error_t dc1394_external_trigger_set_power (\n-dc1394camera_t \u2217 camera,\n-dc1394switch_t pwr )\n-\n-Switch between internal and external trigger\n-\n-4.2.4.12\n-\n-dc1394_external_trigger_set_source()\n-\n-dc1394error_t dc1394_external_trigger_set_source (\n-dc1394camera_t \u2217 camera,\n-dc1394trigger_source_t source )\n-\n-Sets the external trigger source\n-\n-4.2.4.13\n-\n-dc1394_feature_get()\n-\n-dc1394error_t dc1394_feature_get (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_info_t \u2217 feature )\n-\n-Stores the bounds and options associated with the feature described by feature->feature_id\n-\n-Generated by Doxygen\n-\n-\f4.2 dc1394/control.h File Reference\n-\n-4.2.4.14\n-\n-dc1394_feature_get_absolute_boundaries()\n-\n-dc1394error_t dc1394_feature_get_absolute_boundaries (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-float \u2217 min,\n-float \u2217 max )\n-\n-Gets the absolute boundaries of a feature\n-\n-4.2.4.15\n-\n-dc1394_feature_get_absolute_control()\n-\n-dc1394error_t dc1394_feature_get_absolute_control (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-dc1394switch_t \u2217 pwr )\n-\n-Gets the status of absolute control of a feature\n-\n-4.2.4.16\n-\n-dc1394_feature_get_absolute_value()\n-\n-dc1394error_t dc1394_feature_get_absolute_value (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-float \u2217 value )\n-\n-Gets the absolute value of a feature\n-\n-4.2.4.17\n-\n-dc1394_feature_get_all()\n-\n-dc1394error_t dc1394_feature_get_all (\n-dc1394camera_t \u2217 camera,\n-dc1394featureset_t \u2217 features )\n-\n-Collects the available features for the camera described by node and stores them in features.\n-\n-4.2.4.18\n-\n-dc1394_feature_get_boundaries()\n-\n-dc1394error_t dc1394_feature_get_boundaries (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-uint32_t \u2217 min,\n-uint32_t \u2217 max )\n-\n-Gets the boundaries of a feature\n-\n-Generated by Doxygen\n-\n-35\n-\n-\f36\n-\n-4.2.4.19\n-\n-File Documentation\n-\n-dc1394_feature_get_mode()\n-\n-dc1394error_t dc1394_feature_get_mode (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-dc1394feature_mode_t \u2217 mode )\n-\n-Gets the current control modes for a feature\n-\n-4.2.4.20\n-\n-dc1394_feature_get_modes()\n-\n-dc1394error_t dc1394_feature_get_modes (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-dc1394feature_modes_t \u2217 modes )\n-\n-Gets the list of control modes for a feature (manual, auto, etc...)\n-\n-4.2.4.21\n-\n-dc1394_feature_get_power()\n-\n-dc1394error_t dc1394_feature_get_power (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-dc1394switch_t \u2217 pwr )\n-\n-Gets the power status of a feature (ON or OFF)\n-\n-4.2.4.22\n-\n-dc1394_feature_get_value()\n-\n-dc1394error_t dc1394_feature_get_value (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-uint32_t \u2217 value )\n-\n-Gets the value of a feature\n-\n-4.2.4.23\n-\n-dc1394_feature_has_absolute_control()\n-\n-dc1394error_t dc1394_feature_has_absolute_control (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-dc1394bool_t \u2217 value )\n-\n-Tells whether a feature can be controlled in absolute mode\n-\n-4.2.4.24\n-\n-dc1394_feature_is_present()\n-\n-dc1394error_t dc1394_feature_is_present (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-dc1394bool_t \u2217 value )\n-\n-Tells whether a feature is present or not\n-Generated by Doxygen\n-\n-\f4.2 dc1394/control.h File Reference\n-\n-4.2.4.25\n-\n-dc1394_feature_is_readable()\n-\n-dc1394error_t dc1394_feature_is_readable (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-dc1394bool_t \u2217 value )\n-\n-Tells whether a feature is readable or not\n-\n-4.2.4.26\n-\n-dc1394_feature_is_switchable()\n-\n-dc1394error_t dc1394_feature_is_switchable (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-dc1394bool_t \u2217 value )\n-\n-Tells whether a feature is switcheable or not (ON/OFF)\n-\n-4.2.4.27\n-\n-dc1394_feature_print()\n-\n-dc1394error_t dc1394_feature_print (\n-dc1394feature_info_t \u2217 feature,\n-FILE \u2217 fd )\n-\n-Displays the bounds and options of the given feature\n-\n-4.2.4.28\n-\n-dc1394_feature_print_all()\n-\n-dc1394error_t dc1394_feature_print_all (\n-dc1394featureset_t \u2217 features,\n-FILE \u2217 fd )\n-\n-Displays the bounds and options of every feature supported by the camera\n-\n-4.2.4.29\n-\n-dc1394_feature_set_absolute_control()\n-\n-dc1394error_t dc1394_feature_set_absolute_control (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-dc1394switch_t pwr )\n-\n-Sets the feature in absolute control mode (ON/OFF)\n-\n-4.2.4.30\n-\n-dc1394_feature_set_absolute_value()\n-\n-dc1394error_t dc1394_feature_set_absolute_value (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-float value )\n-\n-Sets the absolute value of a feature\n-Generated by Doxygen\n-\n-37\n-\n-\f38\n-\n-4.2.4.31\n-\n-File Documentation\n-\n-dc1394_feature_set_mode()\n-\n-dc1394error_t dc1394_feature_set_mode (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-dc1394feature_mode_t mode )\n-\n-Sets the current control modes for a feature\n-\n-4.2.4.32\n-\n-dc1394_feature_set_power()\n-\n-dc1394error_t dc1394_feature_set_power (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-dc1394switch_t pwr )\n-\n-Sets the power status of a feature (ON or OFF)\n-\n-4.2.4.33\n-\n-dc1394_feature_set_value()\n-\n-dc1394error_t dc1394_feature_set_value (\n-dc1394camera_t \u2217 camera,\n-dc1394feature_t feature,\n-uint32_t value )\n-\n-Sets the value of a feature\n-\n-4.2.4.34\n-\n-dc1394_feature_temperature_get_value()\n-\n-dc1394error_t dc1394_feature_temperature_get_value (\n-dc1394camera_t \u2217 camera,\n-uint32_t \u2217 target_temperature,\n-uint32_t \u2217 temperature )\n-\n-Gets the temperature values (target and current)\n-\n-4.2.4.35\n-\n-dc1394_feature_temperature_set_value()\n-\n-dc1394error_t dc1394_feature_temperature_set_value (\n-dc1394camera_t \u2217 camera,\n-uint32_t target_temperature )\n-\n-Sets the temperature values (target only) FIXME: COULD BE DROPPED? already in the standard feature_set_\u2190value()?\n-\n-4.2.4.36\n-\n-dc1394_feature_whitebalance_get_value()\n-\n-dc1394error_t dc1394_feature_whitebalance_get_value (\n-dc1394camera_t \u2217 camera,\n-uint32_t \u2217 u_b_value,\n-uint32_t \u2217 v_r_value )\n-\n-Gets the whitebalance values\n-Generated by Doxygen\n-\n-\f4.2 dc1394/control.h File Reference\n-\n-4.2.4.37\n-\n-dc1394_feature_whitebalance_set_value()\n-\n-dc1394error_t dc1394_feature_whitebalance_set_value (\n-dc1394camera_t \u2217 camera,\n-uint32_t u_b_value,\n-uint32_t v_r_value )\n-\n-Sets the whitebalance values\n-\n-4.2.4.38\n-\n-dc1394_feature_whiteshading_get_value()\n-\n-dc1394error_t dc1394_feature_whiteshading_get_value (\n-dc1394camera_t \u2217 camera,\n-uint32_t \u2217 r_value,\n-uint32_t \u2217 g_value,\n-uint32_t \u2217 b_value )\n-\n-Gets the white shading values\n-\n-4.2.4.39\n-\n-dc1394_feature_whiteshading_set_value()\n-\n-dc1394error_t dc1394_feature_whiteshading_set_value (\n-dc1394camera_t \u2217 camera,\n-uint32_t r_value,\n-uint32_t g_value,\n-uint32_t b_value )\n-\n-Sets the white shading values\n-\n-4.2.4.40\n-\n-dc1394_memory_busy()\n-\n-dc1394error_t dc1394_memory_busy (\n-dc1394camera_t \u2217 camera,\n-dc1394bool_t \u2217 value )\n-\n-Download a camera setup from the memory.\n-\n-4.2.4.41\n-\n-dc1394_memory_load()\n-\n-dc1394error_t dc1394_memory_load (\n-dc1394camera_t \u2217 camera,\n-uint32_t channel )\n-\n-Tells whether the writing of the camera setup in memory is finished or not.\n-\n-Generated by Doxygen\n-\n-39\n-\n-\f40\n-\n-File Documentation\n-\n-4.2.4.42\n-\n-dc1394_memory_save()\n-\n-dc1394error_t dc1394_memory_save (\n-dc1394camera_t \u2217 camera,\n-uint32_t channel )\n-\n-Uploads a camera setup in the memory.\n-Note that this operation can only be performed a certain number of times for a given camera, as it requires reprogramming of an EEPROM.\n-\n-4.2.4.43\n-\n-dc1394_pio_get()\n-\n-dc1394error_t dc1394_pio_get (\n-dc1394camera_t \u2217 camera,\n-uint32_t \u2217 value )\n-\n-Gets the current quadlet at the PIO (input)\n-\n-4.2.4.44\n-\n-dc1394_pio_set()\n-\n-dc1394error_t dc1394_pio_set (\n-dc1394camera_t \u2217 camera,\n-uint32_t value )\n-\n-Sends a quadlet on the PIO (output)\n-\n-4.2.4.45\n-\n-dc1394_software_trigger_get_power()\n-\n-dc1394error_t dc1394_software_trigger_get_power (\n-dc1394camera_t \u2217 camera,\n-dc1394switch_t \u2217 pwr )\n-\n-Gets the state of software trigger\n-\n-4.2.4.46\n-\n-dc1394_software_trigger_set_power()\n-\n-dc1394error_t dc1394_software_trigger_set_power (\n-dc1394camera_t \u2217 camera,\n-dc1394switch_t pwr )\n-\n-Turn software trigger on or off\n-\n-4.3\n-\n dc1394/conversions.h File Reference\n \n functions to convert video formats\n \n #include <dc1394/log.h>\n \n-Generated by Doxygen\n-\n-\f4.3 dc1394/conversions.h File Reference\n-\n-41\n-\n Enumerations\n \u2022 enum dc1394bayer_method_t\n \u2022 enum dc1394stereo_method_t\n \n Functions\n \u2022 dc1394error_t dc1394_convert_to_YUV422 (uint8_t \u2217src, uint8_t \u2217dest, uint32_t width, uint32_t height,\n uint32_t byte_order, dc1394color_coding_t source_coding, uint32_t bits)\n@@ -4242,162 +3486,165 @@\n \u2022 dc1394error_t dc1394_bayer_decoding_16bit (const uint16_t \u2217bayer, uint16_t \u2217rgb, uint32_t width,\n uint32_t height, dc1394color_filter_t tile, dc1394bayer_method_t method, uint32_t bits)\n \u2022 dc1394error_t dc1394_convert_frames ( dc1394video_frame_t \u2217in, dc1394video_frame_t \u2217out)\n \u2022 dc1394error_t dc1394_debayer_frames ( dc1394video_frame_t \u2217in, dc1394video_frame_t \u2217out,\n dc1394bayer_method_t method)\n \u2022 dc1394error_t dc1394_deinterlace_stereo_frames ( dc1394video_frame_t \u2217in, dc1394video_frame\u2190_t \u2217out, dc1394stereo_method_t method)\n \n-4.3.1\n+4.2.1\n \n Detailed Description\n \n functions to convert video formats\n Author\n Damien Douxchamps: coding\n Frederic Devernay: coding\n Peter Antoniac: documentation maintainer\n-\n More details soon\n+Generated by Doxygen\n+\n+\f30\n \n-4.3.2\n+File Documentation\n+\n+4.2.2\n \n Enumeration Type Documentation\n \n-4.3.2.1\n+4.2.2.1\n \n dc1394bayer_method_t\n \n enum\n \n dc1394bayer_method_t\n \n A list of de-mosaicing techniques for Bayer-patterns.\n The speed of the techniques can vary greatly, as well as their quality.\n \n-4.3.2.2\n-\n+4.2.2.2\n enum\n \n dc1394stereo_method_t\n-\n dc1394stereo_method_t\n \n A list of known stereo-in-normal-video modes used by manufacturers like Point Grey Research and Videre Design.\n-Generated by Doxygen\n-\n-\f42\n \n-File Documentation\n-\n-4.3.3\n+4.2.3\n \n Function Documentation\n \n-4.3.3.1\n+4.2.3.1\n \n dc1394_bayer_decoding_16bit()\n \n dc1394error_t dc1394_bayer_decoding_16bit (\n const uint16_t \u2217 bayer,\n uint16_t \u2217 rgb,\n uint32_t width,\n uint32_t height,\n dc1394color_filter_t tile,\n dc1394bayer_method_t method,\n uint32_t bits )\n \n Perform de-mosaicing on an 16-bit image buffer\n \n-4.3.3.2\n+4.2.3.2\n \n dc1394_bayer_decoding_8bit()\n \n dc1394error_t dc1394_bayer_decoding_8bit (\n const uint8_t \u2217 bayer,\n uint8_t \u2217 rgb,\n uint32_t width,\n uint32_t height,\n dc1394color_filter_t tile,\n dc1394bayer_method_t method )\n \n Perform de-mosaicing on an 8-bit image buffer\n \n-4.3.3.3\n+4.2.3.3\n \n dc1394_convert_frames()\n \n dc1394error_t dc1394_convert_frames (\n dc1394video_frame_t \u2217 in,\n dc1394video_frame_t \u2217 out )\n \n Converts the format of a video frame.\n To set the format of the output, simply set the values of the corresponding fields in the output frame\n+Generated by Doxygen\n \n-4.3.3.4\n+\f4.2 dc1394/conversions.h File Reference\n+\n+4.2.3.4\n \n dc1394_convert_to_MONO8()\n \n dc1394error_t dc1394_convert_to_MONO8 (\n uint8_t \u2217 src,\n uint8_t \u2217 dest,\n uint32_t width,\n uint32_t height,\n uint32_t byte_order,\n dc1394color_coding_t source_coding,\n uint32_t bits )\n \n Converts an image buffer to MONO8\n \n-Generated by Doxygen\n-\n-\f4.3 dc1394/conversions.h File Reference\n-\n-4.3.3.5\n-\n-43\n+4.2.3.5\n \n dc1394_convert_to_RGB8()\n \n dc1394error_t dc1394_convert_to_RGB8 (\n uint8_t \u2217 src,\n uint8_t \u2217 dest,\n uint32_t width,\n uint32_t height,\n uint32_t byte_order,\n dc1394color_coding_t source_coding,\n uint32_t bits )\n \n Converts an image buffer to RGB8\n \n-4.3.3.6\n+4.2.3.6\n \n dc1394_convert_to_YUV422()\n \n dc1394error_t dc1394_convert_to_YUV422 (\n uint8_t \u2217 src,\n uint8_t \u2217 dest,\n uint32_t width,\n uint32_t height,\n uint32_t byte_order,\n dc1394color_coding_t source_coding,\n uint32_t bits )\n \n Converts an image buffer to YUV422\n \n-4.3.3.7\n+4.2.3.7\n \n dc1394_debayer_frames()\n \n dc1394error_t dc1394_debayer_frames (\n dc1394video_frame_t \u2217 in,\n dc1394video_frame_t \u2217 out,\n dc1394bayer_method_t method )\n \n De-mosaicing of a Bayer-encoded video frame\n To set the format of the output, simply set the values of the corresponding fields in the output frame\n+\n+Generated by Doxygen\n+\n+31\n+\n+\f32\n+\n+File Documentation\n+\n Parameters\n in\n \n is a pointer to the bayer video frame that is to be converted\n \n out\n \n@@ -4405,45 +3652,39 @@\n be adjusted accordingly by this function. If there is no memory allocated to the image field, then\n ensure that out->image == NULL and out->allocated_image_bytes == 0\n \n method\n \n is the bayer method to interpolate the frame.\n \n-4.3.3.8\n+4.2.3.8\n \n dc1394_deinterlace_stereo()\n \n dc1394error_t dc1394_deinterlace_stereo (\n uint8_t \u2217 src,\n uint8_t \u2217 dest,\n-Generated by Doxygen\n-\n-\f44\n-\n-File Documentation\n-\n uint32_t width,\n uint32_t height )\n \n changes a 16bit stereo image (8bit/channel) into two 8bit images on top of each other\n \n-4.3.3.9\n+4.2.3.9\n \n dc1394_deinterlace_stereo_frames()\n \n dc1394error_t dc1394_deinterlace_stereo_frames (\n dc1394video_frame_t \u2217 in,\n dc1394video_frame_t \u2217 out,\n dc1394stereo_method_t method )\n \n De-interlacing of stereo data for cideo frames\n To set the format of the output, simply set the values of the corresponding fields in the output frame\n \n-4.4\n+4.3\n \n dc1394/dc1394.h File Reference\n \n Main include file, which include all others.\n \n #include <dc1394/types.h>\n #include <dc1394/camera.h>\n@@ -4453,36 +3694,35 @@\n #include <dc1394/format7.h>\n #include <dc1394/iso.h>\n #include <dc1394/log.h>\n #include <dc1394/register.h>\n #include <dc1394/video.h>\n #include <dc1394/utils.h>\n \n-4.4.1\n+4.3.1\n \n Detailed Description\n \n Main include file, which include all others.\n More details soon\n+Generated by Doxygen\n \n-4.5\n+\f4.4 dc1394/format7.h File Reference\n+\n+4.4\n+\n+33\n \n dc1394/format7.h File Reference\n \n Functions to control Format_7 (aka scalable format, ROI)\n \n #include <dc1394/log.h>\n #include <dc1394/video.h>\n \n-Generated by Doxygen\n-\n-\f4.5 dc1394/format7.h File Reference\n-\n-45\n-\n Data Structures\n \u2022 struct __dc1394format7mode_t\n \u2022 struct __dc1394format7modeset_t\n \n Typedefs\n \u2022 typedef struct __dc1394format7mode_t dc1394format7mode_t\n \u2022 typedef struct __dc1394format7modeset_t dc1394format7modeset_t\n@@ -4509,258 +3749,258 @@\n \u2022 dc1394error_t dc1394_format7_set_packet_size ( dc1394camera_t \u2217camera, dc1394video_mode_t\n video_mode, uint32_t packet_size)\n \u2022\n dc1394error_t\n dc1394_format7_get_recommended_packet_size ( dc1394camera_t \u2217camera,\n dc1394video_mode_t video_mode, uint32_t \u2217packet_size)\n \u2022 dc1394error_t dc1394_format7_get_packets_per_frame ( dc1394camera_t \u2217camera, dc1394video\u2190_mode_t video_mode, uint32_t \u2217ppf)\n+Generated by Doxygen\n+\n+\f34\n+\n+File Documentation\n \u2022 dc1394error_t dc1394_format7_get_data_depth ( dc1394camera_t \u2217camera, dc1394video_mode_t\n video_mode, uint32_t \u2217data_depth)\n \u2022 dc1394error_t dc1394_format7_get_frame_interval ( dc1394camera_t \u2217camera, dc1394video_\u2190mode_t video_mode, float \u2217interval)\n \u2022 dc1394error_t dc1394_format7_get_pixel_number ( dc1394camera_t \u2217camera, dc1394video_mode\u2190_t video_mode, uint32_t \u2217pixnum)\n \u2022 dc1394error_t dc1394_format7_get_total_bytes ( dc1394camera_t \u2217camera, dc1394video_mode_t\n video_mode, uint64_t \u2217total_bytes)\n \u2022 dc1394error_t dc1394_format7_get_modeset ( dc1394camera_t \u2217camera, dc1394format7modeset_t\n \u2217info)\n-Generated by Doxygen\n-\n-\f46\n-\n-File Documentation\n \u2022 dc1394error_t dc1394_format7_get_mode_info ( dc1394camera_t \u2217camera, dc1394video_mode_\u2190t video_mode, dc1394format7mode_t \u2217f7_mode)\n \u2022 dc1394error_t dc1394_format7_set_roi ( dc1394camera_t \u2217camera, dc1394video_mode_t video\u2190_mode, dc1394color_coding_t color_coding, int32_t packet_size, int32_t left, int32_t top, int32_t width,\n int32_t height)\n \u2022 dc1394error_t dc1394_format7_get_roi ( dc1394camera_t \u2217camera, dc1394video_mode_t video_\u2190mode, dc1394color_coding_t \u2217color_coding, uint32_t \u2217packet_size, uint32_t \u2217left, uint32_t \u2217top, uint32_t\n \u2217width, uint32_t \u2217height)\n \n-4.5.1\n+4.4.1\n \n Detailed Description\n \n Functions to control Format_7 (aka scalable format, ROI)\n More details soon\n \n-4.5.2\n+4.4.2\n \n Typedef Documentation\n \n-4.5.2.1\n+4.4.2.1\n \n dc1394format7mode_t\n \n typedef struct\n \n __dc1394format7mode_t\n \n dc1394format7mode_t\n \n A struct containing information about a mode of Format_7, the scalable image format.\n \n-4.5.2.2\n+4.4.2.2\n \n dc1394format7modeset_t\n \n typedef struct\n \n __dc1394format7modeset_t\n \n dc1394format7modeset_t\n \n A struct containing the list of Format_7 modes. FIXME: this may become very big if format_7 pages are used in\n IIDC 1.32. It would be better to use a \"num\" and an allocated list.\n \n-4.5.3\n+4.4.3\n \n Function Documentation\n \n-4.5.3.1\n+4.4.3.1\n \n dc1394_format7_get_color_coding()\n \n dc1394error_t dc1394_format7_get_color_coding (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_coding_t \u2217 color_coding )\n \n Gets the current color coding\n+Generated by Doxygen\n+\n+\f4.4 dc1394/format7.h File Reference\n \n-4.5.3.2\n+4.4.3.2\n \n dc1394_format7_get_color_codings()\n \n dc1394error_t dc1394_format7_get_color_codings (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_codings_t \u2217 codings )\n \n Gets the list of color codings available for this mode\n-Generated by Doxygen\n \n-\f4.5 dc1394/format7.h File Reference\n-\n-4.5.3.3\n+4.4.3.3\n \n dc1394_format7_get_color_filter()\n \n dc1394error_t dc1394_format7_get_color_filter (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_filter_t \u2217 color_filter )\n \n Gets the current color filter\n \n-4.5.3.4\n+4.4.3.4\n \n dc1394_format7_get_data_depth()\n \n dc1394error_t dc1394_format7_get_data_depth (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 data_depth )\n \n Gets the data depth (e.g. 12, 13, 14 bits/pixel)\n \n-4.5.3.5\n+4.4.3.5\n \n dc1394_format7_get_frame_interval()\n \n dc1394error_t dc1394_format7_get_frame_interval (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n float \u2217 interval )\n \n Gets the frame interval in float format\n \n-4.5.3.6\n+4.4.3.6\n \n dc1394_format7_get_image_position()\n \n dc1394error_t dc1394_format7_get_image_position (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 left,\n uint32_t \u2217 top )\n \n Gets the current image position\n \n-4.5.3.7\n+Generated by Doxygen\n+\n+35\n+\n+\f36\n+\n+4.4.3.7\n+\n+File Documentation\n \n dc1394_format7_get_image_size()\n \n dc1394error_t dc1394_format7_get_image_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 width,\n uint32_t \u2217 height )\n \n Gets the current image size.\n \n-Generated by Doxygen\n-\n-47\n-\n-\f48\n-\n-4.5.3.8\n-\n-File Documentation\n+4.4.3.8\n \n dc1394_format7_get_max_image_size()\n \n dc1394error_t dc1394_format7_get_max_image_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 h_size,\n uint32_t \u2217 v_size )\n \n Gets the maximal image size for a given mode.\n \n-4.5.3.9\n+4.4.3.9\n \n dc1394_format7_get_mode_info()\n \n dc1394error_t dc1394_format7_get_mode_info (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394format7mode_t \u2217 f7_mode )\n \n Gets the properties of a Format_7 mode\n \n-4.5.3.10\n+4.4.3.10\n \n dc1394_format7_get_modeset()\n \n dc1394error_t dc1394_format7_get_modeset (\n dc1394camera_t \u2217 camera,\n dc1394format7modeset_t \u2217 info )\n \n Gets the properties of all Format_7 modes supported by the camera.\n \n-4.5.3.11\n+4.4.3.11\n \n dc1394_format7_get_packet_parameters()\n \n dc1394error_t dc1394_format7_get_packet_parameters (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 unit_bytes,\n uint32_t \u2217 max_bytes )\n \n Get the parameters of the packet size: its maximal size and its unit size. The packet size is always a multiple of the\n unit bytes and cannot be zero.\n \n-4.5.3.12\n+Generated by Doxygen\n+\n+\f4.4 dc1394/format7.h File Reference\n+\n+4.4.3.12\n \n dc1394_format7_get_packet_size()\n \n dc1394error_t dc1394_format7_get_packet_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 packet_size )\n \n Gets the current packet size\n \n-Generated by Doxygen\n-\n-\f4.5 dc1394/format7.h File Reference\n-\n-4.5.3.13\n+4.4.3.13\n \n dc1394_format7_get_packets_per_frame()\n \n dc1394error_t dc1394_format7_get_packets_per_frame (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 ppf )\n \n Gets the number of packets per frame.\n \n-4.5.3.14\n+4.4.3.14\n \n dc1394_format7_get_pixel_number()\n \n dc1394error_t dc1394_format7_get_pixel_number (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 pixnum )\n \n Gets the number of pixels per image frame\n \n-4.5.3.15\n+4.4.3.15\n \n dc1394_format7_get_recommended_packet_size()\n \n dc1394error_t dc1394_format7_get_recommended_packet_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 packet_size )\n \n Gets the recommended packet size. Ignore if zero.\n \n-4.5.3.16\n+4.4.3.16\n \n dc1394_format7_get_roi()\n \n dc1394error_t dc1394_format7_get_roi (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_coding_t \u2217 color_coding,\n@@ -4768,111 +4008,112 @@\n uint32_t \u2217 left,\n uint32_t \u2217 top,\n uint32_t \u2217 width,\n uint32_t \u2217 height )\n \n Joint function that fully gets a certain ROI taking all parameters into account.\n \n-4.5.3.17\n+Generated by Doxygen\n+\n+37\n+\n+\f38\n+\n+4.4.3.17\n+\n+File Documentation\n \n dc1394_format7_get_total_bytes()\n \n dc1394error_t dc1394_format7_get_total_bytes (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint64_t \u2217 total_bytes )\n \n Get the total number of bytes per frame. This includes padding (to reach an entire number of packets)\n \n-Generated by Doxygen\n-\n-49\n-\n-\f50\n-\n-4.5.3.18\n-\n-File Documentation\n+4.4.3.18\n \n dc1394_format7_get_unit_position()\n \n dc1394error_t dc1394_format7_get_unit_position (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 h_unit_pos,\n uint32_t \u2217 v_unit_pos )\n \n Gets the unit positions for a given mode. The image position can only be a multiple of the unit position (zero is\n acceptable).\n \n-4.5.3.19\n+4.4.3.19\n \n dc1394_format7_get_unit_size()\n \n dc1394error_t dc1394_format7_get_unit_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 h_unit,\n uint32_t \u2217 v_unit )\n \n Gets the unit sizes for a given mode. The image size can only be a multiple of the unit size, and cannot be smaller\n than it.\n \n-4.5.3.20\n+4.4.3.20\n \n dc1394_format7_set_color_coding()\n \n dc1394error_t dc1394_format7_set_color_coding (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_coding_t color_coding )\n \n Sets the current color coding\n \n-4.5.3.21\n+4.4.3.21\n \n dc1394_format7_set_image_position()\n \n dc1394error_t dc1394_format7_set_image_position (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t left,\n uint32_t top )\n \n Sets the current image position\n \n-4.5.3.22\n+Generated by Doxygen\n+\n+\f4.5 dc1394/iso.h File Reference\n+\n+4.4.3.22\n+\n+39\n \n dc1394_format7_set_image_size()\n \n dc1394error_t dc1394_format7_set_image_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t width,\n uint32_t height )\n \n Sets the current image size\n-Generated by Doxygen\n \n-\f4.6 dc1394/iso.h File Reference\n-\n-4.5.3.23\n-\n-51\n+4.4.3.23\n \n dc1394_format7_set_packet_size()\n \n dc1394error_t dc1394_format7_set_packet_size (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t packet_size )\n \n Sets the current packet size\n \n-4.5.3.24\n+4.4.3.24\n \n dc1394_format7_set_roi()\n \n dc1394error_t dc1394_format7_set_roi (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394color_coding_t color_coding,\n@@ -4881,15 +4122,15 @@\n int32_t top,\n int32_t width,\n int32_t height )\n \n Joint function that fully sets a certain ROI taking all parameters into account. Note that this function does not\n SWITCH to the video mode passed as argument, it mearly sets it\n \n-4.6\n+4.5\n \n dc1394/iso.h File Reference\n \n Functions to manually manage the ISO resources (channels and bandwidth)\n \n #include <dc1394/log.h>\n \n@@ -4897,35 +4138,37 @@\n \u2022 dc1394error_t dc1394_iso_set_persist ( dc1394camera_t \u2217camera)\n \u2022 dc1394error_t dc1394_iso_allocate_channel ( dc1394camera_t \u2217camera, uint64_t channels_allowed, int\n \u2217channel)\n \u2022 dc1394error_t dc1394_iso_release_channel ( dc1394camera_t \u2217camera, int channel)\n \u2022 dc1394error_t dc1394_iso_allocate_bandwidth ( dc1394camera_t \u2217camera, int bandwidth_units)\n \u2022 dc1394error_t dc1394_iso_release_bandwidth ( dc1394camera_t \u2217camera, int bandwidth_units)\n \u2022 dc1394error_t dc1394_iso_release_all ( dc1394camera_t \u2217camera)\n+Generated by Doxygen\n \n-4.6.1\n+\f40\n+\n+File Documentation\n+\n+4.5.1\n \n Detailed Description\n \n Functions to manually manage the ISO resources (channels and bandwidth)\n+\n Author\n Damien Douxchamps: coding\n Peter Antoniac: documentation maintainer\n-More details soon\n-Generated by Doxygen\n \n-\f52\n-\n-File Documentation\n+More details soon\n \n-4.6.2\n+4.5.2\n \n Function Documentation\n \n-4.6.2.1\n+4.5.2.1\n \n dc1394_iso_allocate_bandwidth()\n \n dc1394error_t dc1394_iso_allocate_bandwidth (\n dc1394camera_t \u2217 camera,\n int bandwidth_units )\n \n@@ -4936,63 +4179,65 @@\n \n A camera handle.\n The number of isochronous bandwidth units to allocate.\n \n Allocates isochronous bandwidth. This functions allocates bandwidth in addition to any previous allocations. It\n may be called multiple times. The bandwidth is automatically re-allocated if there is a bus reset. The bandwidth is\n automatically released if this camera is freed or the application shuts down prematurely. If the bandwidth needs to\n-persist beyond the lifetime of this application, call dc1394_iso_set_persist() ( p. 54) first.\n+persist beyond the lifetime of this application, call dc1394_iso_set_persist() ( p. 42) first.\n \n Returns\n DC1394_SUCCESS if the operation succeeded. DC1394_FUNCTION_NOT_SUPPORTED if the current\n driver/platform does not allow bandwidth allocation. DC1394_NO_BANDWIDTH if there is not enough available bandwidth to support the allocation. In this case, no bandwidth is allocated.\n \n-4.6.2.2\n+4.5.2.2\n \n dc1394_iso_allocate_channel()\n \n dc1394error_t dc1394_iso_allocate_channel (\n dc1394camera_t \u2217 camera,\n uint64_t channels_allowed,\n int \u2217 channel )\n \n dc1394_iso_allocate_channel:\n Parameters\n camera\n-channels_allowed\n \n A camera handle.\n+\n+Generated by Doxygen\n+\n+\f4.5 dc1394/iso.h File Reference\n+\n+41\n+\n+Parameters\n+channels_allowed\n+\n A bitmask of acceptable channels for the allocation. The LSB corresponds to channel 0\n and the MSB corresponds to channel\n 1. Only channels whose bit is set will be considered for the allocation. If\n channels_allowed = 0, the complete set of channels supported by this camera will\n be considered for the allocation.\n \n channel\n \n The allocated channel number is returned here.\n \n Allocates an isochronous channel. This function may be called multiple times, each time allocating an additional\n channel. The channel is automatically re-allocated if there is a bus reset. The channel is automatically released\n when this dc1394camera_t is freed or if the application shuts down prematurely. If the channel needs to persist\n-beyond the lifetime of this application, call dc1394_iso_set_persist() ( p. 54) first. Note that this function does not\n-\n-Generated by Doxygen\n-\n-\f4.6 dc1394/iso.h File Reference\n-\n-53\n-\n+beyond the lifetime of this application, call dc1394_iso_set_persist() ( p. 42) first. Note that this function does not\n automatically program camera to use the allocated channel for isochronous streaming. You must do that manually\n using dc1394_video_set_iso_channel() ( p. 95).\n \n Returns\n DC1394_SUCCESS if the operation succeeded. The allocated channel is stored in channel. DC1394_\u2190FUNCTION_NOT_SUPPORTED if the current driver/platform does not allow channel allocation. DC1394_\u2190NO_ISO_CHANNEL if none of the requested channels are available.\n \n-4.6.2.3\n+4.5.2.3\n \n dc1394_iso_release_all()\n \n dc1394error_t dc1394_iso_release_all (\n dc1394camera_t \u2217 camera )\n \n dc1394_iso_release_all:\n@@ -5000,53 +4245,52 @@\n camera\n \n A camera handle.\n \n Releases all channels and bandwidth that have been previously allocated for this dc1394camera_t. Note that this\n information can only be tracked per process, and there is no knowledge of allocations for this camera by previous\n processes. To release resources in such a case, the manual release functions dc1394_iso_release_channel()\n-( p. 54) and dc1394_iso_release_bandwidth() ( p. 53) must be used.\n-\n+( p. 42) and dc1394_iso_release_bandwidth() ( p. 41) must be used.\n Returns\n DC1394_SUCCESS if the operation succeeded. DC1394_FAILURE if some resources were not able to be\n released.\n \n-4.6.2.4\n+4.5.2.4\n \n dc1394_iso_release_bandwidth()\n \n dc1394error_t dc1394_iso_release_bandwidth (\n dc1394camera_t \u2217 camera,\n int bandwidth_units )\n \n dc1394_iso_release_bandwidth:\n+\n+Generated by Doxygen\n+\n+\f42\n+\n+File Documentation\n+\n Parameters\n camera\n bandwidth_units\n \n A camera handle.\n The number of isochronous bandwidth units to free.\n \n Releases previously allocated isochronous bandwidth. Each dc1394camera_t keeps track of a running total of\n bandwidth that has been allocated. Released bandwidth is subtracted from this total for the sake of automatic reallocation and automatic release on shutdown. It is also acceptable for a camera to release more bandwidth than\n it has allocated (to clean up for another process for example). In this case, the running total of bandwidth is not\n affected. It is acceptable to release more bandwidth than is allocated in total for the bus. In this case, all bandwidth\n is released and the function succeeds.\n-\n-Generated by Doxygen\n-\n-\f54\n-\n-File Documentation\n-\n Returns\n DC1394_SUCCESS if the operation succeeded. DC1394_FUNCTION_NOT_SUPPORTED if the current\n driver/platform does not allow bandwidth release.\n \n-4.6.2.5\n+4.5.2.5\n \n dc1394_iso_release_channel()\n \n dc1394error_t dc1394_iso_release_channel (\n dc1394camera_t \u2217 camera,\n int channel )\n \n@@ -5061,44 +4305,46 @@\n Releases a previously allocated channel. It is acceptable to release channels that were allocated by a different\n process or host. If attempting to release a channel that is already released, the function will succeed.\n \n Returns\n DC1394_SUCCESS if the operation succeeded. DC1394_FUNCTION_NOT_SUPPORTED if the current\n driver/platform does not allow channel release.\n \n-4.6.2.6\n+4.5.2.6\n \n dc1394_iso_set_persist()\n \n dc1394error_t dc1394_iso_set_persist (\n dc1394camera_t \u2217 camera )\n \n dc1394_iso_set_persist\n Parameters\n camera\n \n A camera handle.\n \n+Generated by Doxygen\n+\n+\f4.6 dc1394/capture.h File Reference\n+\n+43\n+\n Calling this function will cause isochronous channel and bandwidth allocations to persist beyond the lifetime of\n this dc1394camera_t instance. Normally (when this function is not called), any allocations would be automatically\n released upon freeing this camera or a premature shutdown of the application (if possible). For this function to be\n used, it must be called prior to any allocations or an error will be returned.\n+\n Returns\n DC1394_SUCCESS if the operation succeeded. DC1394_FUNCTION_NOT_SUPPORTED if the current platform/driver does not allow persistent allocations.\n \n-4.7\n+4.6\n \n dc1394/capture.h File Reference\n \n Capture functions.\n-Generated by Doxygen\n-\n-\f4.7 dc1394/capture.h File Reference\n-\n-55\n \n #include <dc1394/log.h>\n #include <dc1394/video.h>\n \n Macros\n \u2022 #define DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC 0x00000001U\n \n@@ -5117,170 +4363,918 @@\n dc1394video_frame_t \u2217\u2217frame)\n \u2022 dc1394error_t dc1394_capture_enqueue ( dc1394camera_t \u2217camera, dc1394video_frame_t \u2217frame)\n \u2022 dc1394bool_t dc1394_capture_is_frame_corrupt ( dc1394camera_t \u2217camera, dc1394video_frame_t\n \u2217frame)\n \u2022 void dc1394_capture_set_callback ( dc1394camera_t \u2217camera, dc1394capture_callback_t callback,\n void \u2217user_data)\n \n-4.7.1\n+Generated by Doxygen\n+\n+\f44\n+\n+File Documentation\n+\n+4.6.1\n \n Detailed Description\n \n Capture functions.\n Author\n Damien Douxchamps: coding\n Peter Antoniac: documentation maintainer\n \n More details soon\n \n-4.7.2\n+4.6.2\n \n Macro Definition Documentation\n \n-4.7.2.1\n+4.6.2.1\n \n DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC\n \n #define DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC 0x00000001U\n \n Capture flags. Currently limited to switching automatic functions on/off: channel allocation, bandwidth allocation\n and automatic starting of ISO transmission\n-Generated by Doxygen\n \n-\f56\n-\n-File Documentation\n-\n-4.7.3\n+4.6.3\n \n Typedef Documentation\n \n-4.7.3.1\n+4.6.3.1\n \n dc1394capture_callback_t\n \n typedef void(\u2217 dc1394capture_callback_t) ( dc1394camera_t \u2217, void \u2217)\n \n typedef for the callback param for dc1394_capture_set_callback\n \n-4.7.4\n+4.6.4\n \n Enumeration Type Documentation\n \n-4.7.4.1\n+4.6.4.1\n \n dc1394capture_policy_t\n \n enum\n \n dc1394capture_policy_t\n \n The capture policy.\n Can be blocking (wait for a frame forever) or polling (returns if no frames is in the ring buffer)\n \n-4.7.5\n+4.6.5\n \n Function Documentation\n \n-4.7.5.1\n+4.6.5.1\n \n dc1394_capture_dequeue()\n \n dc1394error_t dc1394_capture_dequeue (\n dc1394camera_t \u2217 camera,\n dc1394capture_policy_t policy,\n dc1394video_frame_t \u2217\u2217 frame )\n \n Captures a video frame. The returned struct contains the image buffer, among others. This image buffer SHALL\n NOT be freed, as it represents an area in the memory that belongs to the system.\n+Generated by Doxygen\n+\n+\f4.6 dc1394/capture.h File Reference\n+\n+4.6.5.2\n \n-4.7.5.2\n+45\n \n dc1394_capture_enqueue()\n \n dc1394error_t dc1394_capture_enqueue (\n dc1394camera_t \u2217 camera,\n dc1394video_frame_t \u2217 frame )\n \n Returns a frame to the ring buffer once it has been used.\n \n-4.7.5.3\n+4.6.5.3\n \n dc1394_capture_get_fileno()\n \n int dc1394_capture_get_fileno (\n dc1394camera_t \u2217 camera )\n \n-Gets a file descriptor to be used for select(). Must be called after dc1394_capture_setup() (p. 57).\n-\n-Generated by Doxygen\n-\n-\f4.8 dc1394/log.h File Reference\n+Gets a file descriptor to be used for select(). Must be called after dc1394_capture_setup() (p. 45).\n \n-4.7.5.4\n-\n-57\n+4.6.5.4\n \n dc1394_capture_is_frame_corrupt()\n \n dc1394bool_t dc1394_capture_is_frame_corrupt (\n dc1394camera_t \u2217 camera,\n dc1394video_frame_t \u2217 frame )\n \n Returns DC1394_TRUE if the given frame (previously dequeued) has been detected to be corrupt (missing data,\n corrupted data, overrun buffer, etc.). Note that certain types of corruption may go undetected in which case\n-DC1394_FALSE will be returned. The ability to detect corruption also varies between platforms. Note that corrupt frames still need to be enqueued with dc1394_capture_enqueue() (p. 56) when no longer needed by the user.\n+DC1394_FALSE will be returned. The ability to detect corruption also varies between platforms. Note that corrupt frames still need to be enqueued with dc1394_capture_enqueue() (p. 44) when no longer needed by the user.\n \n-4.7.5.5\n+4.6.5.5\n \n dc1394_capture_set_callback()\n \n void dc1394_capture_set_callback (\n dc1394camera_t \u2217 camera,\n dc1394capture_callback_t callback,\n void \u2217 user_data )\n \n Set a callback if supported by the platform (OS X only for now).\n \n-4.7.5.6\n+4.6.5.6\n \n dc1394_capture_setup()\n \n dc1394error_t dc1394_capture_setup (\n dc1394camera_t \u2217 camera,\n uint32_t num_dma_buffers,\n uint32_t flags )\n \n Setup the capture, using a ring buffer of a certain size (num_dma_buffers) and certain options (flags)\n \n-4.7.5.7\n+4.6.5.7\n \n dc1394_capture_stop()\n \n dc1394error_t dc1394_capture_stop (\n dc1394camera_t \u2217 camera )\n \n Stop the capture\n+Generated by Doxygen\n+\n+\f46\n+\n+File Documentation\n+\n+4.7\n+\n+dc1394/control.h File Reference\n+\n+Diverse controls of camera features.\n+\n+#include <dc1394/log.h>\n+\n+Data Structures\n+\u2022 struct dc1394feature_modes_t\n+\u2022 struct dc1394trigger_modes_t\n+\u2022 struct dc1394trigger_sources_t\n+\u2022 struct __dc1394feature_info_t_struct\n+\u2022 struct __dc1394featureset_t\n+\n+Typedefs\n+\u2022 typedef struct __dc1394feature_info_t_struct dc1394feature_info_t\n+\u2022 typedef struct __dc1394featureset_t dc1394featureset_t\n+\n+Enumerations\n+\u2022 enum dc1394trigger_mode_t\n+\u2022 enum dc1394feature_t\n+\u2022 enum dc1394trigger_source_t\n+\u2022 enum dc1394trigger_polarity_t\n+\u2022 enum dc1394feature_mode_t\n+\n+Functions\n+dc1394error_t dc1394_feature_get_all ( dc1394camera_t \u2217camera, dc1394featureset_t \u2217features)\n+dc1394error_t dc1394_feature_get ( dc1394camera_t \u2217camera, dc1394feature_info_t \u2217feature)\n+dc1394error_t dc1394_feature_print ( dc1394feature_info_t \u2217feature, FILE \u2217fd)\n+dc1394error_t dc1394_feature_print_all ( dc1394featureset_t \u2217features, FILE \u2217fd)\n+dc1394error_t dc1394_feature_whitebalance_get_value ( dc1394camera_t \u2217camera, uint32_t \u2217u_b_\u2190value, uint32_t \u2217v_r_value)\n+\u2022 dc1394error_t dc1394_feature_whitebalance_set_value ( dc1394camera_t \u2217camera, uint32_t u_b_\u2190value, uint32_t v_r_value)\n+\u2022 dc1394error_t dc1394_feature_temperature_get_value ( dc1394camera_t \u2217camera, uint32_t \u2217target\u2190_temperature, uint32_t \u2217temperature)\n+\u2022 dc1394error_t dc1394_feature_temperature_set_value ( dc1394camera_t \u2217camera, uint32_t target_\u2190temperature)\n+\u2022 dc1394error_t dc1394_feature_whiteshading_get_value ( dc1394camera_t \u2217camera, uint32_t \u2217r_value,\n+uint32_t \u2217g_value, uint32_t \u2217b_value)\n+\u2022 dc1394error_t dc1394_feature_whiteshading_set_value ( dc1394camera_t \u2217camera, uint32_t r_value,\n+uint32_t g_value, uint32_t b_value)\n+\u2022 dc1394error_t dc1394_feature_get_value ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+uint32_t \u2217value)\n+\u2022 dc1394error_t dc1394_feature_set_value ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+uint32_t value)\n+\n+\u2022\n+\u2022\n+\u2022\n+\u2022\n+\u2022\n+\n+Generated by Doxygen\n+\n+\f4.7 dc1394/control.h File Reference\n+\n+47\n+\n+dc1394error_t dc1394_feature_is_present ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+dc1394bool_t \u2217value)\n+\u2022 dc1394error_t dc1394_feature_is_readable ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+dc1394bool_t \u2217value)\n+\u2022 dc1394error_t dc1394_feature_get_boundaries ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+uint32_t \u2217min, uint32_t \u2217max)\n+\u2022 dc1394error_t dc1394_feature_is_switchable ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+dc1394bool_t \u2217value)\n+\u2022 dc1394error_t dc1394_feature_get_power ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+dc1394switch_t \u2217pwr)\n+\u2022 dc1394error_t dc1394_feature_set_power ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+dc1394switch_t pwr)\n+\u2022 dc1394error_t dc1394_feature_get_modes ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+dc1394feature_modes_t \u2217modes)\n+\u2022 dc1394error_t dc1394_feature_get_mode ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+dc1394feature_mode_t \u2217mode)\n+\u2022 dc1394error_t dc1394_feature_set_mode ( dc1394camera_t \u2217camera, dc1394feature_t feature,\n+dc1394feature_mode_t mode)\n+\u2022 dc1394error_t dc1394_feature_has_absolute_control ( dc1394camera_t \u2217camera, dc1394feature_t\n+feature, dc1394bool_t \u2217value)\n+\u2022 dc1394error_t dc1394_feature_get_absolute_boundaries ( dc1394camera_t \u2217camera, dc1394feature\u2190_t feature, float \u2217min, float \u2217max)\n+\u2022 dc1394error_t dc1394_feature_get_absolute_value ( dc1394camera_t \u2217camera, dc1394feature_\u2190t feature, float \u2217value)\n+\u2022 dc1394error_t dc1394_feature_set_absolute_value ( dc1394camera_t \u2217camera, dc1394feature_\u2190t feature, float value)\n+\u2022 dc1394error_t dc1394_feature_get_absolute_control ( dc1394camera_t \u2217camera, dc1394feature_t\n+feature, dc1394switch_t \u2217pwr)\n+\u2022 dc1394error_t dc1394_feature_set_absolute_control ( dc1394camera_t \u2217camera, dc1394feature_t\n+feature, dc1394switch_t pwr)\n+\u2022 dc1394error_t dc1394_external_trigger_set_polarity ( dc1394camera_t \u2217camera, dc1394trigger_\u2190polarity_t polarity)\n+\u2022 dc1394error_t dc1394_external_trigger_get_polarity ( dc1394camera_t \u2217camera, dc1394trigger_\u2190polarity_t \u2217polarity)\n+\u2022 dc1394error_t dc1394_external_trigger_has_polarity ( dc1394camera_t \u2217camera, dc1394bool_\u2190t \u2217polarity_capable)\n+\u2022 dc1394error_t dc1394_external_trigger_set_power ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n+\u2022 dc1394error_t dc1394_external_trigger_get_power ( dc1394camera_t \u2217camera, dc1394switch_t \u2217pwr)\n+\u2022 dc1394error_t dc1394_external_trigger_set_mode ( dc1394camera_t \u2217camera, dc1394trigger_\u2190mode_t mode)\n+\u2022 dc1394error_t dc1394_external_trigger_get_mode ( dc1394camera_t \u2217camera, dc1394trigger_\u2190mode_t \u2217mode)\n+\u2022 dc1394error_t dc1394_external_trigger_set_source ( dc1394camera_t \u2217camera, dc1394trigger_\u2190source_t source)\n+\u2022 dc1394error_t dc1394_external_trigger_get_source ( dc1394camera_t \u2217camera, dc1394trigger_\u2190source_t \u2217source)\n+\u2022 dc1394error_t\n+dc1394_external_trigger_get_supported_sources ( dc1394camera_t \u2217camera,\n+dc1394trigger_sources_t \u2217sources)\n+\u2022 dc1394error_t dc1394_software_trigger_set_power ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n+\u2022 dc1394error_t dc1394_software_trigger_get_power ( dc1394camera_t \u2217camera, dc1394switch_\u2190t \u2217pwr)\n+\u2022 dc1394error_t dc1394_pio_set ( dc1394camera_t \u2217camera, uint32_t value)\n+\u2022 dc1394error_t dc1394_pio_get ( dc1394camera_t \u2217camera, uint32_t \u2217value)\n+\u2022 dc1394error_t dc1394_camera_reset ( dc1394camera_t \u2217camera)\n+\u2022 dc1394error_t dc1394_camera_set_power ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n+\u2022 dc1394error_t dc1394_memory_busy ( dc1394camera_t \u2217camera, dc1394bool_t \u2217value)\n+\u2022 dc1394error_t dc1394_memory_save ( dc1394camera_t \u2217camera, uint32_t channel)\n+\u2022 dc1394error_t dc1394_memory_load ( dc1394camera_t \u2217camera, uint32_t channel)\n+\u2022\n+\n+Generated by Doxygen\n+\n+\f48\n+\n+File Documentation\n+\n+4.7.1\n+\n+Detailed Description\n+\n+Diverse controls of camera features.\n+Author\n+Gord Peters: main writer\n+Chris Urmson: some additions\n+Damien Douxchamps: some additions\n+Peter Antoniac: documentation maintainer\n+Rudolf Leitgeb: documentation writer\n+\n+This is the main include file of the library. It lists most of the library functions, enumerations and data structures.\n+\n+4.7.2\n+\n+Typedef Documentation\n+\n+4.7.2.1\n+\n+dc1394feature_info_t\n+\n+typedef struct\n+\n+__dc1394feature_info_t_struct\n+\n+dc1394feature_info_t\n+\n+A structure containing all information about a feature.\n+Some fields are only valid for some features (e.g. trigger, white balance,...)\n+\n+4.7.2.2\n+\n+dc1394featureset_t\n+\n+typedef struct\n+\n+__dc1394featureset_t\n+\n+dc1394featureset_t\n+\n+The list of features\n+\n+4.7.3\n+\n+Enumeration Type Documentation\n+\n+4.7.3.1\n+\n+dc1394feature_mode_t\n+\n+enum\n+\n+dc1394feature_mode_t\n+\n+Control modes for a feature (excl. absolute control)\n+\n+4.7.3.2\n+\n+enum\n+\n+dc1394feature_t\n+\n+dc1394feature_t\n+\n+Enumeration of camera features\n+\n+Generated by Doxygen\n+\n+\f4.7 dc1394/control.h File Reference\n+\n+4.7.3.3\n+\n+enum\n+\n+dc1394trigger_mode_t\n+\n+dc1394trigger_mode_t\n+\n+Enumeration of trigger modes\n+\n+4.7.3.4\n+\n+dc1394trigger_polarity_t\n+\n+enum\n+\n+dc1394trigger_polarity_t\n+\n+External trigger polarity\n+\n+4.7.3.5\n+\n+dc1394trigger_source_t\n+\n+enum\n+\n+dc1394trigger_source_t\n+\n+Enumeration of trigger sources\n+\n+4.7.4\n+\n+Function Documentation\n+\n+4.7.4.1\n+\n+dc1394_camera_reset()\n+\n+dc1394error_t dc1394_camera_reset (\n+dc1394camera_t \u2217 camera )\n+\n+reset a camera to factory default settings\n+\n+4.7.4.2\n+\n+dc1394_camera_set_power()\n+\n+dc1394error_t dc1394_camera_set_power (\n+dc1394camera_t \u2217 camera,\n+dc1394switch_t pwr )\n+\n+turn a camera on or off\n+\n+4.7.4.3\n+\n+dc1394_external_trigger_get_mode()\n+\n+dc1394error_t dc1394_external_trigger_get_mode (\n+dc1394camera_t \u2217 camera,\n+dc1394trigger_mode_t \u2217 mode )\n+\n+Gets the external trigger mode\n+\n+Generated by Doxygen\n+\n+49\n+\n+\f50\n+\n+4.7.4.4\n+\n+File Documentation\n+\n+dc1394_external_trigger_get_polarity()\n+\n+dc1394error_t dc1394_external_trigger_get_polarity (\n+dc1394camera_t \u2217 camera,\n+dc1394trigger_polarity_t \u2217 polarity )\n+\n+Gets the polarity of the external trigger\n+\n+4.7.4.5\n+\n+dc1394_external_trigger_get_power()\n+\n+dc1394error_t dc1394_external_trigger_get_power (\n+dc1394camera_t \u2217 camera,\n+dc1394switch_t \u2217 pwr )\n+\n+Gets the status of the external trigger\n+\n+4.7.4.6\n+\n+dc1394_external_trigger_get_source()\n+\n+dc1394error_t dc1394_external_trigger_get_source (\n+dc1394camera_t \u2217 camera,\n+dc1394trigger_source_t \u2217 source )\n+\n+Gets the external trigger source\n+\n+4.7.4.7\n+\n+dc1394_external_trigger_get_supported_sources()\n+\n+dc1394error_t dc1394_external_trigger_get_supported_sources (\n+dc1394camera_t \u2217 camera,\n+dc1394trigger_sources_t \u2217 sources )\n+\n+Gets the list of available external trigger source\n+\n+4.7.4.8\n+\n+dc1394_external_trigger_has_polarity()\n+\n+dc1394error_t dc1394_external_trigger_has_polarity (\n+dc1394camera_t \u2217 camera,\n+dc1394bool_t \u2217 polarity_capable )\n+\n+Tells whether the external trigger can change its polarity or not.\n+\n+4.7.4.9\n+\n+dc1394_external_trigger_set_mode()\n+\n+dc1394error_t dc1394_external_trigger_set_mode (\n+dc1394camera_t \u2217 camera,\n+dc1394trigger_mode_t mode )\n+\n+Sets the external trigger mode\n+\n+Generated by Doxygen\n+\n+\f4.7 dc1394/control.h File Reference\n+\n+4.7.4.10\n+\n+dc1394_external_trigger_set_polarity()\n+\n+dc1394error_t dc1394_external_trigger_set_polarity (\n+dc1394camera_t \u2217 camera,\n+dc1394trigger_polarity_t polarity )\n+\n+Sets the polarity of the external trigger\n+\n+4.7.4.11\n+\n+dc1394_external_trigger_set_power()\n+\n+dc1394error_t dc1394_external_trigger_set_power (\n+dc1394camera_t \u2217 camera,\n+dc1394switch_t pwr )\n+\n+Switch between internal and external trigger\n+\n+4.7.4.12\n+\n+dc1394_external_trigger_set_source()\n+\n+dc1394error_t dc1394_external_trigger_set_source (\n+dc1394camera_t \u2217 camera,\n+dc1394trigger_source_t source )\n+\n+Sets the external trigger source\n+\n+4.7.4.13\n+\n+dc1394_feature_get()\n+\n+dc1394error_t dc1394_feature_get (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_info_t \u2217 feature )\n+\n+Stores the bounds and options associated with the feature described by feature->feature_id\n+\n+4.7.4.14\n+\n+dc1394_feature_get_absolute_boundaries()\n+\n+dc1394error_t dc1394_feature_get_absolute_boundaries (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+float \u2217 min,\n+float \u2217 max )\n+\n+Gets the absolute boundaries of a feature\n+\n+4.7.4.15\n+\n+dc1394_feature_get_absolute_control()\n+\n+dc1394error_t dc1394_feature_get_absolute_control (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+dc1394switch_t \u2217 pwr )\n+\n+Gets the status of absolute control of a feature\n+Generated by Doxygen\n+\n+51\n+\n+\f52\n+\n+4.7.4.16\n+\n+File Documentation\n+\n+dc1394_feature_get_absolute_value()\n+\n+dc1394error_t dc1394_feature_get_absolute_value (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+float \u2217 value )\n+\n+Gets the absolute value of a feature\n+\n+4.7.4.17\n+\n+dc1394_feature_get_all()\n+\n+dc1394error_t dc1394_feature_get_all (\n+dc1394camera_t \u2217 camera,\n+dc1394featureset_t \u2217 features )\n+\n+Collects the available features for the camera described by node and stores them in features.\n+\n+4.7.4.18\n+\n+dc1394_feature_get_boundaries()\n+\n+dc1394error_t dc1394_feature_get_boundaries (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+uint32_t \u2217 min,\n+uint32_t \u2217 max )\n+\n+Gets the boundaries of a feature\n+\n+4.7.4.19\n+\n+dc1394_feature_get_mode()\n+\n+dc1394error_t dc1394_feature_get_mode (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+dc1394feature_mode_t \u2217 mode )\n+\n+Gets the current control modes for a feature\n+\n+4.7.4.20\n+\n+dc1394_feature_get_modes()\n+\n+dc1394error_t dc1394_feature_get_modes (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+dc1394feature_modes_t \u2217 modes )\n+\n+Gets the list of control modes for a feature (manual, auto, etc...)\n+\n+4.7.4.21\n+\n+dc1394_feature_get_power()\n+\n+dc1394error_t dc1394_feature_get_power (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+dc1394switch_t \u2217 pwr )\n+\n+Gets the power status of a feature (ON or OFF)\n+Generated by Doxygen\n+\n+\f4.7 dc1394/control.h File Reference\n+\n+4.7.4.22\n+\n+dc1394_feature_get_value()\n+\n+dc1394error_t dc1394_feature_get_value (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+uint32_t \u2217 value )\n+\n+Gets the value of a feature\n+\n+4.7.4.23\n+\n+dc1394_feature_has_absolute_control()\n+\n+dc1394error_t dc1394_feature_has_absolute_control (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+dc1394bool_t \u2217 value )\n+\n+Tells whether a feature can be controlled in absolute mode\n+\n+4.7.4.24\n+\n+dc1394_feature_is_present()\n+\n+dc1394error_t dc1394_feature_is_present (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+dc1394bool_t \u2217 value )\n+\n+Tells whether a feature is present or not\n+\n+4.7.4.25\n+\n+dc1394_feature_is_readable()\n+\n+dc1394error_t dc1394_feature_is_readable (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+dc1394bool_t \u2217 value )\n+\n+Tells whether a feature is readable or not\n+\n+4.7.4.26\n+\n+dc1394_feature_is_switchable()\n+\n+dc1394error_t dc1394_feature_is_switchable (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+dc1394bool_t \u2217 value )\n+\n+Tells whether a feature is switcheable or not (ON/OFF)\n+\n+4.7.4.27\n+\n+dc1394_feature_print()\n+\n+dc1394error_t dc1394_feature_print (\n+dc1394feature_info_t \u2217 feature,\n+FILE \u2217 fd )\n+\n+Displays the bounds and options of the given feature\n+Generated by Doxygen\n+\n+53\n+\n+\f54\n+\n+4.7.4.28\n+\n+File Documentation\n+\n+dc1394_feature_print_all()\n+\n+dc1394error_t dc1394_feature_print_all (\n+dc1394featureset_t \u2217 features,\n+FILE \u2217 fd )\n+\n+Displays the bounds and options of every feature supported by the camera\n+\n+4.7.4.29\n+\n+dc1394_feature_set_absolute_control()\n+\n+dc1394error_t dc1394_feature_set_absolute_control (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+dc1394switch_t pwr )\n+\n+Sets the feature in absolute control mode (ON/OFF)\n+\n+4.7.4.30\n+\n+dc1394_feature_set_absolute_value()\n+\n+dc1394error_t dc1394_feature_set_absolute_value (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+float value )\n+\n+Sets the absolute value of a feature\n+\n+4.7.4.31\n+\n+dc1394_feature_set_mode()\n+\n+dc1394error_t dc1394_feature_set_mode (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+dc1394feature_mode_t mode )\n+\n+Sets the current control modes for a feature\n+\n+4.7.4.32\n+\n+dc1394_feature_set_power()\n+\n+dc1394error_t dc1394_feature_set_power (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+dc1394switch_t pwr )\n+\n+Sets the power status of a feature (ON or OFF)\n+\n+4.7.4.33\n+\n+dc1394_feature_set_value()\n+\n+dc1394error_t dc1394_feature_set_value (\n+dc1394camera_t \u2217 camera,\n+dc1394feature_t feature,\n+uint32_t value )\n+\n+Sets the value of a feature\n+Generated by Doxygen\n+\n+\f4.7 dc1394/control.h File Reference\n+\n+4.7.4.34\n+\n+55\n+\n+dc1394_feature_temperature_get_value()\n+\n+dc1394error_t dc1394_feature_temperature_get_value (\n+dc1394camera_t \u2217 camera,\n+uint32_t \u2217 target_temperature,\n+uint32_t \u2217 temperature )\n+\n+Gets the temperature values (target and current)\n+\n+4.7.4.35\n+\n+dc1394_feature_temperature_set_value()\n+\n+dc1394error_t dc1394_feature_temperature_set_value (\n+dc1394camera_t \u2217 camera,\n+uint32_t target_temperature )\n+\n+Sets the temperature values (target only) FIXME: COULD BE DROPPED? already in the standard feature_set_\u2190value()?\n+\n+4.7.4.36\n+\n+dc1394_feature_whitebalance_get_value()\n+\n+dc1394error_t dc1394_feature_whitebalance_get_value (\n+dc1394camera_t \u2217 camera,\n+uint32_t \u2217 u_b_value,\n+uint32_t \u2217 v_r_value )\n+\n+Gets the whitebalance values\n+\n+4.7.4.37\n+\n+dc1394_feature_whitebalance_set_value()\n+\n+dc1394error_t dc1394_feature_whitebalance_set_value (\n+dc1394camera_t \u2217 camera,\n+uint32_t u_b_value,\n+uint32_t v_r_value )\n+\n+Sets the whitebalance values\n+\n+4.7.4.38\n+\n+dc1394_feature_whiteshading_get_value()\n+\n+dc1394error_t dc1394_feature_whiteshading_get_value (\n+dc1394camera_t \u2217 camera,\n+uint32_t \u2217 r_value,\n+uint32_t \u2217 g_value,\n+uint32_t \u2217 b_value )\n+\n+Gets the white shading values\n+\n+Generated by Doxygen\n+\n+\f56\n+\n+4.7.4.39\n+\n+File Documentation\n+\n+dc1394_feature_whiteshading_set_value()\n+\n+dc1394error_t dc1394_feature_whiteshading_set_value (\n+dc1394camera_t \u2217 camera,\n+uint32_t r_value,\n+uint32_t g_value,\n+uint32_t b_value )\n+\n+Sets the white shading values\n+\n+4.7.4.40\n+\n+dc1394_memory_busy()\n+\n+dc1394error_t dc1394_memory_busy (\n+dc1394camera_t \u2217 camera,\n+dc1394bool_t \u2217 value )\n+\n+Download a camera setup from the memory.\n+\n+4.7.4.41\n+\n+dc1394_memory_load()\n+\n+dc1394error_t dc1394_memory_load (\n+dc1394camera_t \u2217 camera,\n+uint32_t channel )\n+\n+Tells whether the writing of the camera setup in memory is finished or not.\n+\n+4.7.4.42\n+\n+dc1394_memory_save()\n+\n+dc1394error_t dc1394_memory_save (\n+dc1394camera_t \u2217 camera,\n+uint32_t channel )\n+\n+Uploads a camera setup in the memory.\n+Note that this operation can only be performed a certain number of times for a given camera, as it requires reprogramming of an EEPROM.\n+\n+4.7.4.43\n+\n+dc1394_pio_get()\n+\n+dc1394error_t dc1394_pio_get (\n+dc1394camera_t \u2217 camera,\n+uint32_t \u2217 value )\n+\n+Gets the current quadlet at the PIO (input)\n+\n+4.7.4.44\n+\n+dc1394_pio_set()\n+\n+dc1394error_t dc1394_pio_set (\n+dc1394camera_t \u2217 camera,\n+uint32_t value )\n+\n+Sends a quadlet on the PIO (output)\n+Generated by Doxygen\n+\n+\f4.8 dc1394/log.h File Reference\n+\n+4.7.4.45\n+\n+57\n+\n+dc1394_software_trigger_get_power()\n+\n+dc1394error_t dc1394_software_trigger_get_power (\n+dc1394camera_t \u2217 camera,\n+dc1394switch_t \u2217 pwr )\n+\n+Gets the state of software trigger\n+\n+4.7.4.46\n+\n+dc1394_software_trigger_set_power()\n+\n+dc1394error_t dc1394_software_trigger_set_power (\n+dc1394camera_t \u2217 camera,\n+dc1394switch_t pwr )\n+\n+Turn software trigger on or off\n \n 4.8\n \n dc1394/log.h File Reference\n \n Functions to log errors, warning and debug messages.\n \n #include <dc1394/dc1394.h>\n \n Enumerations\n \u2022 enum dc1394error_t\n \u2022 enum dc1394log_t\n-Generated by Doxygen\n-\n-\f58\n-\n-File Documentation\n \n Functions\n \u2022 dc1394error_t dc1394_log_register_handler ( dc1394log_t type, void(\u2217log_handler)( dc1394log_t type,\n const char \u2217message, void \u2217user), void \u2217user)\n \u2022 dc1394error_t dc1394_log_set_default_handler ( dc1394log_t type)\n \u2022 void dc1394_log_error (const char \u2217format,...)\n \u2022 void dc1394_log_warning (const char \u2217format,...)\n@@ -5291,15 +5285,21 @@\n Detailed Description\n \n Functions to log errors, warning and debug messages.\n Author\n Damien Douxchamps: coding\n Rudolf Leitgeb: coding\n Peter Antoniac: documentation maintainer\n+\n More details soon\n+Generated by Doxygen\n+\n+\f58\n+\n+File Documentation\n \n 4.8.2\n \n Enumeration Type Documentation\n \n 4.8.2.1\n \n@@ -5309,21 +5309,24 @@\n \n dc1394error_t\n \n Error codes returned by most libdc1394 functions.\n General rule: 0 is success, negative denotes a problem.\n \n 4.8.2.2\n+\n enum\n \n dc1394log_t\n+\n dc1394log_t\n \n Types of logging messages\n Three types exist:\n+\n \u2022 ERROR for real, hard, unrecoverable errors that will result in the program terminating.\n \u2022 WARNING for things that have gone wrong, but are not requiring a termination of the program.\n \u2022 DEBUG for debug messages that can be very verbose but may help the developers to fix bugs.\n \n 4.8.3\n \n Function Documentation\n@@ -5335,21 +5338,14 @@\n void dc1394_log_debug (\n const char \u2217 format,\n ... )\n \n dc1394_log_debug: logs a debug statement to the registered facility This function shall be invoked if a debug\n statement is to be logged. The message passed as argument is delivered to the registered debug reporting function\n registered before ONLY IF the environment variable DC1394_DEBUG has been set before the program starts.\n-\n-Generated by Doxygen\n-\n-\f4.8 dc1394/log.h File Reference\n-\n-59\n-\n Parameters\n \n in\n \n 4.8.3.2\n \n format,...\n@@ -5361,14 +5357,21 @@\n void dc1394_log_error (\n const char \u2217 format,\n ... )\n \n dc1394_log_error: logs a fatal error condition to the registered facility This function shall be invoked if a fatal error\n condition is encountered. The message passed as argument is delivered to the registered error reporting function\n registered before.\n+\n+Generated by Doxygen\n+\n+\f4.9 dc1394/register.h File Reference\n+\n+59\n+\n Parameters\n \n in\n \n 4.8.3.3\n \n format,...\n@@ -5416,19 +5419,14 @@\n 4.8.3.5\n \n dc1394_log_warning()\n \n void dc1394_log_warning (\n const char \u2217 format,\n ... )\n-Generated by Doxygen\n-\n-\f60\n-\n-File Documentation\n \n dc1394_log_warning: logs a nonfatal error condition to the registered facility This function shall be invoked if a\n nonfatal error condition is encountered. The message passed as argument is delivered to the registered warning\n reporting function registered before.\n Parameters\n \n in\n@@ -5438,14 +5436,19 @@\n format,...\n \n warning message to be logged, multiple arguments allowed (printf style)\n \n dc1394/register.h File Reference\n \n Functions to directly access camera registers.\n+Generated by Doxygen\n+\n+\f60\n+\n+File Documentation\n \n Functions\n dc1394error_t dc1394_get_registers ( dc1394camera_t \u2217camera, uint64_t offset, uint32_t \u2217value,\n uint32_t num_regs)\n \u2022 dc1394error_t dc1394_set_registers ( dc1394camera_t \u2217camera, uint64_t offset, const uint32_t \u2217value,\n uint32_t num_regs)\n \u2022 dc1394error_t dc1394_get_control_registers ( dc1394camera_t \u2217camera, uint64_t offset, uint32_\u2190t \u2217value, uint32_t num_regs)\n@@ -5470,21 +5473,20 @@\n \u2022\n \n 4.9.1\n \n Detailed Description\n \n Functions to directly access camera registers.\n+\n Author\n Damien Douxchamps: coding\n Peter Antoniac: documentation maintainer\n-More details soon\n-Generated by Doxygen\n \n-\f4.9 dc1394/register.h File Reference\n+More details soon\n \n 4.9.2\n \n Function Documentation\n \n 4.9.2.1\n \n@@ -5493,14 +5495,17 @@\n dc1394error_t dc1394_get_absolute_register (\n dc1394camera_t \u2217 camera,\n unsigned int feature,\n uint64_t offset,\n uint32_t \u2217 value )\n \n No Docs\n+Generated by Doxygen\n+\n+\f4.9 dc1394/register.h File Reference\n \n 4.9.2.2\n \n dc1394_get_adv_control_registers()\n \n dc1394error_t dc1394_get_adv_control_registers (\n dc1394camera_t \u2217 camera,\n@@ -5540,36 +5545,37 @@\n \n dc1394error_t dc1394_get_PIO_register (\n dc1394camera_t \u2217 camera,\n uint64_t offset,\n uint32_t \u2217 value )\n \n No Docs\n-Generated by Doxygen\n-\n-61\n-\n-\f62\n \n 4.9.2.6\n \n-File Documentation\n-\n dc1394_get_registers()\n \n dc1394error_t dc1394_get_registers (\n dc1394camera_t \u2217 camera,\n uint64_t offset,\n uint32_t \u2217 value,\n uint32_t num_regs )\n \n No Docs\n \n+Generated by Doxygen\n+\n+61\n+\n+\f62\n+\n 4.9.2.7\n \n+File Documentation\n+\n dc1394_get_SIO_register()\n \n dc1394error_t dc1394_get_SIO_register (\n dc1394camera_t \u2217 camera,\n uint64_t offset,\n uint32_t \u2217 value )\n \n@@ -5606,30 +5612,30 @@\n dc1394camera_t \u2217 camera,\n uint64_t offset,\n const uint32_t \u2217 value,\n uint32_t num_regs )\n \n No Docs\n \n-Generated by Doxygen\n-\n-\f4.9 dc1394/register.h File Reference\n-\n 4.9.2.11\n \n dc1394_set_control_registers()\n \n dc1394error_t dc1394_set_control_registers (\n dc1394camera_t \u2217 camera,\n uint64_t offset,\n const uint32_t \u2217 value,\n uint32_t num_regs )\n \n No Docs\n \n+Generated by Doxygen\n+\n+\f4.9 dc1394/register.h File Reference\n+\n 4.9.2.12\n \n dc1394_set_format7_register()\n \n dc1394error_t dc1394_set_format7_register (\n dc1394camera_t \u2217 camera,\n unsigned int mode,\n@@ -5668,33 +5674,33 @@\n dc1394error_t dc1394_set_SIO_register (\n dc1394camera_t \u2217 camera,\n uint64_t offset,\n uint32_t value )\n \n No Docs\n \n-Generated by Doxygen\n-\n-63\n-\n-\f64\n-\n-File Documentation\n-\n 4.9.2.16\n \n dc1394_set_strobe_register()\n \n dc1394error_t dc1394_set_strobe_register (\n dc1394camera_t \u2217 camera,\n uint64_t offset,\n uint32_t value )\n \n No Docs\n \n+Generated by Doxygen\n+\n+63\n+\n+\f64\n+\n+File Documentation\n+\n 4.10\n \n dc1394/types.h File Reference\n \n Various types that must be defined here.\n \n #include <stdint.h>\n@@ -5728,24 +5734,18 @@\n \n enum\n \n dc1394bool_t\n \n Yet another boolean data type\n \n-Generated by Doxygen\n-\n-\f4.11 dc1394/utils.h File Reference\n-\n 4.10.2.2\n \n enum\n \n-65\n-\n dc1394byte_order_t\n \n dc1394byte_order_t\n \n Byte order for YUV formats (may be expanded to RGB in the future)\n IIDC cameras always return data in UYVY order, but conversion functions can change this if requested.\n \n@@ -5754,19 +5754,24 @@\n enum\n \n dc1394color_coding_t\n \n dc1394color_coding_t\n \n Enumeration of colour codings. For details on the data format please read the IIDC specifications.\n+Generated by Doxygen\n+\n+\f4.11 dc1394/utils.h File Reference\n \n 4.10.2.4\n \n enum\n \n+65\n+\n dc1394color_filter_t\n \n dc1394color_filter_t\n \n RAW sensor filters. These elementary tiles tesselate the image plane in RAW modes. RGGB should be interpreted\n in 2D as\n RG GB\n@@ -5795,20 +5800,14 @@\n \n 4.11\n \n dc1394/utils.h File Reference\n \n Utility functions.\n \n-Generated by Doxygen\n-\n-\f66\n-\n-File Documentation\n-\n Functions\n \u2022 dc1394error_t dc1394_get_image_size_from_video_mode ( dc1394camera_t \u2217camera, dc1394video\u2190_mode_t video_mode, uint32_t \u2217width, uint32_t \u2217height)\n \u2022 dc1394error_t dc1394_framerate_as_float ( dc1394framerate_t framerate_enum, float \u2217framerate)\n \u2022 dc1394error_t dc1394_get_color_coding_data_depth ( dc1394color_coding_t color_coding, uint32_t\n \u2217bits)\n \u2022 dc1394error_t dc1394_get_color_coding_bit_size ( dc1394color_coding_t color_coding, uint32_t \u2217bits)\n \u2022 dc1394error_t dc1394_get_color_coding_from_video_mode ( dc1394camera_t \u2217camera, dc1394video\u2190_mode_t video_mode, dc1394color_coding_t \u2217color_coding)\n@@ -5816,24 +5815,28 @@\n \u2022 dc1394bool_t dc1394_is_video_mode_scalable ( dc1394video_mode_t video_mode)\n \u2022 dc1394bool_t dc1394_is_video_mode_still_image ( dc1394video_mode_t video_mode)\n \u2022 dc1394bool_t dc1394_is_same_camera ( dc1394camera_id_t id1, dc1394camera_id_t id2)\n \u2022 const char \u2217 dc1394_feature_get_string ( dc1394feature_t feature)\n \u2022 const char \u2217 dc1394_error_get_string ( dc1394error_t error)\n \u2022 uint16_t dc1394_checksum_crc16 (const uint8_t \u2217buffer, uint32_t buffer_size)\n \n+Generated by Doxygen\n+\n+\f66\n+\n+File Documentation\n+\n 4.11.1\n \n Detailed Description\n \n Utility functions.\n-\n Author\n Damien Douxchamps: coding\n Peter Antoniac: documentation maintainer\n-\n More details soon\n \n 4.11.2\n \n Function Documentation\n \n 4.11.2.1\n@@ -5851,22 +5854,16 @@\n dc1394_error_get_string()\n \n const char \u2217 dc1394_error_get_string (\n dc1394error_t error )\n \n Returns a descriptive string for an error code\n \n-Generated by Doxygen\n-\n-\f4.11 dc1394/utils.h File Reference\n-\n 4.11.2.3\n \n-67\n-\n dc1394_feature_get_string()\n \n const char \u2217 dc1394_feature_get_string (\n dc1394feature_t feature )\n \n Returns a descriptive name for a feature\n \n@@ -5886,17 +5883,22 @@\n \n dc1394error_t dc1394_get_color_coding_bit_size (\n dc1394color_coding_t color_coding,\n uint32_t \u2217 bits )\n \n Returns the bit-space used by a pixel. This is different from the data depth! For instance, RGB16 has a bit space of\n 48 bits, YUV422 is 16bits and YU411 is 12bits.\n+Generated by Doxygen\n+\n+\f4.11 dc1394/utils.h File Reference\n \n 4.11.2.6\n \n+67\n+\n dc1394_get_color_coding_data_depth()\n \n dc1394error_t dc1394_get_color_coding_data_depth (\n dc1394color_coding_t color_coding,\n uint32_t \u2217 bits )\n \n Returns the number of bits per pixel for a certain color coding. This is the size of the data sent on the bus, the\n@@ -5921,22 +5923,17 @@\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n uint32_t \u2217 width,\n uint32_t \u2217 height )\n \n Returns the image width and height (in pixels) corresponding to a video mode. Works for scalable and non-scalable\n video modes.\n-Generated by Doxygen\n-\n-\f68\n \n 4.11.2.9\n \n-File Documentation\n-\n dc1394_is_color()\n \n dc1394error_t dc1394_is_color (\n dc1394color_coding_t color_mode,\n dc1394bool_t \u2217 is_color )\n \n Tells whether the color mode is color or monochrome\n@@ -5955,14 +5952,19 @@\n \n dc1394_is_video_mode_scalable()\n \n dc1394bool_t dc1394_is_video_mode_scalable (\n dc1394video_mode_t video_mode )\n \n Tells whether the video mode is scalable or not.\n+Generated by Doxygen\n+\n+\f68\n+\n+File Documentation\n \n 4.11.2.12\n \n dc1394_is_video_mode_still_image()\n \n dc1394bool_t dc1394_is_video_mode_still_image (\n dc1394video_mode_t video_mode )\n@@ -5976,20 +5978,14 @@\n \n No docs yet.\n \n #include <stdint.h>\n #include <dc1394/types.h>\n #include <dc1394/log.h>\n \n-Generated by Doxygen\n-\n-\f4.12 dc1394/vendor/avt.h File Reference\n-\n-69\n-\n Functions\n dc1394error_t dc1394_avt_get_version ( dc1394camera_t \u2217camera, uint32_t \u2217UCType, uint32_\u2190t \u2217Version, uint32_t \u2217Camera_ID, uint32_t \u2217FPGA_Version)\n \u2022 dc1394error_t dc1394_avt_get_advanced_feature_inquiry ( dc1394camera_t \u2217camera, dc1394_avt_\u2190adv_feature_info_t \u2217adv_feature)\n \u2022 dc1394error_t dc1394_avt_print_advanced_feature (dc1394_avt_adv_feature_info_t \u2217adv_feature)\n \u2022 dc1394error_t\n dc1394_avt_get_shading ( dc1394camera_t \u2217camera,\n dc1394bool_t \u2217on_off,\n@@ -6015,15 +6011,24 @@\n \u2217MaxValue)\n \u2022 dc1394error_t dc1394_avt_set_auto_shutter ( dc1394camera_t \u2217camera, uint32_t MinValue, uint32_t\n MaxValue)\n \u2022 dc1394error_t dc1394_avt_get_auto_gain ( dc1394camera_t \u2217camera, uint32_t \u2217MinValue, uint32_\u2190t \u2217MaxValue)\n \u2022 dc1394error_t dc1394_avt_set_auto_gain ( dc1394camera_t \u2217camera, uint32_t MinValue, uint32_\u2190t MaxValue)\n \u2022 dc1394error_t dc1394_avt_get_trigger_delay ( dc1394camera_t \u2217camera, dc1394bool_t \u2217on_off,\n uint32_t \u2217DelayTime)\n-\u2022 dc1394error_t dc1394_avt_set_trigger_delay ( dc1394camera_t \u2217camera, dc1394bool_t on_off,\n+\n+\u2022\n+\n+Generated by Doxygen\n+\n+\f4.12 dc1394/vendor/avt.h File Reference\n+\n+69\n+\n+dc1394error_t dc1394_avt_set_trigger_delay ( dc1394camera_t \u2217camera, dc1394bool_t on_off,\n uint32_t DelayTime)\n \u2022 dc1394error_t dc1394_avt_get_mirror ( dc1394camera_t \u2217camera, dc1394bool_t \u2217on_off)\n \u2022 dc1394error_t dc1394_avt_set_mirror ( dc1394camera_t \u2217camera, dc1394bool_t on_off)\n \u2022 dc1394error_t dc1394_avt_get_dsnu ( dc1394camera_t \u2217camera, dc1394bool_t \u2217on_off, uint32_\u2190t \u2217frame_nb)\n \u2022 dc1394error_t dc1394_avt_set_dsnu ( dc1394camera_t \u2217camera, dc1394bool_t on_off, dc1394bool\u2190_t compute, uint32_t frame_nb)\n \u2022 dc1394error_t dc1394_avt_get_blemish ( dc1394camera_t \u2217camera, dc1394bool_t \u2217on_off, uint32_t\n \u2217frame_nb)\n@@ -6034,22 +6039,14 @@\n \u2022 dc1394error_t dc1394_avt_get_io ( dc1394camera_t \u2217camera, uint32_t IO, dc1394bool_t \u2217polarity,\n uint32_t \u2217mode, dc1394bool_t \u2217pinstate)\n \u2022 dc1394error_t dc1394_avt_set_io ( dc1394camera_t \u2217camera, uint32_t IO, dc1394bool_t polarity,\n uint32_t mode, dc1394bool_t pinstate)\n \u2022 dc1394error_t dc1394_avt_reset ( dc1394camera_t \u2217camera)\n \u2022 dc1394error_t dc1394_avt_get_lut ( dc1394camera_t \u2217camera, dc1394bool_t \u2217on_off, uint32_t \u2217lutnb)\n \u2022 dc1394error_t dc1394_avt_set_lut ( dc1394camera_t \u2217camera, dc1394bool_t on_off, uint32_t lutnb)\n-\n-\u2022\n-\n-Generated by Doxygen\n-\n-\f70\n-\n-File Documentation\n \u2022 dc1394error_t dc1394_avt_get_lut_mem_ctrl ( dc1394camera_t \u2217camera, dc1394bool_t \u2217en_write,\n uint32_t \u2217AccessLutNo, uint32_t \u2217addroffset)\n \u2022 dc1394error_t dc1394_avt_set_lut_mem_ctrl ( dc1394camera_t \u2217camera, dc1394bool_t en_write,\n uint32_t AccessLutNo, uint32_t addroffset)\n \u2022 dc1394error_t dc1394_avt_get_lut_info ( dc1394camera_t \u2217camera, uint32_t \u2217NumOfLuts, uint32_\u2190t \u2217MaxLutSize)\n \u2022 dc1394error_t dc1394_avt_get_aoi ( dc1394camera_t \u2217camera, dc1394bool_t \u2217on_off, int \u2217left, int \u2217top,\n int \u2217width, int \u2217height)\n@@ -6075,17 +6072,24 @@\n dc1394bool_t reset, int32_t Crr, int32_t Cgr, int32_t Cbr, int32_t Crg, int32_t Cgg, int32_t Cbg, int32_t\n Crb, int32_t Cgb, int32_t Cbb)\n \u2022 dc1394error_t dc1394_avt_get_color_corr ( dc1394camera_t \u2217camera, dc1394bool_t \u2217on_off, int32_t\n \u2217Crr, int32_t \u2217Cgr, int32_t \u2217Cbr, int32_t \u2217Crg, int32_t \u2217Cgg, int32_t \u2217Cbg, int32_t \u2217Crb, int32_t \u2217Cgb, int32_t\n \u2217Cbb)\n \u2022 dc1394error_t dc1394_avt_get_hsnr ( dc1394camera_t \u2217camera, dc1394bool_t \u2217on_off, uint32_\u2190t \u2217grabCount)\n \u2022 dc1394error_t dc1394_avt_set_hsnr ( dc1394camera_t \u2217camera, dc1394bool_t on_off, uint32_t grab\u2190Count)\n+\u2022\n+\n+Generated by Doxygen\n+\n+\f70\n \n 4.12.1\n \n+File Documentation\n+\n Detailed Description\n \n No docs yet.\n More details soon\n \n 4.12.2\n \n@@ -6096,17 +6100,14 @@\n dc1394_avt_get_advanced_feature_inquiry()\n \n dc1394error_t dc1394_avt_get_advanced_feature_inquiry (\n dc1394camera_t \u2217 camera,\n dc1394_avt_adv_feature_info_t \u2217 adv_feature )\n \n Retrieve the supported features\n-Generated by Doxygen\n-\n-\f4.12 dc1394/vendor/avt.h File Reference\n \n 4.12.2.2\n \n dc1394_avt_get_aoi()\n \n dc1394error_t dc1394_avt_get_aoi (\n dc1394camera_t \u2217 camera,\n@@ -6136,14 +6137,18 @@\n dc1394error_t dc1394_avt_get_auto_shutter (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 MinValue,\n uint32_t \u2217 MaxValue )\n \n Get min and max shutter values for autoshutter\n \n+Generated by Doxygen\n+\n+\f4.12 dc1394/vendor/avt.h File Reference\n+\n 4.12.2.5\n \n dc1394_avt_get_blemish()\n \n dc1394error_t dc1394_avt_get_blemish (\n dc1394camera_t \u2217 camera,\n dc1394bool_t \u2217 on_off,\n@@ -6157,24 +6162,16 @@\n \n dc1394error_t dc1394_avt_get_channel_adjust (\n dc1394camera_t \u2217 camera,\n int16_t \u2217 channel_adjust )\n \n Read channel adjust (AVT Pike)\n \n-Generated by Doxygen\n-\n-71\n-\n-\f72\n-\n 4.12.2.7\n \n-File Documentation\n-\n dc1394_avt_get_color_corr()\n \n dc1394error_t dc1394_avt_get_color_corr (\n dc1394camera_t \u2217 camera,\n dc1394bool_t \u2217 on_off,\n int32_t \u2217 Crr,\n int32_t \u2217 Cgr,\n@@ -6207,17 +6204,24 @@\n \n dc1394error_t dc1394_avt_get_dsnu (\n dc1394camera_t \u2217 camera,\n dc1394bool_t \u2217 on_off,\n uint32_t \u2217 frame_nb )\n \n Get DSNU mode and num of frames used for computing dsnu correction\n+Generated by Doxygen\n+\n+71\n+\n+\f72\n \n 4.12.2.10\n \n+File Documentation\n+\n dc1394_avt_get_extented_shutter()\n \n dc1394error_t dc1394_avt_get_extented_shutter (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 timebase_id )\n \n Get the extented shutter value in us\n@@ -6227,17 +6231,14 @@\n dc1394_avt_get_frame_info()\n \n dc1394error_t dc1394_avt_get_frame_info (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 framecounter )\n \n Get the number of captured frames\n-Generated by Doxygen\n-\n-\f4.12 dc1394/vendor/avt.h File Reference\n \n 4.12.2.12\n \n dc1394_avt_get_gpdata_info()\n \n dc1394error_t dc1394_avt_get_gpdata_info (\n dc1394camera_t \u2217 camera,\n@@ -6275,36 +6276,31 @@\n \n dc1394error_t dc1394_avt_get_lut (\n dc1394camera_t \u2217 camera,\n dc1394bool_t \u2217 on_off,\n uint32_t \u2217 lutnb )\n \n Get on/off and the num of the current lut loaded\n+Generated by Doxygen\n+\n+\f4.12 dc1394/vendor/avt.h File Reference\n \n 4.12.2.16\n \n dc1394_avt_get_lut_info()\n \n dc1394error_t dc1394_avt_get_lut_info (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 NumOfLuts,\n uint32_t \u2217 MaxLutSize )\n \n Get num of luts present and the max size\n \n-Generated by Doxygen\n-\n-73\n-\n-\f74\n-\n 4.12.2.17\n \n-File Documentation\n-\n dc1394_avt_get_lut_mem_ctrl()\n \n dc1394error_t dc1394_avt_get_lut_mem_ctrl (\n dc1394camera_t \u2217 camera,\n dc1394bool_t \u2217 en_write,\n uint32_t \u2217 AccessLutNo,\n uint32_t \u2217 addroffset )\n@@ -6342,31 +6338,35 @@\n uint32_t \u2217 points_nb,\n uint32_t \u2217 kneepoint1,\n uint32_t \u2217 kneepoint2,\n uint32_t \u2217 kneepoint3 )\n \n Retrieve if on/off, the nb of kneepoints used and the kneepoints values\n \n+Generated by Doxygen\n+\n+73\n+\n+\f74\n+\n 4.12.2.21\n \n+File Documentation\n+\n dc1394_avt_get_shading()\n \n dc1394error_t dc1394_avt_get_shading (\n dc1394camera_t \u2217 camera,\n dc1394bool_t \u2217 on_off,\n dc1394bool_t \u2217 compute,\n dc1394bool_t \u2217 show,\n uint32_t \u2217 frame_nb )\n \n Retrieve if shading is on and the number of frames used to compute the shading reference frame\n \n-Generated by Doxygen\n-\n-\f4.12 dc1394/vendor/avt.h File Reference\n-\n 4.12.2.22\n \n dc1394_avt_get_shading_info()\n \n dc1394error_t dc1394_avt_get_shading_info (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 MaxImageSize )\n@@ -6411,37 +6411,33 @@\n \n dc1394error_t dc1394_avt_get_trigger_delay (\n dc1394camera_t \u2217 camera,\n dc1394bool_t \u2217 on_off,\n uint32_t \u2217 DelayTime )\n \n Get if trigger delay on and the trigger delay\n+Generated by Doxygen\n+\n+\f4.12 dc1394/vendor/avt.h File Reference\n \n 4.12.2.27\n \n dc1394_avt_get_version()\n \n dc1394error_t dc1394_avt_get_version (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 UCType,\n uint32_t \u2217 Version,\n uint32_t \u2217 Camera_ID,\n uint32_t \u2217 FPGA_Version )\n \n Retrieve the firmware version, FPGA version and the camera ID\n-Generated by Doxygen\n-\n-75\n-\n-\f76\n \n 4.12.2.28\n \n-File Documentation\n-\n dc1394_avt_print_advanced_feature()\n \n dc1394error_t dc1394_avt_print_advanced_feature (\n dc1394_avt_adv_feature_info_t \u2217 adv_feature )\n \n Print the supported features requested\n \n@@ -6480,31 +6476,35 @@\n \n dc1394_avt_reset_frame_info()\n \n dc1394error_t dc1394_avt_reset_frame_info (\n dc1394camera_t \u2217 camera )\n \n Reset frame counter\n+Generated by Doxygen\n+\n+75\n+\n+\f76\n \n 4.12.2.33\n \n+File Documentation\n+\n dc1394_avt_set_aoi()\n \n dc1394error_t dc1394_avt_set_aoi (\n dc1394camera_t \u2217 camera,\n dc1394bool_t on_off,\n int left,\n int top,\n int width,\n int height )\n \n Set on/off and area\n-Generated by Doxygen\n-\n-\f4.12 dc1394/vendor/avt.h File Reference\n \n 4.12.2.34\n \n dc1394_avt_set_auto_gain()\n \n dc1394error_t dc1394_avt_set_auto_gain (\n dc1394camera_t \u2217 camera,\n@@ -6542,14 +6542,18 @@\n \n dc1394error_t dc1394_avt_set_channel_adjust (\n dc1394camera_t \u2217 camera,\n int16_t channel_adjust )\n \n Write channel adjust (AVT Pike)\n \n+Generated by Doxygen\n+\n+\f4.12 dc1394/vendor/avt.h File Reference\n+\n 4.12.2.38\n \n dc1394_avt_set_color_corr()\n \n dc1394error_t dc1394_avt_set_color_corr (\n dc1394camera_t \u2217 camera,\n dc1394bool_t on_off,\n@@ -6561,24 +6565,17 @@\n int32_t Cgg,\n int32_t Cbg,\n int32_t Crb,\n int32_t Cgb,\n int32_t Cbb )\n \n Set Color Correction + Coefficients\n-Generated by Doxygen\n-\n-77\n-\n-\f78\n \n 4.12.2.39\n \n-File Documentation\n-\n dc1394_avt_set_deferred_trans()\n \n dc1394error_t dc1394_avt_set_deferred_trans (\n dc1394camera_t \u2217 camera,\n dc1394bool_t HoldImage,\n dc1394bool_t FastCapture,\n uint32_t FifoSize,\n@@ -6605,16 +6602,24 @@\n \n dc1394error_t dc1394_avt_set_extented_shutter (\n dc1394camera_t \u2217 camera,\n uint32_t timebase_id )\n \n Set the extented shutter value in us\n \n+Generated by Doxygen\n+\n+77\n+\n+\f78\n+\n 4.12.2.42\n \n+File Documentation\n+\n dc1394_avt_set_hsnr()\n \n dc1394error_t dc1394_avt_set_hsnr (\n dc1394camera_t \u2217 camera,\n dc1394bool_t on_off,\n uint32_t grabCount )\n \n@@ -6629,18 +6634,14 @@\n uint32_t IO,\n dc1394bool_t polarity,\n uint32_t mode,\n dc1394bool_t pinstate )\n \n Set the polarity, the mode and the state of the IO\n \n-Generated by Doxygen\n-\n-\f4.12 dc1394/vendor/avt.h File Reference\n-\n 4.12.2.44\n \n dc1394_avt_set_lut()\n \n dc1394error_t dc1394_avt_set_lut (\n dc1394camera_t \u2217 camera,\n dc1394bool_t on_off,\n@@ -6666,14 +6667,18 @@\n \n dc1394error_t dc1394_avt_set_mirror (\n dc1394camera_t \u2217 camera,\n dc1394bool_t on_off )\n \n Set mirror mode\n \n+Generated by Doxygen\n+\n+\f4.12 dc1394/vendor/avt.h File Reference\n+\n 4.12.2.47\n \n dc1394_avt_set_multiple_slope()\n \n dc1394error_t dc1394_avt_set_multiple_slope (\n dc1394camera_t \u2217 camera,\n dc1394bool_t on_off,\n@@ -6693,24 +6698,16 @@\n dc1394bool_t on_off,\n dc1394bool_t compute,\n dc1394bool_t show,\n uint32_t frame_nb )\n \n Set the shading to on/off and the number of frames used to compute the shading reference frame\n \n-Generated by Doxygen\n-\n-79\n-\n-\f80\n-\n 4.12.2.49\n \n-File Documentation\n-\n dc1394_avt_set_shading_mem_ctrl()\n \n dc1394error_t dc1394_avt_set_shading_mem_ctrl (\n dc1394camera_t \u2217 camera,\n dc1394bool_t en_write,\n dc1394bool_t en_read,\n uint32_t addroffset )\n@@ -6733,14 +6730,22 @@\n \n dc1394error_t dc1394_avt_set_timebase (\n dc1394camera_t \u2217 camera,\n uint32_t timebase_id )\n \n Set the timebase value with an Id. See Manual for correspondance\n \n+Generated by Doxygen\n+\n+79\n+\n+\f80\n+\n+File Documentation\n+\n 4.12.2.52\n \n dc1394_avt_set_trigger_delay()\n \n dc1394error_t dc1394_avt_set_trigger_delay (\n dc1394camera_t \u2217 camera,\n dc1394bool_t on_off,\n@@ -6765,22 +6770,17 @@\n \n dc1394error_t dc1394_avt_write_shading_img (\n dc1394camera_t \u2217 camera,\n unsigned char \u2217 buf,\n uint32_t size )\n \n Write shading image from buffer to camera\n-Generated by Doxygen\n-\n-\f4.13 dc1394/vendor/basler.h File Reference\n \n 4.13\n \n-81\n-\n dc1394/vendor/basler.h File Reference\n \n No docs yet.\n \n #include \"basler_sff.h\"\n \n Functions\n@@ -6791,14 +6791,17 @@\n \u2022 dc1394bool_t dc1394_basler_sff_check_crc (const uint8_t \u2217frame_buffer, uint32_t frame_size)\n \u2022 dc1394error_t dc1394_basler_sff_chunk_iterate_init ( dc1394basler_sff_t \u2217chunk, void \u2217frame_buffer,\n uint32_t frame_size, dc1394bool_t has_crc_checksum)\n \u2022 dc1394error_t dc1394_basler_sff_chunk_iterate ( dc1394basler_sff_t \u2217chunk)\n \u2022 dc1394error_t dc1394_basler_sff_chunk_find ( dc1394basler_sff_feature_t feature_id, void \u2217\u2217chunk\u2190_data, void \u2217frame_buffer, uint32_t frame_size, dc1394bool_t has_crc_checksum)\n \u2022 dc1394error_t dc1394_basler_sff_feature_print ( dc1394camera_t \u2217camera, dc1394basler_sff_\u2190feature_t feature_id, FILE \u2217fd)\n \u2022 dc1394error_t dc1394_basler_sff_feature_print_all ( dc1394camera_t \u2217camera, FILE \u2217fd)\n+Generated by Doxygen\n+\n+\f4.13 dc1394/vendor/basler.h File Reference\n \n 4.13.1\n \n Detailed Description\n \n No docs yet.\n More details soon\n@@ -6825,22 +6828,17 @@\n dc1394basler_sff_feature_t feature_id,\n void \u2217\u2217 chunk_data,\n void \u2217 frame_buffer,\n uint32_t frame_size,\n dc1394bool_t has_crc_checksum )\n \n Finds a specific SFF chunk in the frame buffer\n-Generated by Doxygen\n-\n-\f82\n \n 4.13.2.3\n \n-File Documentation\n-\n dc1394_basler_sff_chunk_iterate()\n \n dc1394error_t dc1394_basler_sff_chunk_iterate (\n dc1394basler_sff_t \u2217 chunk )\n \n Iterates over the available SFF chunks in the frame buffer\n \n@@ -6862,17 +6860,24 @@\n \n dc1394error_t dc1394_basler_sff_feature_enable (\n dc1394camera_t \u2217 camera,\n dc1394basler_sff_feature_t feature_id,\n dc1394switch_t on_off )\n \n Enables or disables a specific feature\n+Generated by Doxygen\n+\n+81\n+\n+\f82\n \n 4.13.2.6\n \n+File Documentation\n+\n dc1394_basler_sff_feature_is_available()\n \n dc1394error_t dc1394_basler_sff_feature_is_available (\n dc1394camera_t \u2217 camera,\n dc1394basler_sff_feature_t feature_id,\n dc1394bool_t \u2217 available )\n \n@@ -6895,22 +6900,17 @@\n \n dc1394error_t dc1394_basler_sff_feature_print (\n dc1394camera_t \u2217 camera,\n dc1394basler_sff_feature_t feature_id,\n FILE \u2217 fd )\n \n prints info about one feature\n-Generated by Doxygen\n-\n-\f4.14 dc1394/vendor/basler_sff.h File Reference\n \n 4.13.2.9\n \n-83\n-\n dc1394_basler_sff_feature_print_all()\n \n dc1394error_t dc1394_basler_sff_feature_print_all (\n dc1394camera_t \u2217 camera,\n FILE \u2217 fd )\n \n prints info about all features\n@@ -6929,14 +6929,20 @@\n \n dc1394/vendor/basler_sff.h File Reference\n \n No docs yet.\n \n #include <stdint.h>\n \n+Generated by Doxygen\n+\n+\f4.14 dc1394/vendor/basler_sff.h File Reference\n+\n+83\n+\n Data Structures\n \u2022 struct dc1394basler_sff_extended_data_stream_t\n \u2022 struct dc1394basler_sff_frame_counter_t\n \u2022 struct dc1394basler_sff_cycle_time_stamp_t\n \u2022 struct dc1394basler_dcam_csr_value_t\n \u2022 struct dc1394basler_dcam_whitebalance_csr_value_t\n \u2022 struct dc1394basler_sff_dcam_values_t\n@@ -6950,22 +6956,17 @@\n \u2022 typedef struct dc1394basler_dcam_csr_value_t dc1394basler_dcam_csr_value_t\n \u2022 typedef struct dc1394basler_dcam_whitebalance_csr_value_t dc1394basler_dcam_whitebalance_\u2190csr_value_t\n \u2022 typedef struct dc1394basler_sff_dcam_values_t dc1394basler_sff_dcam_values_t\n \u2022 typedef struct dc1394basler_sff_crc_checksum_t dc1394basler_sff_crc_checksum_t\n \n Enumerations\n \u2022 enum dc1394basler_sff_feature_t { }\n-Generated by Doxygen\n-\n-\f84\n \n 4.14.1\n \n-File Documentation\n-\n Detailed Description\n \n No docs yet.\n More details soon\n \n 4.14.2\n \n@@ -6986,19 +6987,25 @@\n 4.14.2.2\n \n dc1394basler_dcam_whitebalance_csr_value_t\n \n typedef struct\n csr_value_t\n \n+No Docs\n+\n+Generated by Doxygen\n+\n dc1394basler_dcam_whitebalance_csr_value_t\n \n dc1394basler_dcam_whitebalance_\u2190-\n \n-No Docs\n+\f84\n+\n+File Documentation\n \n 4.14.2.3\n \n dc1394basler_sff_crc_checksum_t\n \n typedef struct\n \n@@ -7033,35 +7040,29 @@\n No Docs\n \n 4.14.2.6\n \n dc1394basler_sff_extended_data_stream_t\n \n typedef struct\n+stream_t\n \n dc1394basler_sff_extended_data_stream_t\n \n dc1394basler_sff_extended_data_\u2190-\n \n-stream_t\n-\n This structure is used to capture the SFF extended data stream chunk. According to the Basler manuals the\n extended data stream chunk also contains to members pixel_data and gap of variable size; these members are\n ignored in this API because they can be obtained from other sources. The pixel_data member which is the actual\n image frame is all data from the beginning of the frame buffer until width\u2217height\u2217bytes_per_pixel bytes. The gap is\n required on some cameras for technical reason but not used otherwise. The size of the gap can be computed by\n computing frame_size - sizeof all chunks - image_size.\n-Generated by Doxygen\n-\n-\f4.14 dc1394/vendor/basler_sff.h File Reference\n \n 4.14.2.7\n \n-85\n-\n dc1394basler_sff_feature_t\n \n typedef enum\n \n dc1394basler_sff_feature_t\n \n dc1394basler_sff_feature_t\n@@ -7089,26 +7090,35 @@\n dc1394basler_sff_feature_t\n \n enum\n \n dc1394basler_sff_feature_t\n \n SFF feature IDs\n+\n+Generated by Doxygen\n+\n+\f4.14 dc1394/vendor/basler_sff.h File Reference\n+\n+85\n+\n Enumerator\n DC1394_BASLER_SFF_EXTENDED_DATA_\u2190STREAM\n \n DC1394_BASLER_SFF_FRAME_COUNTER\n \n DC1394_BASLER_SFF_CYCLE_TIME_STAMP\n \n DC1394_BASLER_SFF_DCAM_VALUES\n \n DC1394_BASLER_SFF_CRC_CHECKSUM\n \n-Generated by Doxygen\n+DC1394_BASLER_SFF_TEST_IMAGES\n+\n+DC1394_BASLER_SFF_EXTENDED_VERSION_\u2190INFO\n \n SFF Extended data stream, this feature must be\n enabled in order to use any other smart feature.\n Please refer to struct\n dc1394basler_sff_extended_data_stream for more\n information.\n The frame counter feature numbers images\n@@ -7134,24 +7144,14 @@\n image frame containing a 16bit CRC checksum\n computed using the Z-modem algorithm. The\n checksum is computed for all the image data and all\n other SFF chunks except the CRC checksum chunk.\n Please refer to the function\n dc1394_basler_validate_checksum() for more\n information\n-\n-\f86\n-\n-File Documentation\n-\n-Enumerator\n-DC1394_BASLER_SFF_TEST_IMAGES\n-\n-DC1394_BASLER_SFF_EXTENDED_VERSION_\u2190INFO\n-\n The test images feature is used to check the camera's\n basic functionality and its ability to transmit an image\n via the video data cable. The test image can be used\n for service purposes and for failure diagnostics. In\n test mode the image is generated with a software\n program and the camera's digital devices and does\n not use the optics the pixel array or the ADCs.\n@@ -7167,23 +7167,32 @@\n \n This feature is not implemented\n \n DC1394_BASLER_SFF_TRIGGER_FLAG_AND_\u2190COUNTER\n DC1394_BASLER_SFF_OUTPUT_PORT_0_\u2190CONFIGURATION\n DC1394_BASLER_SFF_OUTPUT_PORT_1_\u2190CONFIGURATION\n DC1394_BASLER_SFF_OUTPUT_PORT_2_\u2190CONFIGURATION\n-DC1394_BASLER_SFF_OUTPUT_PORT_3_\u2190CONFIGURATION\n \n This feature is not implemented\n \n-4.15\n+Generated by Doxygen\n \n This feature is not implemented\n This feature is not implemented\n This feature is not implemented\n+\n+\f86\n+\n+File Documentation\n+\n+Enumerator\n+DC1394_BASLER_SFF_OUTPUT_PORT_3_\u2190CONFIGURATION\n+\n+4.15\n+\n This feature is not implemented\n \n dc1394/vendor/basler_sff_registry.h File Reference\n \n No docs yet.\n \n #include \"basler_sff.h\"\n@@ -7196,18 +7205,14 @@\n 4.15.1\n \n Detailed Description\n \n No docs yet.\n More details soon\n \n-Generated by Doxygen\n-\n-\f4.16 dc1394/vendor/pixelink.h File Reference\n-\n 4.15.2\n \n Function Documentation\n \n 4.15.2.1\n \n basler_sff_registry_find_by_chunk_guid()\n@@ -7230,17 +7235,22 @@\n \n basler_sff_registry_find_by_id()\n \n const sff_feature \u2217 basler_sff_registry_find_by_id (\n dc1394basler_sff_feature_t feature_id )\n \n Returns a sff feature descriptor by id\n+Generated by Doxygen\n+\n+\f4.16 dc1394/vendor/pixelink.h File Reference\n \n 4.16\n \n+87\n+\n dc1394/vendor/pixelink.h File Reference\n \n No docs yet.\n \n #include <dc1394/log.h>\n #include <dc1394/types.h>\n \n@@ -7253,21 +7263,14 @@\n \u2022 typedef struct __dc1394_pxl_gpio_info_struct dc1394_pxl_gpio_info_t\n \u2022 typedef struct __dc1394_pxl_camera_info_struct dc1394_pxl_camera_info_t\n \u2022 typedef struct __dc1394_pxl_adv_feature_info_struct dc1394_pxl_adv_feature_info_t\n \n Enumerations\n \u2022 enum dc1394pxl_gpio_polarity_t\n \u2022 enum dc1394pxl_gpio_mode_t\n-Generated by Doxygen\n-\n-87\n-\n-\f88\n-\n-File Documentation\n \n Functions\n dc1394error_t dc1394_pxl_convert_float32_to_quadlet (double, uint32_t \u2217)\n dc1394error_t dc1394_pxl_convert_uint32_to_float32 (uint32_t, double \u2217)\n dc1394error_t dc1394_pxl_get_camera_name ( dc1394camera_t \u2217, char \u2217, uint32_t)\n dc1394error_t dc1394_pxl_get_camera_info ( dc1394camera_t \u2217, dc1394_pxl_camera_info_t \u2217)\n dc1394error_t dc1394_pxl_get_camera_serial_number ( dc1394camera_t \u2217, uint32_t \u2217)\n@@ -7275,29 +7278,34 @@\n uint32_t \u2217)\n \u2022 dc1394error_t dc1394_pxl_get_gpo_param_min_max ( dc1394camera_t \u2217, uint32_t, uint32_t \u2217,\n uint32_t \u2217, uint32_t \u2217, uint32_t \u2217, uint32_t \u2217, uint32_t \u2217, uint32_t \u2217, uint32_t \u2217, uint32_t \u2217)\n \u2022 dc1394error_t dc1394_pxl_get_gpo_config ( dc1394camera_t \u2217, uint32_t, uint32_t \u2217)\n \u2022 dc1394error_t dc1394_pxl_set_gpo_config ( dc1394camera_t \u2217, uint32_t, uint32_t)\n \u2022 dc1394error_t dc1394_pxl_set_gpio_mode_param ( dc1394camera_t \u2217, uint32_t, dc1394pxl_gpio_\u2190polarity_t, dc1394pxl_gpio_mode_t, double, double, double)\n \u2022 dc1394error_t dc1394_pxl_print_camera_info ( dc1394camera_t \u2217, FILE \u2217fd)\n-\n \u2022\n \u2022\n \u2022\n \u2022\n \u2022\n \u2022\n \n 4.16.1\n \n Detailed Description\n \n No docs yet.\n More details soon\n \n+Generated by Doxygen\n+\n+\f88\n+\n+File Documentation\n+\n 4.16.2\n \n Typedef Documentation\n \n 4.16.2.1\n \n dc1394_pxl_adv_feature_info_t\n@@ -7343,17 +7351,14 @@\n dc1394pxl_gpio_mode_t\n \n enum\n \n dc1394pxl_gpio_mode_t\n \n No Docs\n-Generated by Doxygen\n-\n-\f4.16 dc1394/vendor/pixelink.h File Reference\n \n 4.16.3.2\n \n enum\n \n dc1394pxl_gpio_polarity_t\n \n@@ -7371,66 +7376,65 @@\n \n dc1394error_t dc1394_pxl_convert_float32_to_quadlet (\n double ,\n uint32_t \u2217 )\n \n No Docs\n \n+Generated by Doxygen\n+\n+\f4.16 dc1394/vendor/pixelink.h File Reference\n+\n 4.16.4.2\n \n+89\n+\n dc1394_pxl_convert_uint32_to_float32()\n \n dc1394error_t dc1394_pxl_convert_uint32_to_float32 (\n uint32_t ,\n double \u2217 )\n \n No Docs\n \n 4.16.4.3\n \n dc1394_pxl_get_camera_info()\n \n dc1394error_t dc1394_pxl_get_camera_info (\n dc1394camera_t \u2217 ,\n-dc1394_pxl_camera_info_t \u2217 )\n+dc1394_pxl_camera_info_t \u2217\n+\n+)\n \n No Docs\n \n 4.16.4.4\n \n dc1394_pxl_get_camera_name()\n \n dc1394error_t dc1394_pxl_get_camera_name (\n dc1394camera_t \u2217 ,\n char \u2217 ,\n-uint32_t\n-\n-)\n+uint32_t )\n \n No Docs\n \n 4.16.4.5\n \n dc1394_pxl_get_camera_serial_number()\n \n dc1394error_t dc1394_pxl_get_camera_serial_number (\n dc1394camera_t \u2217 ,\n uint32_t \u2217 )\n \n No Docs\n-Generated by Doxygen\n-\n-89\n-\n-\f90\n \n 4.16.4.6\n \n-File Documentation\n-\n dc1394_pxl_get_gpo_config()\n \n dc1394error_t dc1394_pxl_get_gpo_config (\n dc1394camera_t \u2217 ,\n uint32_t ,\n uint32_t \u2217 )\n \n@@ -7441,20 +7445,27 @@\n dc1394_pxl_get_gpo_param()\n \n dc1394error_t dc1394_pxl_get_gpo_param (\n dc1394camera_t \u2217 ,\n uint32_t ,\n uint32_t \u2217 ,\n uint32_t \u2217 ,\n-uint32_t \u2217 )\n+uint32_t \u2217\n \n No Docs\n+Generated by Doxygen\n+\n+)\n+\n+\f90\n \n 4.16.4.8\n \n+File Documentation\n+\n dc1394_pxl_get_gpo_param_min_max()\n \n dc1394error_t dc1394_pxl_get_gpo_param_min_max (\n dc1394camera_t \u2217 ,\n uint32_t ,\n uint32_t \u2217 ,\n uint32_t \u2217 ,\n@@ -7485,27 +7496,20 @@\n dc1394error_t dc1394_pxl_set_gpio_mode_param (\n dc1394camera_t \u2217 ,\n uint32_t ,\n dc1394pxl_gpio_polarity_t ,\n dc1394pxl_gpio_mode_t ,\n double ,\n double ,\n-double\n-\n-)\n+double )\n \n No Docs\n-Generated by Doxygen\n-\n-\f4.17 dc1394/video.h File Reference\n \n 4.16.4.11\n \n-91\n-\n dc1394_pxl_set_gpo_config()\n \n dc1394error_t dc1394_pxl_set_gpo_config (\n dc1394camera_t \u2217 ,\n uint32_t ,\n uint32_t )\n \n@@ -7515,14 +7519,20 @@\n \n dc1394/video.h File Reference\n \n Functions related to video modes, formats, framerate and video flow.\n \n #include <dc1394/log.h>\n \n+Generated by Doxygen\n+\n+\f4.17 dc1394/video.h File Reference\n+\n+91\n+\n Data Structures\n \u2022 struct dc1394framerates_t\n \u2022 struct __dc1394_video_frame\n \n Typedefs\n \u2022 typedef struct __dc1394_video_frame dc1394video_frame_t\n \n@@ -7538,48 +7548,39 @@\n dc1394framerate_\u2190t \u2217framerate)\n \u2022 dc1394error_t dc1394_video_set_framerate ( dc1394camera_t \u2217camera, dc1394framerate_t framerate)\n \u2022 dc1394error_t dc1394_video_get_mode ( dc1394camera_t \u2217camera, dc1394video_mode_t \u2217video_\u2190mode)\n \u2022 dc1394error_t dc1394_video_set_mode ( dc1394camera_t \u2217camera, dc1394video_mode_t video_\u2190mode)\n \u2022 dc1394error_t dc1394_video_get_operation_mode ( dc1394camera_t \u2217camera, dc1394operation_\u2190mode_t \u2217mode)\n \u2022 dc1394error_t dc1394_video_set_operation_mode ( dc1394camera_t \u2217camera, dc1394operation_\u2190mode_t mode)\n \u2022 dc1394error_t dc1394_video_get_iso_speed ( dc1394camera_t \u2217camera, dc1394speed_t \u2217speed)\n-Generated by Doxygen\n-\n-\f92\n-\n-File Documentation\n-dc1394error_t dc1394_video_set_iso_speed ( dc1394camera_t \u2217camera, dc1394speed_t speed)\n-dc1394error_t dc1394_video_get_iso_channel ( dc1394camera_t \u2217camera, uint32_t \u2217channel)\n-dc1394error_t dc1394_video_set_iso_channel ( dc1394camera_t \u2217camera, uint32_t channel)\n-dc1394error_t dc1394_video_get_data_depth ( dc1394camera_t \u2217camera, uint32_t \u2217depth)\n-dc1394error_t dc1394_video_set_transmission ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n-dc1394error_t dc1394_video_get_transmission ( dc1394camera_t \u2217camera, dc1394switch_t \u2217pwr)\n-dc1394error_t dc1394_video_set_one_shot ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n-dc1394error_t dc1394_video_get_one_shot ( dc1394camera_t \u2217camera, dc1394bool_t \u2217is_on)\n-dc1394error_t dc1394_video_set_multi_shot ( dc1394camera_t \u2217camera, uint32_t numFrames,\n+\u2022 dc1394error_t dc1394_video_set_iso_speed ( dc1394camera_t \u2217camera, dc1394speed_t speed)\n+\u2022 dc1394error_t dc1394_video_get_iso_channel ( dc1394camera_t \u2217camera, uint32_t \u2217channel)\n+\u2022 dc1394error_t dc1394_video_set_iso_channel ( dc1394camera_t \u2217camera, uint32_t channel)\n+\u2022 dc1394error_t dc1394_video_get_data_depth ( dc1394camera_t \u2217camera, uint32_t \u2217depth)\n+\u2022 dc1394error_t dc1394_video_set_transmission ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n+\u2022 dc1394error_t dc1394_video_get_transmission ( dc1394camera_t \u2217camera, dc1394switch_t \u2217pwr)\n+\u2022 dc1394error_t dc1394_video_set_one_shot ( dc1394camera_t \u2217camera, dc1394switch_t pwr)\n+\u2022 dc1394error_t dc1394_video_get_one_shot ( dc1394camera_t \u2217camera, dc1394bool_t \u2217is_on)\n+\u2022 dc1394error_t dc1394_video_set_multi_shot ( dc1394camera_t \u2217camera, uint32_t numFrames,\n dc1394switch_t pwr)\n \u2022 dc1394error_t dc1394_video_get_multi_shot ( dc1394camera_t \u2217camera, dc1394bool_t \u2217is_on,\n uint32_t \u2217numFrames)\n \u2022 dc1394error_t dc1394_video_get_bandwidth_usage ( dc1394camera_t \u2217camera, uint32_t \u2217bandwidth)\n-\u2022\n-\u2022\n-\u2022\n-\u2022\n-\u2022\n-\u2022\n-\u2022\n-\u2022\n-\u2022\n \n 4.17.1\n \n Detailed Description\n \n Functions related to video modes, formats, framerate and video flow.\n More details soon\n+Generated by Doxygen\n+\n+\f92\n+\n+File Documentation\n \n 4.17.2\n \n Typedef Documentation\n \n 4.17.2.1\n \n@@ -7610,24 +7611,18 @@\n dc1394framerate_t\n \n Enumeration of video framerates\n This enumeration is used for non-Format_7 modes. The framerate can be lower than expected if the exposure\n time is longer than the requested frame period. Framerate can be controlled in a number of other ways: framerate\n feature, external trigger, software trigger, shutter throttling and packet size (Format_7)\n \n-Generated by Doxygen\n-\n-\f4.17 dc1394/video.h File Reference\n-\n 4.17.3.2\n \n enum\n \n-93\n-\n dc1394operation_mode_t\n \n dc1394operation_mode_t\n \n Operation modes\n Two operation modes exist: the legacy and most common 1394a, and the newer 1394B. The latter allows speeds\n over 400Mbps, but can also be used at other speeds.\n@@ -7641,22 +7636,28 @@\n dc1394speed_t\n \n Enumeration of iso data speeds\n Most (if not all) cameras are compatible with 400Mbps speed. Only older cameras (pre-1999) may still only work at\n sub-400 speeds. However, speeds lower than 400Mbps are still useful: they can be used for longer distances (e.g.\n 10m cables). Speeds over 400Mbps are only available in \"B\" mode (DC1394_OPERATION_MODE_1394B).\n \n+Generated by Doxygen\n+\n+\f4.17 dc1394/video.h File Reference\n+\n 4.17.4\n \n Function Documentation\n \n 4.17.4.1\n \n dc1394_video_get_bandwidth_usage()\n \n+93\n+\n dc1394error_t dc1394_video_get_bandwidth_usage (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 bandwidth )\n \n Gets the bandwidth usage of a camera.\n This function returns the bandwidth that is used by the camera IF ISO was ON. The returned value is in bandwidth\n units. The 1394 bus has 4915 bandwidth units available per cycle. Each unit corresponds to the time it takes to\n@@ -7678,22 +7679,17 @@\n dc1394_video_get_framerate()\n \n dc1394error_t dc1394_video_get_framerate (\n dc1394camera_t \u2217 camera,\n dc1394framerate_t \u2217 framerate )\n \n Gets the current framerate. This is meaningful only if the video mode is not scalable.\n-Generated by Doxygen\n-\n-\f94\n \n 4.17.4.4\n \n-File Documentation\n-\n dc1394_video_get_iso_channel()\n \n dc1394error_t dc1394_video_get_iso_channel (\n dc1394camera_t \u2217 camera,\n uint32_t \u2217 channel )\n \n Gets the current ISO channel\n@@ -7704,16 +7700,22 @@\n \n dc1394error_t dc1394_video_get_iso_speed (\n dc1394camera_t \u2217 camera,\n dc1394speed_t \u2217 speed )\n \n Gets the current ISO speed.\n \n+Generated by Doxygen\n+\n+\f94\n+\n 4.17.4.6\n \n+File Documentation\n+\n dc1394_video_get_mode()\n \n dc1394error_t dc1394_video_get_mode (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t \u2217 video_mode )\n \n Gets the current video mode.\n@@ -7744,22 +7746,17 @@\n dc1394_video_get_operation_mode()\n \n dc1394error_t dc1394_video_get_operation_mode (\n dc1394camera_t \u2217 camera,\n dc1394operation_mode_t \u2217 mode )\n \n Gets the current operation mode.\n-Generated by Doxygen\n-\n-\f4.17 dc1394/video.h File Reference\n \n 4.17.4.10\n \n-95\n-\n dc1394_video_get_supported_framerates()\n \n dc1394error_t dc1394_video_get_supported_framerates (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode,\n dc1394framerates_t \u2217 framerates )\n \n@@ -7770,14 +7767,17 @@\n dc1394_video_get_supported_modes()\n \n dc1394error_t dc1394_video_get_supported_modes (\n dc1394camera_t \u2217 camera,\n dc1394video_modes_t \u2217 video_modes )\n \n Gets a list of video modes supported by the camera.\n+Generated by Doxygen\n+\n+\f4.17 dc1394/video.h File Reference\n \n 4.17.4.12\n \n dc1394_video_get_transmission()\n \n dc1394error_t dc1394_video_get_transmission (\n dc1394camera_t \u2217 camera,\n@@ -7810,22 +7810,17 @@\n dc1394_video_set_iso_speed()\n \n dc1394error_t dc1394_video_set_iso_speed (\n dc1394camera_t \u2217 camera,\n dc1394speed_t speed )\n \n Sets the current ISO speed. Speeds over 400Mbps require 1394B.\n-Generated by Doxygen\n-\n-\f96\n \n 4.17.4.16\n \n-File Documentation\n-\n dc1394_video_set_mode()\n \n dc1394error_t dc1394_video_set_mode (\n dc1394camera_t \u2217 camera,\n dc1394video_mode_t video_mode )\n \n Sets the current video mode.\n@@ -7836,17 +7831,24 @@\n \n dc1394error_t dc1394_video_set_multi_shot (\n dc1394camera_t \u2217 camera,\n uint32_t numFrames,\n dc1394switch_t pwr )\n \n Turns multishot mode on or off\n+Generated by Doxygen\n+\n+95\n+\n+\f96\n \n 4.17.4.18\n \n+File Documentation\n+\n dc1394_video_set_one_shot()\n \n dc1394error_t dc1394_video_set_one_shot (\n dc1394camera_t \u2217 camera,\n dc1394switch_t pwr )\n \n Turns one-shot mode on or off\n@@ -7883,123 +7885,123 @@\n __dc1394feature_info_t_struct, 7\n __dc1394featureset_t, 7\n __dc1394format7mode_t, 7\n __dc1394format7modeset_t, 8\n avt.h\n dc1394_avt_get_advanced_feature_inquiry, 70\n dc1394_avt_get_aoi, 70\n-dc1394_avt_get_auto_gain, 71\n-dc1394_avt_get_auto_shutter, 71\n-dc1394_avt_get_blemish, 71\n+dc1394_avt_get_auto_gain, 70\n+dc1394_avt_get_auto_shutter, 70\n+dc1394_avt_get_blemish, 70\n dc1394_avt_get_channel_adjust, 71\n dc1394_avt_get_color_corr, 71\n-dc1394_avt_get_deferred_trans, 72\n-dc1394_avt_get_dsnu, 72\n-dc1394_avt_get_extented_shutter, 72\n+dc1394_avt_get_deferred_trans, 71\n+dc1394_avt_get_dsnu, 71\n+dc1394_avt_get_extented_shutter, 71\n dc1394_avt_get_frame_info, 72\n dc1394_avt_get_gpdata_info, 72\n-dc1394_avt_get_hsnr, 73\n-dc1394_avt_get_io, 73\n-dc1394_avt_get_lut, 73\n-dc1394_avt_get_lut_info, 73\n+dc1394_avt_get_hsnr, 72\n+dc1394_avt_get_io, 72\n+dc1394_avt_get_lut, 72\n+dc1394_avt_get_lut_info, 72\n dc1394_avt_get_lut_mem_ctrl, 73\n-dc1394_avt_get_MaxResolution, 74\n-dc1394_avt_get_mirror, 74\n-dc1394_avt_get_multiple_slope, 74\n-dc1394_avt_get_shading, 74\n+dc1394_avt_get_MaxResolution, 73\n+dc1394_avt_get_mirror, 73\n+dc1394_avt_get_multiple_slope, 73\n+dc1394_avt_get_shading, 73\n dc1394_avt_get_shading_info, 74\n-dc1394_avt_get_shading_mem_ctrl, 75\n-dc1394_avt_get_test_images, 75\n-dc1394_avt_get_timebase, 75\n-dc1394_avt_get_trigger_delay, 75\n-dc1394_avt_get_version, 75\n+dc1394_avt_get_shading_mem_ctrl, 74\n+dc1394_avt_get_test_images, 74\n+dc1394_avt_get_timebase, 74\n+dc1394_avt_get_trigger_delay, 74\n+dc1394_avt_get_version, 74\n dc1394_avt_print_advanced_feature, 75\n-dc1394_avt_read_gpdata, 76\n-dc1394_avt_read_shading_img, 76\n-dc1394_avt_reset, 76\n-dc1394_avt_reset_frame_info, 76\n-dc1394_avt_set_aoi, 76\n+dc1394_avt_read_gpdata, 75\n+dc1394_avt_read_shading_img, 75\n+dc1394_avt_reset, 75\n+dc1394_avt_reset_frame_info, 75\n+dc1394_avt_set_aoi, 75\n dc1394_avt_set_auto_gain, 76\n-dc1394_avt_set_auto_shutter, 77\n-dc1394_avt_set_blemish, 77\n-dc1394_avt_set_channel_adjust, 77\n-dc1394_avt_set_color_corr, 77\n+dc1394_avt_set_auto_shutter, 76\n+dc1394_avt_set_blemish, 76\n+dc1394_avt_set_channel_adjust, 76\n+dc1394_avt_set_color_corr, 76\n Generated by Doxygen\n \n dc1394_avt_set_deferred_trans, 77\n-dc1394_avt_set_dsnu, 78\n-dc1394_avt_set_extented_shutter, 78\n-dc1394_avt_set_hsnr, 78\n+dc1394_avt_set_dsnu, 77\n+dc1394_avt_set_extented_shutter, 77\n+dc1394_avt_set_hsnr, 77\n dc1394_avt_set_io, 78\n dc1394_avt_set_lut, 78\n-dc1394_avt_set_lut_mem_ctrl, 79\n-dc1394_avt_set_mirror, 79\n-dc1394_avt_set_multiple_slope, 79\n+dc1394_avt_set_lut_mem_ctrl, 78\n+dc1394_avt_set_mirror, 78\n+dc1394_avt_set_multiple_slope, 78\n dc1394_avt_set_shading, 79\n dc1394_avt_set_shading_mem_ctrl, 79\n-dc1394_avt_set_test_images, 80\n-dc1394_avt_set_timebase, 80\n-dc1394_avt_set_trigger_delay, 80\n+dc1394_avt_set_test_images, 79\n+dc1394_avt_set_timebase, 79\n+dc1394_avt_set_trigger_delay, 79\n dc1394_avt_write_gpdata, 80\n dc1394_avt_write_shading_img, 80\n basler.h\n dc1394_basler_sff_check_crc, 81\n dc1394_basler_sff_chunk_find, 81\n dc1394_basler_sff_chunk_iterate, 81\n-dc1394_basler_sff_chunk_iterate_init, 82\n-dc1394_basler_sff_feature_enable, 82\n-dc1394_basler_sff_feature_is_available, 82\n+dc1394_basler_sff_chunk_iterate_init, 81\n+dc1394_basler_sff_feature_enable, 81\n+dc1394_basler_sff_feature_is_available, 81\n dc1394_basler_sff_feature_is_enabled, 82\n dc1394_basler_sff_feature_print, 82\n dc1394_basler_sff_feature_print_all, 82\n-dc1394_basler_sff_is_available, 83\n+dc1394_basler_sff_is_available, 82\n basler_sff.h\n DC1394_BASLER_SFF_CRC_CHECKSUM, 85\n DC1394_BASLER_SFF_CYCLE_TIME_STAMP,\n 85\n DC1394_BASLER_SFF_DCAM_VALUES, 85\n DC1394_BASLER_SFF_EXTENDED_DATA_STREAM,\n 85\n DC1394_BASLER_SFF_EXTENDED_VERSION_INFO,\n-86\n+85\n DC1394_BASLER_SFF_FRAME_COUNTER, 85\n-DC1394_BASLER_SFF_LOOKUP_TABLE, 86\n+DC1394_BASLER_SFF_LOOKUP_TABLE, 85\n DC1394_BASLER_SFF_OUTPUT_PORT_0_CONFIGURATION,\n-86\n+85\n DC1394_BASLER_SFF_OUTPUT_PORT_1_CONFIGURATION,\n-86\n+85\n DC1394_BASLER_SFF_OUTPUT_PORT_2_CONFIGURATION,\n-86\n+85\n DC1394_BASLER_SFF_OUTPUT_PORT_3_CONFIGURATION,\n 86\n-DC1394_BASLER_SFF_TEST_IMAGES, 86\n+DC1394_BASLER_SFF_TEST_IMAGES, 85\n DC1394_BASLER_SFF_TRIGGER_FLAG_AND_COUNTER,\n-86\n+85\n \n \f98\n \n-dc1394basler_dcam_csr_value_t, 84\n+dc1394basler_dcam_csr_value_t, 83\n dc1394basler_dcam_whitebalance_csr_value_t,\n-84\n-dc1394basler_sff_crc_checksum_t, 84\n+83\n+dc1394basler_sff_crc_checksum_t, 83\n dc1394basler_sff_cycle_time_stamp_t, 84\n dc1394basler_sff_dcam_values_t, 84\n dc1394basler_sff_extended_data_stream_t, 84\n-dc1394basler_sff_feature_t, 84, 85\n-dc1394basler_sff_frame_counter_t, 85\n+dc1394basler_sff_feature_t, 84\n+dc1394basler_sff_frame_counter_t, 84\n basler_sff_registry.h\n-basler_sff_registry_find_by_chunk_guid, 87\n-basler_sff_registry_find_by_csr_guid, 87\n-basler_sff_registry_find_by_id, 87\n+basler_sff_registry_find_by_chunk_guid, 86\n+basler_sff_registry_find_by_csr_guid, 86\n+basler_sff_registry_find_by_id, 86\n basler_sff_registry_find_by_chunk_guid\n-basler_sff_registry.h, 87\n+basler_sff_registry.h, 86\n basler_sff_registry_find_by_csr_guid\n-basler_sff_registry.h, 87\n+basler_sff_registry.h, 86\n basler_sff_registry_find_by_id\n-basler_sff_registry.h, 87\n+basler_sff_registry.h, 86\n camera.h\n dc1394_camera_enumerate, 27\n dc1394_camera_free, 27\n dc1394_camera_free_list, 27\n dc1394_camera_get_node, 27\n dc1394_camera_get_platform_string, 27\n dc1394_camera_new, 27\n@@ -8011,235 +8013,235 @@\n dc1394_reset_bus, 28\n dc1394camera_list_t, 26\n dc1394camera_t, 26\n dc1394iidc_version_t, 26\n dc1394phy_delay_t, 26\n dc1394power_class_t, 26\n capture.h\n-dc1394_capture_dequeue, 56\n-dc1394_capture_enqueue, 56\n+dc1394_capture_dequeue, 44\n+dc1394_capture_enqueue, 44\n DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC,\n-55\n-dc1394_capture_get_fileno, 56\n-dc1394_capture_is_frame_corrupt, 56\n-dc1394_capture_set_callback, 57\n-dc1394_capture_setup, 57\n-dc1394_capture_stop, 57\n-dc1394capture_callback_t, 56\n-dc1394capture_policy_t, 56\n+44\n+dc1394_capture_get_fileno, 45\n+dc1394_capture_is_frame_corrupt, 45\n+dc1394_capture_set_callback, 45\n+dc1394_capture_setup, 45\n+dc1394_capture_stop, 45\n+dc1394capture_callback_t, 44\n+dc1394capture_policy_t, 44\n control.h\n-dc1394_camera_reset, 32\n-dc1394_camera_set_power, 32\n-dc1394_external_trigger_get_mode, 33\n-dc1394_external_trigger_get_polarity, 33\n-dc1394_external_trigger_get_power, 33\n-dc1394_external_trigger_get_source, 33\n+dc1394_camera_reset, 49\n+dc1394_camera_set_power, 49\n+dc1394_external_trigger_get_mode, 49\n+dc1394_external_trigger_get_polarity, 49\n+dc1394_external_trigger_get_power, 50\n+dc1394_external_trigger_get_source, 50\n dc1394_external_trigger_get_supported_sources,\n-33\n+50\n \n INDEX\n \n-dc1394_external_trigger_has_polarity, 33\n-dc1394_external_trigger_set_mode, 34\n-dc1394_external_trigger_set_polarity, 34\n-dc1394_external_trigger_set_power, 34\n-dc1394_external_trigger_set_source, 34\n-dc1394_feature_get, 34\n-dc1394_feature_get_absolute_boundaries, 34\n-dc1394_feature_get_absolute_control, 35\n-dc1394_feature_get_absolute_value, 35\n-dc1394_feature_get_all, 35\n-dc1394_feature_get_boundaries, 35\n-dc1394_feature_get_mode, 35\n-dc1394_feature_get_modes, 36\n-dc1394_feature_get_power, 36\n-dc1394_feature_get_value, 36\n-dc1394_feature_has_absolute_control, 36\n-dc1394_feature_is_present, 36\n-dc1394_feature_is_readable, 36\n-dc1394_feature_is_switchable, 37\n-dc1394_feature_print, 37\n-dc1394_feature_print_all, 37\n-dc1394_feature_set_absolute_control, 37\n-dc1394_feature_set_absolute_value, 37\n-dc1394_feature_set_mode, 37\n-dc1394_feature_set_power, 38\n-dc1394_feature_set_value, 38\n-dc1394_feature_temperature_get_value, 38\n-dc1394_feature_temperature_set_value, 38\n-dc1394_feature_whitebalance_get_value, 38\n-dc1394_feature_whitebalance_set_value, 38\n-dc1394_feature_whiteshading_get_value, 39\n-dc1394_feature_whiteshading_set_value, 39\n-dc1394_memory_busy, 39\n-dc1394_memory_load, 39\n-dc1394_memory_save, 39\n-dc1394_pio_get, 40\n-dc1394_pio_set, 40\n-dc1394_software_trigger_get_power, 40\n-dc1394_software_trigger_set_power, 40\n-dc1394feature_info_t, 31\n-dc1394feature_mode_t, 32\n-dc1394feature_t, 32\n-dc1394featureset_t, 31\n-dc1394trigger_mode_t, 32\n-dc1394trigger_polarity_t, 32\n-dc1394trigger_source_t, 32\n+dc1394_external_trigger_has_polarity, 50\n+dc1394_external_trigger_set_mode, 50\n+dc1394_external_trigger_set_polarity, 50\n+dc1394_external_trigger_set_power, 51\n+dc1394_external_trigger_set_source, 51\n+dc1394_feature_get, 51\n+dc1394_feature_get_absolute_boundaries, 51\n+dc1394_feature_get_absolute_control, 51\n+dc1394_feature_get_absolute_value, 51\n+dc1394_feature_get_all, 52\n+dc1394_feature_get_boundaries, 52\n+dc1394_feature_get_mode, 52\n+dc1394_feature_get_modes, 52\n+dc1394_feature_get_power, 52\n+dc1394_feature_get_value, 52\n+dc1394_feature_has_absolute_control, 53\n+dc1394_feature_is_present, 53\n+dc1394_feature_is_readable, 53\n+dc1394_feature_is_switchable, 53\n+dc1394_feature_print, 53\n+dc1394_feature_print_all, 53\n+dc1394_feature_set_absolute_control, 54\n+dc1394_feature_set_absolute_value, 54\n+dc1394_feature_set_mode, 54\n+dc1394_feature_set_power, 54\n+dc1394_feature_set_value, 54\n+dc1394_feature_temperature_get_value, 54\n+dc1394_feature_temperature_set_value, 55\n+dc1394_feature_whitebalance_get_value, 55\n+dc1394_feature_whitebalance_set_value, 55\n+dc1394_feature_whiteshading_get_value, 55\n+dc1394_feature_whiteshading_set_value, 55\n+dc1394_memory_busy, 56\n+dc1394_memory_load, 56\n+dc1394_memory_save, 56\n+dc1394_pio_get, 56\n+dc1394_pio_set, 56\n+dc1394_software_trigger_get_power, 56\n+dc1394_software_trigger_set_power, 57\n+dc1394feature_info_t, 48\n+dc1394feature_mode_t, 48\n+dc1394feature_t, 48\n+dc1394featureset_t, 48\n+dc1394trigger_mode_t, 48\n+dc1394trigger_polarity_t, 49\n+dc1394trigger_source_t, 49\n conversions.h\n-dc1394_bayer_decoding_16bit, 42\n-dc1394_bayer_decoding_8bit, 42\n-dc1394_convert_frames, 42\n-dc1394_convert_to_MONO8, 42\n-dc1394_convert_to_RGB8, 42\n-dc1394_convert_to_YUV422, 43\n-dc1394_debayer_frames, 43\n-dc1394_deinterlace_stereo, 43\n-dc1394_deinterlace_stereo_frames, 44\n-dc1394bayer_method_t, 41\n-dc1394stereo_method_t, 41\n+dc1394_bayer_decoding_16bit, 30\n+dc1394_bayer_decoding_8bit, 30\n+dc1394_convert_frames, 30\n+dc1394_convert_to_MONO8, 30\n+dc1394_convert_to_RGB8, 31\n+dc1394_convert_to_YUV422, 31\n+dc1394_debayer_frames, 31\n+dc1394_deinterlace_stereo, 32\n+dc1394_deinterlace_stereo_frames, 32\n+dc1394bayer_method_t, 30\n+dc1394stereo_method_t, 30\n \n Generated by Doxygen\n \n \fINDEX\n \n dc1394/camera.h, 25\n-dc1394/capture.h, 54\n-dc1394/control.h, 29\n-dc1394/conversions.h, 40\n-dc1394/dc1394.h, 44\n-dc1394/format7.h, 44\n-dc1394/iso.h, 51\n+dc1394/capture.h, 43\n+dc1394/control.h, 46\n+dc1394/conversions.h, 29\n+dc1394/dc1394.h, 32\n+dc1394/format7.h, 33\n+dc1394/iso.h, 39\n dc1394/log.h, 57\n-dc1394/register.h, 60\n+dc1394/register.h, 59\n dc1394/types.h, 64\n dc1394/utils.h, 65\n dc1394/vendor/avt.h, 68\n-dc1394/vendor/basler.h, 81\n-dc1394/vendor/basler_sff.h, 83\n+dc1394/vendor/basler.h, 80\n+dc1394/vendor/basler_sff.h, 82\n dc1394/vendor/basler_sff_registry.h, 86\n dc1394/vendor/pixelink.h, 87\n-dc1394/video.h, 91\n+dc1394/video.h, 90\n dc1394_avt_get_advanced_feature_inquiry\n avt.h, 70\n dc1394_avt_get_aoi\n avt.h, 70\n dc1394_avt_get_auto_gain\n-avt.h, 71\n+avt.h, 70\n dc1394_avt_get_auto_shutter\n-avt.h, 71\n+avt.h, 70\n dc1394_avt_get_blemish\n-avt.h, 71\n+avt.h, 70\n dc1394_avt_get_channel_adjust\n avt.h, 71\n dc1394_avt_get_color_corr\n avt.h, 71\n dc1394_avt_get_deferred_trans\n-avt.h, 72\n+avt.h, 71\n dc1394_avt_get_dsnu\n-avt.h, 72\n+avt.h, 71\n dc1394_avt_get_extented_shutter\n-avt.h, 72\n+avt.h, 71\n dc1394_avt_get_frame_info\n avt.h, 72\n dc1394_avt_get_gpdata_info\n avt.h, 72\n dc1394_avt_get_hsnr\n-avt.h, 73\n+avt.h, 72\n dc1394_avt_get_io\n-avt.h, 73\n+avt.h, 72\n dc1394_avt_get_lut\n-avt.h, 73\n+avt.h, 72\n dc1394_avt_get_lut_info\n-avt.h, 73\n+avt.h, 72\n dc1394_avt_get_lut_mem_ctrl\n avt.h, 73\n dc1394_avt_get_MaxResolution\n-avt.h, 74\n+avt.h, 73\n dc1394_avt_get_mirror\n-avt.h, 74\n+avt.h, 73\n dc1394_avt_get_multiple_slope\n-avt.h, 74\n+avt.h, 73\n dc1394_avt_get_shading\n \n Generated by Doxygen\n \n 99\n \n-avt.h, 74\n+avt.h, 73\n dc1394_avt_get_shading_info\n avt.h, 74\n dc1394_avt_get_shading_mem_ctrl\n-avt.h, 75\n+avt.h, 74\n dc1394_avt_get_test_images\n-avt.h, 75\n+avt.h, 74\n dc1394_avt_get_timebase\n-avt.h, 75\n+avt.h, 74\n dc1394_avt_get_trigger_delay\n-avt.h, 75\n+avt.h, 74\n dc1394_avt_get_version\n-avt.h, 75\n+avt.h, 74\n dc1394_avt_print_advanced_feature\n avt.h, 75\n dc1394_avt_read_gpdata\n-avt.h, 76\n+avt.h, 75\n dc1394_avt_read_shading_img\n-avt.h, 76\n+avt.h, 75\n dc1394_avt_reset\n-avt.h, 76\n+avt.h, 75\n dc1394_avt_reset_frame_info\n-avt.h, 76\n+avt.h, 75\n dc1394_avt_set_aoi\n-avt.h, 76\n+avt.h, 75\n dc1394_avt_set_auto_gain\n avt.h, 76\n dc1394_avt_set_auto_shutter\n-avt.h, 77\n+avt.h, 76\n dc1394_avt_set_blemish\n-avt.h, 77\n+avt.h, 76\n dc1394_avt_set_channel_adjust\n-avt.h, 77\n+avt.h, 76\n dc1394_avt_set_color_corr\n-avt.h, 77\n+avt.h, 76\n dc1394_avt_set_deferred_trans\n avt.h, 77\n dc1394_avt_set_dsnu\n-avt.h, 78\n+avt.h, 77\n dc1394_avt_set_extented_shutter\n-avt.h, 78\n+avt.h, 77\n dc1394_avt_set_hsnr\n-avt.h, 78\n+avt.h, 77\n dc1394_avt_set_io\n avt.h, 78\n dc1394_avt_set_lut\n avt.h, 78\n dc1394_avt_set_lut_mem_ctrl\n-avt.h, 79\n+avt.h, 78\n dc1394_avt_set_mirror\n-avt.h, 79\n+avt.h, 78\n dc1394_avt_set_multiple_slope\n-avt.h, 79\n+avt.h, 78\n dc1394_avt_set_shading\n avt.h, 79\n dc1394_avt_set_shading_mem_ctrl\n avt.h, 79\n dc1394_avt_set_test_images\n \n \f100\n \n INDEX\n \n-avt.h, 80\n-conversions.h, 42\n+avt.h, 79\n+conversions.h, 30\n dc1394_avt_set_timebase\n dc1394_camera_enumerate\n-avt.h, 80\n+avt.h, 79\n camera.h, 27\n dc1394_avt_set_trigger_delay\n dc1394_camera_free\n-avt.h, 80\n+avt.h, 79\n camera.h, 27\n dc1394_avt_write_gpdata\n dc1394_camera_free_list\n avt.h, 80\n camera.h, 27\n dc1394_avt_write_shading_img\n dc1394_camera_get_node\n@@ -8255,326 +8257,326 @@\n camera.h, 27\n dc1394_basler_sff_chunk_iterate\n dc1394_camera_new_unit\n basler.h, 81\n camera.h, 28\n dc1394_basler_sff_chunk_iterate_init\n dc1394_camera_print_info\n-basler.h, 82\n+basler.h, 81\n camera.h, 28\n DC1394_BASLER_SFF_CRC_CHECKSUM\n dc1394_camera_reset\n basler_sff.h, 85\n-control.h, 32\n+control.h, 49\n DC1394_BASLER_SFF_CYCLE_TIME_STAMP\n dc1394_camera_set_broadcast\n basler_sff.h, 85\n camera.h, 28\n DC1394_BASLER_SFF_DCAM_VALUES\n dc1394_camera_set_power\n basler_sff.h, 85\n-control.h, 32\n+control.h, 49\n DC1394_BASLER_SFF_EXTENDED_DATA_STREAM\n dc1394_capture_dequeue\n basler_sff.h, 85\n-capture.h, 56\n+capture.h, 44\n DC1394_BASLER_SFF_EXTENDED_VERSION_INFO dc1394_capture_enqueue\n-basler_sff.h, 86\n-capture.h, 56\n+basler_sff.h, 85\n+capture.h, 44\n dc1394_basler_sff_feature_enable\n DC1394_CAPTURE_FLAGS_CHANNEL_ALLOC\n-basler.h, 82\n-capture.h, 55\n+basler.h, 81\n+capture.h, 44\n dc1394_basler_sff_feature_is_available\n dc1394_capture_get_fileno\n-basler.h, 82\n-capture.h, 56\n+basler.h, 81\n+capture.h, 45\n dc1394_basler_sff_feature_is_enabled\n dc1394_capture_is_frame_corrupt\n basler.h, 82\n-capture.h, 56\n+capture.h, 45\n dc1394_basler_sff_feature_print\n dc1394_capture_set_callback\n basler.h, 82\n-capture.h, 57\n+capture.h, 45\n dc1394_basler_sff_feature_print_all\n dc1394_capture_setup\n basler.h, 82\n-capture.h, 57\n+capture.h, 45\n DC1394_BASLER_SFF_FRAME_COUNTER\n dc1394_capture_stop\n basler_sff.h, 85\n-capture.h, 57\n+capture.h, 45\n dc1394_basler_sff_is_available\n dc1394_checksum_crc16\n-basler.h, 83\n+basler.h, 82\n utils.h, 66\n DC1394_BASLER_SFF_LOOKUP_TABLE\n dc1394_convert_frames\n-basler_sff.h, 86\n-conversions.h, 42\n+basler_sff.h, 85\n+conversions.h, 30\n DC1394_BASLER_SFF_OUTPUT_PORT_0_CONFIGURATION\n dc1394_convert_to_MONO8\n-basler_sff.h, 86\n-conversions.h, 42\n+basler_sff.h, 85\n+conversions.h, 30\n DC1394_BASLER_SFF_OUTPUT_PORT_1_CONFIGURATION\n dc1394_convert_to_RGB8\n-basler_sff.h, 86\n-conversions.h, 42\n+basler_sff.h, 85\n+conversions.h, 31\n DC1394_BASLER_SFF_OUTPUT_PORT_2_CONFIGURATION\n dc1394_convert_to_YUV422\n-basler_sff.h, 86\n-conversions.h, 43\n+basler_sff.h, 85\n+conversions.h, 31\n DC1394_BASLER_SFF_OUTPUT_PORT_3_CONFIGURATION\n dc1394_debayer_frames\n basler_sff.h, 86\n-conversions.h, 43\n+conversions.h, 31\n DC1394_BASLER_SFF_TEST_IMAGES\n dc1394_deinterlace_stereo\n-basler_sff.h, 86\n-conversions.h, 43\n+basler_sff.h, 85\n+conversions.h, 32\n DC1394_BASLER_SFF_TRIGGER_FLAG_AND_COUNTER\n dc1394_deinterlace_stereo_frames\n-basler_sff.h, 86\n-conversions.h, 44\n+basler_sff.h, 85\n+conversions.h, 32\n dc1394_bayer_decoding_16bit\n dc1394_error_get_string\n-conversions.h, 42\n+conversions.h, 30\n utils.h, 66\n dc1394_bayer_decoding_8bit\n dc1394_external_trigger_get_mode\n \n Generated by Doxygen\n \n \fINDEX\n \n-control.h, 33\n+control.h, 49\n dc1394_external_trigger_get_polarity\n-control.h, 33\n+control.h, 49\n dc1394_external_trigger_get_power\n-control.h, 33\n+control.h, 50\n dc1394_external_trigger_get_source\n-control.h, 33\n+control.h, 50\n dc1394_external_trigger_get_supported_sources\n-control.h, 33\n+control.h, 50\n dc1394_external_trigger_has_polarity\n-control.h, 33\n+control.h, 50\n dc1394_external_trigger_set_mode\n-control.h, 34\n+control.h, 50\n dc1394_external_trigger_set_polarity\n-control.h, 34\n+control.h, 50\n dc1394_external_trigger_set_power\n-control.h, 34\n+control.h, 51\n dc1394_external_trigger_set_source\n-control.h, 34\n+control.h, 51\n dc1394_feature_get\n-control.h, 34\n+control.h, 51\n dc1394_feature_get_absolute_boundaries\n-control.h, 34\n+control.h, 51\n dc1394_feature_get_absolute_control\n-control.h, 35\n+control.h, 51\n dc1394_feature_get_absolute_value\n-control.h, 35\n+control.h, 51\n dc1394_feature_get_all\n-control.h, 35\n+control.h, 52\n dc1394_feature_get_boundaries\n-control.h, 35\n+control.h, 52\n dc1394_feature_get_mode\n-control.h, 35\n+control.h, 52\n dc1394_feature_get_modes\n-control.h, 36\n+control.h, 52\n dc1394_feature_get_power\n-control.h, 36\n+control.h, 52\n dc1394_feature_get_string\n utils.h, 66\n dc1394_feature_get_value\n-control.h, 36\n+control.h, 52\n dc1394_feature_has_absolute_control\n-control.h, 36\n+control.h, 53\n dc1394_feature_is_present\n-control.h, 36\n+control.h, 53\n dc1394_feature_is_readable\n-control.h, 36\n+control.h, 53\n dc1394_feature_is_switchable\n-control.h, 37\n+control.h, 53\n dc1394_feature_print\n-control.h, 37\n+control.h, 53\n dc1394_feature_print_all\n-control.h, 37\n+control.h, 53\n dc1394_feature_set_absolute_control\n-control.h, 37\n+control.h, 54\n dc1394_feature_set_absolute_value\n-control.h, 37\n+control.h, 54\n dc1394_feature_set_mode\n \n Generated by Doxygen\n \n 101\n \n-control.h, 37\n+control.h, 54\n dc1394_feature_set_power\n-control.h, 38\n+control.h, 54\n dc1394_feature_set_value\n-control.h, 38\n+control.h, 54\n dc1394_feature_temperature_get_value\n-control.h, 38\n+control.h, 54\n dc1394_feature_temperature_set_value\n-control.h, 38\n+control.h, 55\n dc1394_feature_whitebalance_get_value\n-control.h, 38\n+control.h, 55\n dc1394_feature_whitebalance_set_value\n-control.h, 38\n+control.h, 55\n dc1394_feature_whiteshading_get_value\n-control.h, 39\n+control.h, 55\n dc1394_feature_whiteshading_set_value\n-control.h, 39\n+control.h, 55\n dc1394_format7_get_color_coding\n-format7.h, 46\n+format7.h, 34\n dc1394_format7_get_color_codings\n-format7.h, 46\n+format7.h, 34\n dc1394_format7_get_color_filter\n-format7.h, 46\n+format7.h, 35\n dc1394_format7_get_data_depth\n-format7.h, 47\n+format7.h, 35\n dc1394_format7_get_frame_interval\n-format7.h, 47\n+format7.h, 35\n dc1394_format7_get_image_position\n-format7.h, 47\n+format7.h, 35\n dc1394_format7_get_image_size\n-format7.h, 47\n+format7.h, 35\n dc1394_format7_get_max_image_size\n-format7.h, 47\n+format7.h, 36\n dc1394_format7_get_mode_info\n-format7.h, 48\n+format7.h, 36\n dc1394_format7_get_modeset\n-format7.h, 48\n+format7.h, 36\n dc1394_format7_get_packet_parameters\n-format7.h, 48\n+format7.h, 36\n dc1394_format7_get_packet_size\n-format7.h, 48\n+format7.h, 36\n dc1394_format7_get_packets_per_frame\n-format7.h, 48\n+format7.h, 37\n dc1394_format7_get_pixel_number\n-format7.h, 49\n+format7.h, 37\n dc1394_format7_get_recommended_packet_size\n-format7.h, 49\n+format7.h, 37\n dc1394_format7_get_roi\n-format7.h, 49\n+format7.h, 37\n dc1394_format7_get_total_bytes\n-format7.h, 49\n+format7.h, 37\n dc1394_format7_get_unit_position\n-format7.h, 49\n+format7.h, 38\n dc1394_format7_get_unit_size\n-format7.h, 50\n+format7.h, 38\n dc1394_format7_set_color_coding\n-format7.h, 50\n+format7.h, 38\n dc1394_format7_set_image_position\n \n \f102\n \n-format7.h, 50\n+format7.h, 38\n dc1394_format7_set_image_size\n-format7.h, 50\n+format7.h, 38\n dc1394_format7_set_packet_size\n-format7.h, 50\n+format7.h, 39\n dc1394_format7_set_roi\n-format7.h, 51\n+format7.h, 39\n dc1394_framerate_as_float\n-utils.h, 67\n+utils.h, 66\n dc1394_free\n camera.h, 28\n dc1394_get_absolute_register\n-register.h, 61\n+register.h, 60\n dc1394_get_adv_control_registers\n-register.h, 61\n+register.h, 60\n dc1394_get_color_coding_bit_size\n-utils.h, 67\n+utils.h, 66\n dc1394_get_color_coding_data_depth\n-utils.h, 67\n+utils.h, 66\n dc1394_get_color_coding_from_video_mode\n utils.h, 67\n dc1394_get_control_registers\n register.h, 61\n dc1394_get_format7_register\n register.h, 61\n dc1394_get_image_size_from_video_mode\n utils.h, 67\n dc1394_get_PIO_register\n register.h, 61\n dc1394_get_registers\n register.h, 61\n dc1394_get_SIO_register\n-register.h, 62\n+register.h, 61\n dc1394_get_strobe_register\n register.h, 62\n dc1394_is_color\n utils.h, 67\n dc1394_is_same_camera\n-utils.h, 68\n+utils.h, 67\n dc1394_is_video_mode_scalable\n-utils.h, 68\n+utils.h, 67\n dc1394_is_video_mode_still_image\n-utils.h, 68\n+utils.h, 67\n dc1394_iso_allocate_bandwidth\n-iso.h, 52\n+iso.h, 40\n dc1394_iso_allocate_channel\n-iso.h, 52\n+iso.h, 40\n dc1394_iso_release_all\n-iso.h, 53\n+iso.h, 41\n dc1394_iso_release_bandwidth\n-iso.h, 53\n+iso.h, 41\n dc1394_iso_release_channel\n-iso.h, 54\n+iso.h, 42\n dc1394_iso_set_persist\n-iso.h, 54\n+iso.h, 42\n dc1394_log_debug\n log.h, 58\n dc1394_log_error\n \n INDEX\n \n-log.h, 59\n+log.h, 58\n dc1394_log_register_handler\n log.h, 59\n dc1394_log_set_default_handler\n log.h, 59\n dc1394_log_warning\n log.h, 59\n dc1394_memory_busy\n-control.h, 39\n+control.h, 56\n dc1394_memory_load\n-control.h, 39\n+control.h, 56\n dc1394_memory_save\n-control.h, 39\n+control.h, 56\n dc1394_new\n camera.h, 28\n dc1394_pio_get\n-control.h, 40\n+control.h, 56\n dc1394_pio_set\n-control.h, 40\n+control.h, 56\n dc1394_pxl_adv_feature_info_t\n pixelink.h, 88\n dc1394_pxl_camera_info_t\n pixelink.h, 88\n dc1394_pxl_convert_float32_to_quadlet\n-pixelink.h, 89\n+pixelink.h, 88\n dc1394_pxl_convert_uint32_to_float32\n-pixelink.h, 89\n+pixelink.h, 88\n dc1394_pxl_get_camera_info\n pixelink.h, 89\n dc1394_pxl_get_camera_name\n pixelink.h, 89\n dc1394_pxl_get_camera_serial_number\n pixelink.h, 89\n dc1394_pxl_get_gpo_config\n pixelink.h, 89\n dc1394_pxl_get_gpo_param\n-pixelink.h, 90\n+pixelink.h, 89\n dc1394_pxl_get_gpo_param_min_max\n-pixelink.h, 90\n+pixelink.h, 89\n dc1394_pxl_gpio_info_t\n pixelink.h, 88\n dc1394_pxl_print_camera_info\n pixelink.h, 90\n dc1394_pxl_set_gpio_mode_param\n pixelink.h, 90\n dc1394_pxl_set_gpo_config\n@@ -8584,131 +8586,131 @@\n dc1394_set_absolute_register\n register.h, 62\n dc1394_set_adv_control_registers\n register.h, 62\n dc1394_set_control_registers\n register.h, 62\n dc1394_set_format7_register\n-register.h, 63\n+register.h, 62\n dc1394_set_PIO_register\n \n Generated by Doxygen\n \n \fINDEX\n \n register.h, 63\n dc1394_set_registers\n register.h, 63\n dc1394_set_SIO_register\n register.h, 63\n dc1394_set_strobe_register\n register.h, 63\n dc1394_software_trigger_get_power\n-control.h, 40\n+control.h, 56\n dc1394_software_trigger_set_power\n-control.h, 40\n+control.h, 57\n dc1394_video_get_bandwidth_usage\n video.h, 93\n dc1394_video_get_data_depth\n video.h, 93\n dc1394_video_get_framerate\n video.h, 93\n dc1394_video_get_iso_channel\n video.h, 93\n dc1394_video_get_iso_speed\n-video.h, 94\n+video.h, 93\n dc1394_video_get_mode\n-video.h, 94\n+video.h, 93\n dc1394_video_get_multi_shot\n video.h, 94\n dc1394_video_get_one_shot\n video.h, 94\n dc1394_video_get_operation_mode\n video.h, 94\n dc1394_video_get_supported_framerates\n video.h, 94\n dc1394_video_get_supported_modes\n-video.h, 95\n+video.h, 94\n dc1394_video_get_transmission\n-video.h, 95\n+video.h, 94\n dc1394_video_set_framerate\n video.h, 95\n dc1394_video_set_iso_channel\n video.h, 95\n dc1394_video_set_iso_speed\n video.h, 95\n dc1394_video_set_mode\n video.h, 95\n dc1394_video_set_multi_shot\n-video.h, 96\n+video.h, 95\n dc1394_video_set_one_shot\n-video.h, 96\n+video.h, 95\n dc1394_video_set_operation_mode\n video.h, 96\n dc1394_video_set_transmission\n video.h, 96\n dc1394basler_dcam_csr_value_t, 8\n-basler_sff.h, 84\n+basler_sff.h, 83\n dc1394basler_dcam_whitebalance_csr_value_t, 8\n-basler_sff.h, 84\n+basler_sff.h, 83\n dc1394basler_sff_chunk_tail_t, 9\n dc1394basler_sff_crc_checksum_t, 9\n-basler_sff.h, 84\n+basler_sff.h, 83\n \n Generated by Doxygen\n \n 103\n \n dc1394basler_sff_cycle_time_stamp_t, 9\n basler_sff.h, 84\n dc1394basler_sff_dcam_values_t, 9\n basler_sff.h, 84\n dc1394basler_sff_extended_data_stream_t, 10\n basler_sff.h, 84\n dc1394basler_sff_feature_t\n-basler_sff.h, 84, 85\n+basler_sff.h, 84\n dc1394basler_sff_frame_counter_t, 10\n-basler_sff.h, 85\n+basler_sff.h, 84\n dc1394basler_sff_guid_t, 10\n dc1394basler_sff_t, 11\n dc1394bayer_method_t\n-conversions.h, 41\n+conversions.h, 30\n dc1394bool_t\n types.h, 64\n dc1394byte_order_t\n types.h, 64\n dc1394camera_id_t, 11\n dc1394camera_list_t\n camera.h, 26\n dc1394camera_t\n camera.h, 26\n dc1394capture_callback_t\n-capture.h, 56\n+capture.h, 44\n dc1394capture_policy_t\n-capture.h, 56\n+capture.h, 44\n dc1394color_coding_t\n-types.h, 65\n+types.h, 64\n dc1394color_codings_t, 11\n dc1394color_filter_t\n-types.h, 65\n+types.h, 64\n dc1394error_t\n log.h, 58\n dc1394feature_info_t\n-control.h, 31\n+control.h, 48\n dc1394feature_mode_t\n-control.h, 32\n+control.h, 48\n dc1394feature_modes_t, 12\n dc1394feature_t\n-control.h, 32\n+control.h, 48\n dc1394featureset_t\n-control.h, 31\n+control.h, 48\n dc1394format7mode_t\n-format7.h, 46\n+format7.h, 34\n dc1394format7modeset_t\n-format7.h, 46\n+format7.h, 34\n dc1394framerate_t\n video.h, 92\n dc1394framerates_t, 12\n dc1394iidc_version_t\n camera.h, 26\n dc1394log_t\n log.h, 58\n@@ -8722,60 +8724,60 @@\n dc1394power_class_t\n camera.h, 26\n dc1394pxl_gpio_mode_t\n pixelink.h, 88\n dc1394pxl_gpio_polarity_t\n pixelink.h, 88\n dc1394speed_t\n-video.h, 93\n+video.h, 92\n dc1394stereo_method_t\n-conversions.h, 41\n+conversions.h, 30\n dc1394switch_t\n types.h, 65\n dc1394trigger_mode_t\n-control.h, 32\n+control.h, 48\n dc1394trigger_modes_t, 12\n dc1394trigger_polarity_t\n-control.h, 32\n+control.h, 49\n dc1394trigger_source_t\n-control.h, 32\n+control.h, 49\n dc1394trigger_sources_t, 13\n dc1394video_frame_t\n video.h, 92\n dc1394video_mode_t\n types.h, 65\n dc1394video_modes_t, 13\n format7.h\n-dc1394_format7_get_color_coding, 46\n-dc1394_format7_get_color_codings, 46\n-dc1394_format7_get_color_filter, 46\n-dc1394_format7_get_data_depth, 47\n-dc1394_format7_get_frame_interval, 47\n-dc1394_format7_get_image_position, 47\n-dc1394_format7_get_image_size, 47\n-dc1394_format7_get_max_image_size, 47\n-dc1394_format7_get_mode_info, 48\n-dc1394_format7_get_modeset, 48\n-dc1394_format7_get_packet_parameters, 48\n-dc1394_format7_get_packet_size, 48\n-dc1394_format7_get_packets_per_frame, 48\n-dc1394_format7_get_pixel_number, 49\n+dc1394_format7_get_color_coding, 34\n+dc1394_format7_get_color_codings, 34\n+dc1394_format7_get_color_filter, 35\n+dc1394_format7_get_data_depth, 35\n+dc1394_format7_get_frame_interval, 35\n+dc1394_format7_get_image_position, 35\n+dc1394_format7_get_image_size, 35\n+dc1394_format7_get_max_image_size, 36\n+dc1394_format7_get_mode_info, 36\n+dc1394_format7_get_modeset, 36\n+dc1394_format7_get_packet_parameters, 36\n+dc1394_format7_get_packet_size, 36\n+dc1394_format7_get_packets_per_frame, 37\n+dc1394_format7_get_pixel_number, 37\n dc1394_format7_get_recommended_packet_size,\n-49\n-dc1394_format7_get_roi, 49\n-dc1394_format7_get_total_bytes, 49\n-dc1394_format7_get_unit_position, 49\n-dc1394_format7_get_unit_size, 50\n-dc1394_format7_set_color_coding, 50\n-dc1394_format7_set_image_position, 50\n-dc1394_format7_set_image_size, 50\n-dc1394_format7_set_packet_size, 50\n-dc1394_format7_set_roi, 51\n-dc1394format7mode_t, 46\n-dc1394format7modeset_t, 46\n+37\n+dc1394_format7_get_roi, 37\n+dc1394_format7_get_total_bytes, 37\n+dc1394_format7_get_unit_position, 38\n+dc1394_format7_get_unit_size, 38\n+dc1394_format7_set_color_coding, 38\n+dc1394_format7_set_image_position, 38\n+dc1394_format7_set_image_size, 38\n+dc1394_format7_set_packet_size, 39\n+dc1394_format7_set_roi, 39\n+dc1394format7mode_t, 34\n+dc1394format7modeset_t, 34\n fw_cdev_add_descriptor, 13\n fw_cdev_allocate, 14\n fw_cdev_allocate_iso_resource, 14\n fw_cdev_create_iso_context, 15\n fw_cdev_deallocate, 15\n \n INDEX\n@@ -8796,111 +8798,111 @@\n fw_cdev_remove_descriptor, 22\n fw_cdev_send_request, 22\n fw_cdev_send_response, 22\n fw_cdev_send_stream_packet, 23\n fw_cdev_start_iso, 23\n fw_cdev_stop_iso, 24\n iso.h\n-dc1394_iso_allocate_bandwidth, 52\n-dc1394_iso_allocate_channel, 52\n-dc1394_iso_release_all, 53\n-dc1394_iso_release_bandwidth, 53\n-dc1394_iso_release_channel, 54\n-dc1394_iso_set_persist, 54\n+dc1394_iso_allocate_bandwidth, 40\n+dc1394_iso_allocate_channel, 40\n+dc1394_iso_release_all, 41\n+dc1394_iso_release_bandwidth, 41\n+dc1394_iso_release_channel, 42\n+dc1394_iso_set_persist, 42\n log.h\n dc1394_log_debug, 58\n-dc1394_log_error, 59\n+dc1394_log_error, 58\n dc1394_log_register_handler, 59\n dc1394_log_set_default_handler, 59\n dc1394_log_warning, 59\n dc1394error_t, 58\n dc1394log_t, 58\n pixelink.h\n dc1394_pxl_adv_feature_info_t, 88\n dc1394_pxl_camera_info_t, 88\n-dc1394_pxl_convert_float32_to_quadlet, 89\n-dc1394_pxl_convert_uint32_to_float32, 89\n+dc1394_pxl_convert_float32_to_quadlet, 88\n+dc1394_pxl_convert_uint32_to_float32, 88\n dc1394_pxl_get_camera_info, 89\n dc1394_pxl_get_camera_name, 89\n dc1394_pxl_get_camera_serial_number, 89\n dc1394_pxl_get_gpo_config, 89\n-dc1394_pxl_get_gpo_param, 90\n-dc1394_pxl_get_gpo_param_min_max, 90\n+dc1394_pxl_get_gpo_param, 89\n+dc1394_pxl_get_gpo_param_min_max, 89\n dc1394_pxl_gpio_info_t, 88\n dc1394_pxl_print_camera_info, 90\n dc1394_pxl_set_gpio_mode_param, 90\n dc1394_pxl_set_gpo_config, 90\n dc1394pxl_gpio_mode_t, 88\n dc1394pxl_gpio_polarity_t, 88\n register.h\n-dc1394_get_absolute_register, 61\n-dc1394_get_adv_control_registers, 61\n+dc1394_get_absolute_register, 60\n+dc1394_get_adv_control_registers, 60\n dc1394_get_control_registers, 61\n \n Generated by Doxygen\n \n \fINDEX\n \n dc1394_get_format7_register, 61\n dc1394_get_PIO_register, 61\n dc1394_get_registers, 61\n-dc1394_get_SIO_register, 62\n+dc1394_get_SIO_register, 61\n dc1394_get_strobe_register, 62\n dc1394_set_absolute_register, 62\n dc1394_set_adv_control_registers, 62\n dc1394_set_control_registers, 62\n-dc1394_set_format7_register, 63\n+dc1394_set_format7_register, 62\n dc1394_set_PIO_register, 63\n dc1394_set_registers, 63\n dc1394_set_SIO_register, 63\n dc1394_set_strobe_register, 63\n types.h\n dc1394bool_t, 64\n dc1394byte_order_t, 64\n-dc1394color_coding_t, 65\n-dc1394color_filter_t, 65\n+dc1394color_coding_t, 64\n+dc1394color_filter_t, 64\n dc1394switch_t, 65\n dc1394video_mode_t, 65\n utils.h\n dc1394_checksum_crc16, 66\n dc1394_error_get_string, 66\n dc1394_feature_get_string, 66\n-dc1394_framerate_as_float, 67\n-dc1394_get_color_coding_bit_size, 67\n-dc1394_get_color_coding_data_depth, 67\n+dc1394_framerate_as_float, 66\n+dc1394_get_color_coding_bit_size, 66\n+dc1394_get_color_coding_data_depth, 66\n dc1394_get_color_coding_from_video_mode, 67\n dc1394_get_image_size_from_video_mode, 67\n dc1394_is_color, 67\n-dc1394_is_same_camera, 68\n-dc1394_is_video_mode_scalable, 68\n-dc1394_is_video_mode_still_image, 68\n+dc1394_is_same_camera, 67\n+dc1394_is_video_mode_scalable, 67\n+dc1394_is_video_mode_still_image, 67\n video.h\n dc1394_video_get_bandwidth_usage, 93\n dc1394_video_get_data_depth, 93\n dc1394_video_get_framerate, 93\n dc1394_video_get_iso_channel, 93\n-dc1394_video_get_iso_speed, 94\n-dc1394_video_get_mode, 94\n+dc1394_video_get_iso_speed, 93\n+dc1394_video_get_mode, 93\n dc1394_video_get_multi_shot, 94\n dc1394_video_get_one_shot, 94\n dc1394_video_get_operation_mode, 94\n dc1394_video_get_supported_framerates, 94\n-dc1394_video_get_supported_modes, 95\n-dc1394_video_get_transmission, 95\n+dc1394_video_get_supported_modes, 94\n+dc1394_video_get_transmission, 94\n dc1394_video_set_framerate, 95\n dc1394_video_set_iso_channel, 95\n dc1394_video_set_iso_speed, 95\n dc1394_video_set_mode, 95\n-dc1394_video_set_multi_shot, 96\n-dc1394_video_set_one_shot, 96\n+dc1394_video_set_multi_shot, 95\n+dc1394_video_set_one_shot, 95\n dc1394_video_set_operation_mode, 96\n dc1394_video_set_transmission, 96\n dc1394framerate_t, 92\n dc1394operation_mode_t, 92\n Generated by Doxygen\n \n 105\n \n-dc1394speed_t, 93\n+dc1394speed_t, 92\n dc1394video_frame_t, 92\n \n \f\n"}]}]}]}]}]}]}